diff --git a/.gitea/workflows/docker-build.yml b/.gitea/workflows/docker-build.yml index 4cd51dc..54bee39 100644 --- a/.gitea/workflows/docker-build.yml +++ b/.gitea/workflows/docker-build.yml @@ -7,7 +7,7 @@ on: jobs: build: - runs-on: ubuntu-latest + runs-on: ap-host steps: - run: which docker && docker --version diff --git a/Source/ProofOfConcept/Models/Token.cs b/Source/ProofOfConcept/Models/Token.cs new file mode 100644 index 0000000..85cbffa --- /dev/null +++ b/Source/ProofOfConcept/Models/Token.cs @@ -0,0 +1,15 @@ +namespace ProofOfConcept.Models; + +public record Token +{ + public string AccessToken { get; init; } + public DateTimeOffset Expires { get; init; } + public string TokenType { get; init; } + + public Token(string AccessToken, int ExpiresIn, string TokenType, DateTimeOffset? received = null) + { + this.AccessToken = AccessToken; + this.Expires = received?.AddSeconds(ExpiresIn) ?? DateTimeOffset.Now.AddSeconds(ExpiresIn); + this.TokenType = TokenType; + } +} \ No newline at end of file diff --git a/Source/ProofOfConcept/Pages/Index.cshtml b/Source/ProofOfConcept/Pages/Index.cshtml new file mode 100644 index 0000000..4c20080 --- /dev/null +++ b/Source/ProofOfConcept/Pages/Index.cshtml @@ -0,0 +1,40 @@ +@page +@model ProofOfConcept.Pages.Index + + + + + + + + + Launching soon! + + + + + + + + + + + +
+
+
+

Our website is launching soon..

+

We are working hard to finish the development of this site.

+

info@automatic-parking.app | automatic-parking.app

+
+
+
+ + + + \ No newline at end of file diff --git a/Source/ProofOfConcept/Pages/Index.cshtml.cs b/Source/ProofOfConcept/Pages/Index.cshtml.cs new file mode 100644 index 0000000..5af2a7e --- /dev/null +++ b/Source/ProofOfConcept/Pages/Index.cshtml.cs @@ -0,0 +1,11 @@ +using Microsoft.AspNetCore.Mvc.RazorPages; + +namespace ProofOfConcept.Pages; + +public class Index : PageModel +{ + public void OnGet() + { + + } +} \ No newline at end of file diff --git a/Source/ProofOfConcept/Program.cs b/Source/ProofOfConcept/Program.cs index 3a66953..ef66a0e 100644 --- a/Source/ProofOfConcept/Program.cs +++ b/Source/ProofOfConcept/Program.cs @@ -1,31 +1,45 @@ +using Microsoft.AspNetCore.Mvc; using Microsoft.Extensions.Caching.Memory; using ProofOfConcept.Services; +using ProofOfConcept.Utilities; var builder = WebApplication.CreateSlimBuilder(args); +// Load static web assets manifest (referenced libs + your wwwroot) +builder.WebHost.UseStaticWebAssets(); + // builder.Services.ConfigureHttpJsonOptions(options => { options.SerializerOptions.TypeInfoResolverChain.Insert(0, AppJsonSerializerContext.Default); }); +// Add services builder.Services.AddOpenApi(); builder.Services.AddMediator(); builder.Services.AddMemoryCache(); builder.Services.AddHybridCache(); +builder.Services.AddHttpClient(); +builder.Services.AddRazorPages(); +// Add own services builder.Services.AddSingleton(); +builder.Services.AddTransient(); +// Add hosted services builder.Services.AddHostedService(); builder.Services.AddHostedService(); -var app = builder.Build(); +//Build app +WebApplication app = builder.Build(); if (app.Environment.IsDevelopment()) { app.MapOpenApi(); + app.MapGet("/GetPartnerAuthenticationToken", ([FromServices] TeslaAuthenticatorService service) => service.AcquirePartnerAuthenticationTokenAsync()); + app.MapGet("/CheckRegisteredApplication", ([FromServices] TeslaAuthenticatorService service) => service.CheckApplicationRegistrationAsync()); + app.MapGet("/RegisterApplication", ([FromServices] TeslaAuthenticatorService service) => service.RegisterApplicationAsync()); } -//Map tesla required public key file -app.MapGet("/.well-known/appspecific/com.tesla.3p.public-key.pem", (IMemoryCache memoryCache) => memoryCache.GetOrCreateAsync("publicKeyCert", async (_) => await File.ReadAllTextAsync("Resources/Signature/public-key.pem"))); +//Map static assets +app.MapStaticAssets(); -//Map an under constrcution page... -app.Map("/", ()=> "Under construction..."); +app.MapRazorPages(); app.Run(); \ No newline at end of file diff --git a/Source/ProofOfConcept/ProofOfConcept.csproj b/Source/ProofOfConcept/ProofOfConcept.csproj index ef4e7da..5e55dab 100644 --- a/Source/ProofOfConcept/ProofOfConcept.csproj +++ b/Source/ProofOfConcept/ProofOfConcept.csproj @@ -6,7 +6,7 @@ enable true true - true + Linux @@ -20,6 +20,7 @@ + @@ -28,14 +29,9 @@ - - - - - - PreserveNewest + Never diff --git a/Source/ProofOfConcept/Services/TeslaAuthenticatorService.cs b/Source/ProofOfConcept/Services/TeslaAuthenticatorService.cs new file mode 100644 index 0000000..ed8b855 --- /dev/null +++ b/Source/ProofOfConcept/Services/TeslaAuthenticatorService.cs @@ -0,0 +1,153 @@ +using System.Net.Http.Headers; +using System.Text.Json; +using Microsoft.Extensions.Caching.Memory; +using Microsoft.Extensions.Options; +using ProofOfConcept.Models; +using ProofOfConcept.Utilities; +using SzakatsA.Result; + +namespace ProofOfConcept.Services; + +public class TeslaAuthenticatorService +{ + private readonly ILogger logger; + private readonly TeslaAuthenticatorServiceConfiguration configuration; + private readonly IHttpClientFactory httpClientFactory; + private readonly IMemoryCache memoryCache; + + const string authEndpointURL = "https://fleet-auth.prd.vn.cloud.tesla.com/oauth2/v3/token"; + const string euBaseURL = "https://fleet-api.prd.eu.vn.cloud.tesla.com"; + + public TeslaAuthenticatorService(ILogger logger, IOptions options, IHttpClientFactory httpClientFactory, IMemoryCache memoryCache) + { + this.logger = logger; + this.httpClientFactory = httpClientFactory; + this.memoryCache = memoryCache; + this.configuration = options.Value; + } + + /// Asynchronously retrieves an authentication token from the Tesla partner API. + /// This method sends a POST request with client credentials to obtain an + /// OAuth2 access token that grants access to Tesla partner services. + /// Returns a string containing the authentication token received from the API. + /// Thrown when the HTTP request to the API fails. + public async Task AcquirePartnerAuthenticationTokenAsync() + { + this.logger.LogTrace("Acquiring authentication token from Tesla partner API..."); + + using HttpClient client = httpClientFactory.CreateClient(); + + // URL to request the token + const string audience = euBaseURL; + + // Prepare the form-urlencoded body + Dictionary formData = new Dictionary + { + { "grant_type", "client_credentials" }, + { "client_id", this.configuration.ClientID }, + { "client_secret", this.configuration.ClientSecret }, + { "scope", "openid offline_access vehicle_device_data vehicle_location" }, + { "audience", audience } + }; + + FormUrlEncodedContent content = new FormUrlEncodedContent(formData); + + // Send POST request + HttpResponseMessage response = await client.PostAsync(authEndpointURL, content); + this.logger.LogTrace("Response status code: {0}", response.StatusCode); + + // Throw if not successful + response.EnsureSuccessStatusCode(); + + // Read the response body as a string + string json = await response.Content.ReadAsStringAsync(); + + // Deserialize + Token? result = JsonSerializer.Deserialize(json); + + if (result is null) + throw new FormatException($"Could not deserialize token response: {json}"); + + // Return the token response + return result; + } + + /// Retrieves a cached partner authentication token or acquires a new one if not available. + /// This method first attempts to fetch the token from the memory cache. If the token is not found + /// or has expired, it invokes the method to retrieve a new token from the Tesla partner API and stores it in the cache. + /// The cached token is set to expire slightly earlier than its actual expiration time to avoid unexpected token expiry during usage. + /// Returns a Token object containing the authentication token and its expiration details. + /// Thrown when the HTTP request to acquire a new partner token fails. + /// Thrown for any unexpected errors during the token retrieval or caching process. + public async Task GetPartnerAuthenticationTokenAsync() + { + this.logger.LogTrace("Getting partner authentication token..."); + + //Token is available in cache + if (this.memoryCache.TryGetValue(Keys.TeslaPartnerToken, out Token? token) && token is not null) + { + this.logger.LogInformation("Partner authentication token provided from cache"); + return token; + } + + //Acquire token + token = await AcquirePartnerAuthenticationTokenAsync(); + + //Save to cache + this.memoryCache.Set(Keys.TeslaPartnerToken, token, token.Expires.Subtract(this.configuration.MemoryCacheDelta)); + + this.logger.LogInformation("Partner authentication token provided provided by acquiring from API"); + return token; + } + + public async Task RegisterApplicationAsync(CancellationToken cancellationToken = default(CancellationToken)) + { + this.logger.LogTrace("Registering application to Tesla fleet API..."); + + //Create client and get partner token + HttpClient httpClient = httpClientFactory.CreateClient(); + Token partnerToken = await GetPartnerAuthenticationTokenAsync(); + + //Set headers + httpClient.DefaultRequestHeaders.Accept.Add(new MediaTypeWithQualityHeaderValue("application/json")); + httpClient.DefaultRequestHeaders.Authorization = new AuthenticationHeaderValue("Bearer", partnerToken.AccessToken); + + //Prepare body + var postBody = new { domain = this.configuration.Domain }; + + //Send request + HttpResponseMessage response = await httpClient.PostAsJsonAsync($"{euBaseURL}/api/1/partner_accounts", postBody, cancellationToken); + bool success = response.IsSuccessStatusCode; + + logger.LogInformation("Application registration result: {Success}", success ? "Success" : "Failed"); + return new Result(success); + } + + public async Task> CheckApplicationRegistrationAsync(CancellationToken cancellationToken = default(CancellationToken)) + { + this.logger.LogTrace("Checking application registration..."); + + //Create client and get partner token + HttpClient httpClient = httpClientFactory.CreateClient(); + Token partnerToken = await GetPartnerAuthenticationTokenAsync(); + + //Set headers + httpClient.DefaultRequestHeaders.Accept.Add(new MediaTypeWithQualityHeaderValue("application/json")); + httpClient.DefaultRequestHeaders.Authorization = new AuthenticationHeaderValue("Bearer", partnerToken.AccessToken); + + //Send request + HttpResponseMessage response = await httpClient.GetAsync($"{euBaseURL}/api/1/partner_accounts", cancellationToken); + string responseBody = await response.Content.ReadAsStringAsync(cancellationToken); + + logger.LogInformation("Application registration result: {Result}", responseBody); + return new Result(); + } +} + +public class TeslaAuthenticatorServiceConfiguration +{ + public string ClientID { get; set; } = "b2240ee4-332a-4252-91aa-bbcc24f78fdb"; + public string ClientSecret { get; set; } = "ta-secret.YG+XSdlvr6Lv8U-x"; + public TimeSpan MemoryCacheDelta { get; set; } = TimeSpan.FromSeconds(5); + public string Domain { get; set; } = "tesla-connector.automatic-parking.app"; +} \ No newline at end of file diff --git a/Source/ProofOfConcept/Utilities/Keys.cs b/Source/ProofOfConcept/Utilities/Keys.cs new file mode 100644 index 0000000..7255d35 --- /dev/null +++ b/Source/ProofOfConcept/Utilities/Keys.cs @@ -0,0 +1,7 @@ +namespace ProofOfConcept.Utilities; + +public static class Keys +{ + public const string PublicKeyCert = "PublicKeyCert"; + public const string TeslaPartnerToken = "PartnerToken"; +} \ No newline at end of file diff --git a/Source/ProofOfConcept/wwwroot/.well-known/appspecific/com.tesla.3p.public-key.pem b/Source/ProofOfConcept/wwwroot/.well-known/appspecific/com.tesla.3p.public-key.pem new file mode 100644 index 0000000..c51fdc9 --- /dev/null +++ b/Source/ProofOfConcept/wwwroot/.well-known/appspecific/com.tesla.3p.public-key.pem @@ -0,0 +1,4 @@ +-----BEGIN PUBLIC KEY----- +MFkwEwYHKoZIzj0CAQYIKoZIzj0DAQcDQgAE/2+0ZNUwcsa7C2kkQa6J4egse3+N +TnFd7DKlLOcEZGrCBn/mfxsZUpQoVCeoh4j6w5ue471Ott70qpsRuOtjbQ== +-----END PUBLIC KEY----- \ No newline at end of file diff --git a/Source/ProofOfConcept/wwwroot/assets/css/style.min.css b/Source/ProofOfConcept/wwwroot/assets/css/style.min.css new file mode 100644 index 0000000..12454a1 --- /dev/null +++ b/Source/ProofOfConcept/wwwroot/assets/css/style.min.css @@ -0,0 +1,12324 @@ +/*! +* Start Bootstrap - Coming Soon v6.0.7 (https://startbootstrap.com/theme/coming-soon) +* Copyright 2013-2023 Start Bootstrap +* Licensed under MIT (https://github.com/StartBootstrap/startbootstrap-coming-soon/blob/master/LICENSE) +*/ +/*! + * Bootstrap v5.2.3 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +@font-face { + font-family: "Open Sauce Sans"; + src: url("/assets/fonts/open-sauce-sans-latin-400-normal.woff") format("woff"), url("/assets/fonts/open-sauce-sans-latin-400-italic.woff") format("woff") +} + +:root { + --bs-blue: #0d6efd; + --bs-indigo: #6610f2; + --bs-purple: #6f42c1; + --bs-pink: #d63384; + --bs-red: #dc3545; + --bs-orange: #fd7e14; + --bs-yellow: #ffc107; + --bs-green: #198754; + --bs-teal: #20c997; + --bs-cyan: #0dcaf0; + --bs-black: #000; + --bs-white: #fff; + --bs-gray: #6c757d; + --bs-gray-dark: #343a40; + --bs-gray-100: #f8f9fa; + --bs-gray-200: #e9ecef; + --bs-gray-300: #dee2e6; + --bs-gray-400: #ced4da; + --bs-gray-500: #adb5bd; + --bs-gray-600: #6c757d; + --bs-gray-700: #495057; + --bs-gray-800: #343a40; + --bs-gray-900: #000000; + --bs-primary: #2a5555; + --bs-secondary: #6c757d; + --bs-success: #198754; + --bs-info: #0dcaf0; + --bs-warning: #ffc107; + --bs-danger: #dc3545; + --bs-light: #f8f9fa; + --bs-dark: #000000; + --bs-primary-rgb: 42, 85, 85; + --bs-secondary-rgb: 108, 117, 125; + --bs-success-rgb: 25, 135, 84; + --bs-info-rgb: 13, 202, 240; + --bs-warning-rgb: 255, 193, 7; + --bs-danger-rgb: 220, 53, 69; + --bs-light-rgb: 248, 249, 250; + --bs-dark-rgb: 0, 0, 0; + --bs-white-rgb: 255, 255, 255; + --bs-black-rgb: 0, 0, 0; + --bs-body-color-rgb: 0, 0, 0; + --bs-body-bg-rgb: 255, 255, 255; + --bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; + --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0)); + --bs-body-font-family: "Open Source Sans", -apple-system, BlinkMacSystemFont, Segoe UI, Roboto, Helvetica Neue, Arial, sans-serif, Apple Color Emoji, Segoe UI Emoji, Segoe UI Symbol, Noto Color Emoji; + --bs-body-font-size: 1rem; + --bs-body-font-weight: 400; + --bs-body-line-height: 1.5; + --bs-body-color: #000000; + --bs-body-bg: #fff; + --bs-border-width: 1px; + --bs-border-style: solid; + --bs-border-color: #dee2e6; + --bs-border-color-translucent: rgba(0, 0, 0, 0.175); + --bs-border-radius: 0.375rem; + --bs-border-radius-sm: 0.25rem; + --bs-border-radius-lg: 0.5rem; + --bs-border-radius-xl: 1rem; + --bs-border-radius-2xl: 2rem; + --bs-border-radius-pill: 50rem; + --bs-link-color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)); + --bs-link-hover-color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)); + --bs-code-color: #d63384; + --bs-highlight-bg: #fff3cd +} + +*, * ::before, * ::after { + box-sizing:border-box +} + +@media (prefers-reduced-motion: no-preference) { + :root { + scroll-behavior:smooth + } +} + +body { + margin: 0; + font-family: var(--bs-body-font-family); + font-size: var(--bs-body-font-size); + font-weight: var(--bs-body-font-weight); + line-height: var(--bs-body-line-height); + color: var(--bs-body-color); + text-align: var(--bs-body-text-align); + background-color: var(--bs-body-bg); + -webkit-text-size-adjust: 100%; + -webkit-tap-highlight-color:rgba(0, 0, 0, 0) +} + +hr { + margin: 1rem 0; + color: inherit; + border: 0; + border-top: 1px solid; + opacity:.25 +} + +h6, .h6, h5, .h5, h4, .h4, h3, .h3, h2, .h2, h1, .h1 { + margin-top: 0; + margin-bottom: .5rem; + font-family: "Open Sauce Sans", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + font-weight: 700; + line-height:1.2 +} + +h1, .h1 { + font-size:calc(1.375rem + 1.5vw) +} + +@media (min-width: 1200px) { + h1, .h1 { + font-size:2.5rem + } +} + +h2, .h2 { + font-size:calc(1.325rem + .9vw) +} + +@media (min-width: 1200px) { + h2, .h2 { + font-size:2rem + } +} + +h3, .h3 { + font-size:calc(1.3rem + .6vw) +} + +@media (min-width: 1200px) { + h3, .h3 { + font-size:1.75rem + } +} + +h4, .h4 { + font-size:calc(1.275rem + .3vw) +} + +@media (min-width: 1200px) { + h4, .h4 { + font-size:1.5rem + } +} + +h5, .h5 { + font-size:1.25rem +} + +h6, .h6 { + font-size:1rem +} + +p { + margin-top: 0; + margin-bottom:1rem +} + +abbr[title] { + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + -webkit-text-decoration-skip-ink: none; + text-decoration-skip-ink:none +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height:inherit +} + +ol, ul { + padding-left:2rem +} + +ol, ul, dl { + margin-top: 0; + margin-bottom:1rem +} + +ol ol, ul ul, ol ul, ul ol { + margin-bottom:0 +} + +dt { + font-weight:700 +} + +dd { + margin-bottom: .5rem; + margin-left:0 +} + +blockquote { + margin:0 0 1rem +} + +b, strong { + font-weight:bolder +} + +small, .small { + font-size:.875em +} + +mark, .mark { + padding: .1875em; + background-color:var(--bs-highlight-bg) +} + +sub, sup { + position: relative; + font-size: .75em; + line-height: 0; + vertical-align:baseline +} + +sub { + bottom:-0.25em +} + +sup { + top:-0.5em +} + +a { + color: var(--bs-link-color); + text-decoration:none +} + +a:hover { + color: var(--bs-link-hover-color); + text-decoration:underline +} + +a:not([href]):not([class]), a:not([href]):not([class]):hover { + color: inherit; + text-decoration:none +} + +pre, code, kbd, samp { + font-family: var(--bs-font-monospace); + font-size:1em +} + +pre { + display: block; + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + font-size:.875em +} + +pre code { + font-size: inherit; + color: inherit; + word-break:normal +} + +code { + font-size: .875em; + color: var(--bs-code-color); + word-wrap:break-word +} + +a > code { + color:inherit +} + +kbd { + padding: .1875rem .375rem; + font-size: .875em; + color: var(--bs-body-bg); + background-color: var(--bs-body-color); + border-radius:.25rem +} + +kbd kbd { + padding: 0; + font-size:1em +} + +figure { + margin:0 0 1rem +} + +img, svg { + vertical-align:middle +} + +table { + caption-side: bottom; + border-collapse:collapse +} + +caption { + padding-top: .5rem; + padding-bottom: .5rem; + color: #6c757d; + text-align:left +} + +th { + text-align: inherit; + text-align:-webkit-match-parent +} + +thead, tbody, tfoot, tr, td, th { + border-color: inherit; + border-style: solid; + border-width:0 +} + +label { + display:inline-block +} + +button { + border-radius:0 +} + +button:focus:not(:focus-visible) { + outline:0 +} + +input, button, select, optgroup, textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height:inherit +} + +button, select { + text-transform:none +} + +[role=button] { + cursor:pointer +} + +select { + word-wrap:normal +} + +select:disabled { + opacity:1 +} + +[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator { + display:none !important +} + +button, [type=button], [type=reset], [type=submit] { + -webkit-appearance:button +} + +button:not(:disabled), [type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled) { + cursor:pointer +} + +::-moz-focus-inner { + padding: 0; + border-style:none +} + +textarea { + resize:vertical +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border:0 +} + +legend { + float: left; + width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: calc(1.275rem + .3vw); + line-height:inherit +} + +@media (min-width: 1200px) { + legend { + font-size:1.5rem + } +} + +legend + * { + clear:left +} + +::-webkit-datetime-edit-fields-wrapper, ::-webkit-datetime-edit-text, ::-webkit-datetime-edit-minute, ::-webkit-datetime-edit-hour-field, ::-webkit-datetime-edit-day-field, ::-webkit-datetime-edit-month-field, ::-webkit-datetime-edit-year-field { + padding:0 +} + +::-webkit-inner-spin-button { + height:auto +} + +[type=search] { + outline-offset: -2px; + -webkit-appearance:textfield +} + +::-webkit-search-decoration { + -webkit-appearance:none +} + +::-webkit-color-swatch-wrapper { + padding:0 +} + +::file-selector-button { + font: inherit; + -webkit-appearance:button +} + +output { + display:inline-block +} + +iframe { + border:0 +} + +summary { + display: list-item; + cursor:pointer +} + +progress { + vertical-align:baseline +} + +[hidden] { + display:none !important +} + +.lead { + font-size: 1.25rem; + font-weight:300 +} + +.display-1 { + font-size: calc(1.625rem + 4.5vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-1 { + font-size:5rem + } +} + +.display-2 { + font-size: calc(1.575rem + 3.9vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-2 { + font-size:4.5rem + } +} + +.display-3 { + font-size: calc(1.525rem + 3.3vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-3 { + font-size:4rem + } +} + +.display-4 { + font-size: calc(1.475rem + 2.7vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-4 { + font-size:3.5rem + } +} + +.display-5 { + font-size: calc(1.425rem + 2.1vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-5 { + font-size:3rem + } +} + +.display-6 { + font-size: calc(1.375rem + 1.5vw); + font-weight: 300; + line-height:1.2 +} + +@media (min-width: 1200px) { + .display-6 { + font-size:2.5rem + } +} + +.list-unstyled { + padding-left: 0; + list-style:none +} + +.list-inline { + padding-left: 0; + list-style:none +} + +.list-inline-item { + display:inline-block +} + +.list-inline-item:not(:last-child) { + margin-right:.5rem +} + +.initialism { + font-size: .875em; + text-transform:uppercase +} + +.blockquote { + margin-bottom: 1rem; + font-size:1.25rem +} + +.blockquote > :last-child { + margin-bottom:0 +} + +.blockquote-footer { + margin-top: -1rem; + margin-bottom: 1rem; + font-size: .875em; + color:#6c757d +} + +.blockquote-footer::before { + content: "— " +} + +.img-fluid { + max-width: 100%; + height:auto +} + +.img-thumbnail { + padding: .25rem; + background-color: #fff; + border: 1px solid var(--bs-border-color); + border-radius: .375rem; + max-width: 100%; + height:auto +} + +.figure { + display:inline-block +} + +.figure-img { + margin-bottom: .5rem; + line-height:1 +} + +.figure-caption { + font-size: .875em; + color:#6c757d +} + +.container, .container-fluid, .container-xxl, .container-xl, .container-lg, .container-md, .container-sm { + --bs-gutter-x: 1.5rem; + --bs-gutter-y: 0; + width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-right: auto; + margin-left:auto +} + +@media (min-width: 576px) { + .container-sm, .container { + max-width:540px + } +} + +@media (min-width: 768px) { + .container-md, .container-sm, .container { + max-width:720px + } +} + +@media (min-width: 992px) { + .container-lg, .container-md, .container-sm, .container { + max-width:960px + } +} + +@media (min-width: 1200px) { + .container-xl, .container-lg, .container-md, .container-sm, .container { + max-width:1140px + } +} + +@media (min-width: 1400px) { + .container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container { + max-width:1320px + } +} + +.row { + --bs-gutter-x: 1.5rem; + --bs-gutter-y: 0; + display: flex; + flex-wrap: wrap; + margin-top: calc(-1 * var(--bs-gutter-y)); + margin-right: calc(-0.5 * var(--bs-gutter-x)); + margin-left:calc(-0.5 * var(--bs-gutter-x)) +} + +.row > * { + flex-shrink: 0; + width: 100%; + max-width: 100%; + padding-right: calc(var(--bs-gutter-x) * .5); + padding-left: calc(var(--bs-gutter-x) * .5); + margin-top:var(--bs-gutter-y) +} + +.col { + flex:1 0 0% +} + +.row-cols-auto > * { + flex: 0 0 auto; + width:auto +} + +.row-cols-1 > * { + flex: 0 0 auto; + width:100% +} + +.row-cols-2 > * { + flex: 0 0 auto; + width:50% +} + +.row-cols-3 > * { + flex: 0 0 auto; + width:33.3333333333% +} + +.row-cols-4 > * { + flex: 0 0 auto; + width:25% +} + +.row-cols-5 > * { + flex: 0 0 auto; + width:20% +} + +.row-cols-6 > * { + flex: 0 0 auto; + width:16.6666666667% +} + +.col-auto { + flex: 0 0 auto; + width:auto +} + +.col-1 { + flex: 0 0 auto; + width:8.33333333% +} + +.col-2 { + flex: 0 0 auto; + width:16.66666667% +} + +.col-3 { + flex: 0 0 auto; + width:25% +} + +.col-4 { + flex: 0 0 auto; + width:33.33333333% +} + +.col-5 { + flex: 0 0 auto; + width:41.66666667% +} + +.col-6 { + flex: 0 0 auto; + width:50% +} + +.col-7 { + flex: 0 0 auto; + width:58.33333333% +} + +.col-8 { + flex: 0 0 auto; + width:66.66666667% +} + +.col-9 { + flex: 0 0 auto; + width:75% +} + +.col-10 { + flex: 0 0 auto; + width:83.33333333% +} + +.col-11 { + flex: 0 0 auto; + width:91.66666667% +} + +.col-12 { + flex: 0 0 auto; + width:100% +} + +.offset-1 { + margin-left:8.33333333% +} + +.offset-2 { + margin-left:16.66666667% +} + +.offset-3 { + margin-left:25% +} + +.offset-4 { + margin-left:33.33333333% +} + +.offset-5 { + margin-left:41.66666667% +} + +.offset-6 { + margin-left:50% +} + +.offset-7 { + margin-left:58.33333333% +} + +.offset-8 { + margin-left:66.66666667% +} + +.offset-9 { + margin-left:75% +} + +.offset-10 { + margin-left:83.33333333% +} + +.offset-11 { + margin-left:91.66666667% +} + +.g-0, .gx-0 { + --bs-gutter-x: 0 +} + +.g-0, .gy-0 { + --bs-gutter-y: 0 +} + +.g-1, .gx-1 { + --bs-gutter-x: 0.25rem +} + +.g-1, .gy-1 { + --bs-gutter-y: 0.25rem +} + +.g-2, .gx-2 { + --bs-gutter-x: 0.5rem +} + +.g-2, .gy-2 { + --bs-gutter-y: 0.5rem +} + +.g-3, .gx-3 { + --bs-gutter-x: 1rem +} + +.g-3, .gy-3 { + --bs-gutter-y: 1rem +} + +.g-4, .gx-4 { + --bs-gutter-x: 1.5rem +} + +.g-4, .gy-4 { + --bs-gutter-y: 1.5rem +} + +.g-5, .gx-5 { + --bs-gutter-x: 3rem +} + +.g-5, .gy-5 { + --bs-gutter-y: 3rem +} + +@media (min-width: 576px) { + .col-sm { + flex:1 0 0% + } + + .row-cols-sm-auto > * { + flex: 0 0 auto; + width:auto + } + + .row-cols-sm-1 > * { + flex: 0 0 auto; + width:100% + } + + .row-cols-sm-2 > * { + flex: 0 0 auto; + width:50% + } + + .row-cols-sm-3 > * { + flex: 0 0 auto; + width:33.3333333333% + } + + .row-cols-sm-4 > * { + flex: 0 0 auto; + width:25% + } + + .row-cols-sm-5 > * { + flex: 0 0 auto; + width:20% + } + + .row-cols-sm-6 > * { + flex: 0 0 auto; + width:16.6666666667% + } + + .col-sm-auto { + flex: 0 0 auto; + width:auto + } + + .col-sm-1 { + flex: 0 0 auto; + width:8.33333333% + } + + .col-sm-2 { + flex: 0 0 auto; + width:16.66666667% + } + + .col-sm-3 { + flex: 0 0 auto; + width:25% + } + + .col-sm-4 { + flex: 0 0 auto; + width:33.33333333% + } + + .col-sm-5 { + flex: 0 0 auto; + width:41.66666667% + } + + .col-sm-6 { + flex: 0 0 auto; + width:50% + } + + .col-sm-7 { + flex: 0 0 auto; + width:58.33333333% + } + + .col-sm-8 { + flex: 0 0 auto; + width:66.66666667% + } + + .col-sm-9 { + flex: 0 0 auto; + width:75% + } + + .col-sm-10 { + flex: 0 0 auto; + width:83.33333333% + } + + .col-sm-11 { + flex: 0 0 auto; + width:91.66666667% + } + + .col-sm-12 { + flex: 0 0 auto; + width:100% + } + + .offset-sm-0 { + margin-left:0 + } + + .offset-sm-1 { + margin-left:8.33333333% + } + + .offset-sm-2 { + margin-left:16.66666667% + } + + .offset-sm-3 { + margin-left:25% + } + + .offset-sm-4 { + margin-left:33.33333333% + } + + .offset-sm-5 { + margin-left:41.66666667% + } + + .offset-sm-6 { + margin-left:50% + } + + .offset-sm-7 { + margin-left:58.33333333% + } + + .offset-sm-8 { + margin-left:66.66666667% + } + + .offset-sm-9 { + margin-left:75% + } + + .offset-sm-10 { + margin-left:83.33333333% + } + + .offset-sm-11 { + margin-left:91.66666667% + } + + .g-sm-0, .gx-sm-0 { + --bs-gutter-x: 0 + } + + .g-sm-0, .gy-sm-0 { + --bs-gutter-y: 0 + } + + .g-sm-1, .gx-sm-1 { + --bs-gutter-x: 0.25rem + } + + .g-sm-1, .gy-sm-1 { + --bs-gutter-y: 0.25rem + } + + .g-sm-2, .gx-sm-2 { + --bs-gutter-x: 0.5rem + } + + .g-sm-2, .gy-sm-2 { + --bs-gutter-y: 0.5rem + } + + .g-sm-3, .gx-sm-3 { + --bs-gutter-x: 1rem + } + + .g-sm-3, .gy-sm-3 { + --bs-gutter-y: 1rem + } + + .g-sm-4, .gx-sm-4 { + --bs-gutter-x: 1.5rem + } + + .g-sm-4, .gy-sm-4 { + --bs-gutter-y: 1.5rem + } + + .g-sm-5, .gx-sm-5 { + --bs-gutter-x: 3rem + } + + .g-sm-5, .gy-sm-5 { + --bs-gutter-y: 3rem + } +} + +@media (min-width: 768px) { + .col-md { + flex:1 0 0% + } + + .row-cols-md-auto > * { + flex: 0 0 auto; + width:auto + } + + .row-cols-md-1 > * { + flex: 0 0 auto; + width:100% + } + + .row-cols-md-2 > * { + flex: 0 0 auto; + width:50% + } + + .row-cols-md-3 > * { + flex: 0 0 auto; + width:33.3333333333% + } + + .row-cols-md-4 > * { + flex: 0 0 auto; + width:25% + } + + .row-cols-md-5 > * { + flex: 0 0 auto; + width:20% + } + + .row-cols-md-6 > * { + flex: 0 0 auto; + width:16.6666666667% + } + + .col-md-auto { + flex: 0 0 auto; + width:auto + } + + .col-md-1 { + flex: 0 0 auto; + width:8.33333333% + } + + .col-md-2 { + flex: 0 0 auto; + width:16.66666667% + } + + .col-md-3 { + flex: 0 0 auto; + width:25% + } + + .col-md-4 { + flex: 0 0 auto; + width:33.33333333% + } + + .col-md-5 { + flex: 0 0 auto; + width:41.66666667% + } + + .col-md-6 { + flex: 0 0 auto; + width:50% + } + + .col-md-7 { + flex: 0 0 auto; + width:58.33333333% + } + + .col-md-8 { + flex: 0 0 auto; + width:66.66666667% + } + + .col-md-9 { + flex: 0 0 auto; + width:75% + } + + .col-md-10 { + flex: 0 0 auto; + width:83.33333333% + } + + .col-md-11 { + flex: 0 0 auto; + width:91.66666667% + } + + .col-md-12 { + flex: 0 0 auto; + width:100% + } + + .offset-md-0 { + margin-left:0 + } + + .offset-md-1 { + margin-left:8.33333333% + } + + .offset-md-2 { + margin-left:16.66666667% + } + + .offset-md-3 { + margin-left:25% + } + + .offset-md-4 { + margin-left:33.33333333% + } + + .offset-md-5 { + margin-left:41.66666667% + } + + .offset-md-6 { + margin-left:50% + } + + .offset-md-7 { + margin-left:58.33333333% + } + + .offset-md-8 { + margin-left:66.66666667% + } + + .offset-md-9 { + margin-left:75% + } + + .offset-md-10 { + margin-left:83.33333333% + } + + .offset-md-11 { + margin-left:91.66666667% + } + + .g-md-0, .gx-md-0 { + --bs-gutter-x: 0 + } + + .g-md-0, .gy-md-0 { + --bs-gutter-y: 0 + } + + .g-md-1, .gx-md-1 { + --bs-gutter-x: 0.25rem + } + + .g-md-1, .gy-md-1 { + --bs-gutter-y: 0.25rem + } + + .g-md-2, .gx-md-2 { + --bs-gutter-x: 0.5rem + } + + .g-md-2, .gy-md-2 { + --bs-gutter-y: 0.5rem + } + + .g-md-3, .gx-md-3 { + --bs-gutter-x: 1rem + } + + .g-md-3, .gy-md-3 { + --bs-gutter-y: 1rem + } + + .g-md-4, .gx-md-4 { + --bs-gutter-x: 1.5rem + } + + .g-md-4, .gy-md-4 { + --bs-gutter-y: 1.5rem + } + + .g-md-5, .gx-md-5 { + --bs-gutter-x: 3rem + } + + .g-md-5, .gy-md-5 { + --bs-gutter-y: 3rem + } +} + +@media (min-width: 992px) { + .col-lg { + flex:1 0 0% + } + + .row-cols-lg-auto > * { + flex: 0 0 auto; + width:auto + } + + .row-cols-lg-1 > * { + flex: 0 0 auto; + width:100% + } + + .row-cols-lg-2 > * { + flex: 0 0 auto; + width:50% + } + + .row-cols-lg-3 > * { + flex: 0 0 auto; + width:33.3333333333% + } + + .row-cols-lg-4 > * { + flex: 0 0 auto; + width:25% + } + + .row-cols-lg-5 > * { + flex: 0 0 auto; + width:20% + } + + .row-cols-lg-6 > * { + flex: 0 0 auto; + width:16.6666666667% + } + + .col-lg-auto { + flex: 0 0 auto; + width:auto + } + + .col-lg-1 { + flex: 0 0 auto; + width:8.33333333% + } + + .col-lg-2 { + flex: 0 0 auto; + width:16.66666667% + } + + .col-lg-3 { + flex: 0 0 auto; + width:25% + } + + .col-lg-4 { + flex: 0 0 auto; + width:33.33333333% + } + + .col-lg-5 { + flex: 0 0 auto; + width:41.66666667% + } + + .col-lg-6 { + flex: 0 0 auto; + width:50% + } + + .col-lg-7 { + flex: 0 0 auto; + width:58.33333333% + } + + .col-lg-8 { + flex: 0 0 auto; + width:66.66666667% + } + + .col-lg-9 { + flex: 0 0 auto; + width:75% + } + + .col-lg-10 { + flex: 0 0 auto; + width:83.33333333% + } + + .col-lg-11 { + flex: 0 0 auto; + width:91.66666667% + } + + .col-lg-12 { + flex: 0 0 auto; + width:100% + } + + .offset-lg-0 { + margin-left:0 + } + + .offset-lg-1 { + margin-left:8.33333333% + } + + .offset-lg-2 { + margin-left:16.66666667% + } + + .offset-lg-3 { + margin-left:25% + } + + .offset-lg-4 { + margin-left:33.33333333% + } + + .offset-lg-5 { + margin-left:41.66666667% + } + + .offset-lg-6 { + margin-left:50% + } + + .offset-lg-7 { + margin-left:58.33333333% + } + + .offset-lg-8 { + margin-left:66.66666667% + } + + .offset-lg-9 { + margin-left:75% + } + + .offset-lg-10 { + margin-left:83.33333333% + } + + .offset-lg-11 { + margin-left:91.66666667% + } + + .g-lg-0, .gx-lg-0 { + --bs-gutter-x: 0 + } + + .g-lg-0, .gy-lg-0 { + --bs-gutter-y: 0 + } + + .g-lg-1, .gx-lg-1 { + --bs-gutter-x: 0.25rem + } + + .g-lg-1, .gy-lg-1 { + --bs-gutter-y: 0.25rem + } + + .g-lg-2, .gx-lg-2 { + --bs-gutter-x: 0.5rem + } + + .g-lg-2, .gy-lg-2 { + --bs-gutter-y: 0.5rem + } + + .g-lg-3, .gx-lg-3 { + --bs-gutter-x: 1rem + } + + .g-lg-3, .gy-lg-3 { + --bs-gutter-y: 1rem + } + + .g-lg-4, .gx-lg-4 { + --bs-gutter-x: 1.5rem + } + + .g-lg-4, .gy-lg-4 { + --bs-gutter-y: 1.5rem + } + + .g-lg-5, .gx-lg-5 { + --bs-gutter-x: 3rem + } + + .g-lg-5, .gy-lg-5 { + --bs-gutter-y: 3rem + } +} + +@media (min-width: 1200px) { + .col-xl { + flex:1 0 0% + } + + .row-cols-xl-auto > * { + flex: 0 0 auto; + width:auto + } + + .row-cols-xl-1 > * { + flex: 0 0 auto; + width:100% + } + + .row-cols-xl-2 > * { + flex: 0 0 auto; + width:50% + } + + .row-cols-xl-3 > * { + flex: 0 0 auto; + width:33.3333333333% + } + + .row-cols-xl-4 > * { + flex: 0 0 auto; + width:25% + } + + .row-cols-xl-5 > * { + flex: 0 0 auto; + width:20% + } + + .row-cols-xl-6 > * { + flex: 0 0 auto; + width:16.6666666667% + } + + .col-xl-auto { + flex: 0 0 auto; + width:auto + } + + .col-xl-1 { + flex: 0 0 auto; + width:8.33333333% + } + + .col-xl-2 { + flex: 0 0 auto; + width:16.66666667% + } + + .col-xl-3 { + flex: 0 0 auto; + width:25% + } + + .col-xl-4 { + flex: 0 0 auto; + width:33.33333333% + } + + .col-xl-5 { + flex: 0 0 auto; + width:41.66666667% + } + + .col-xl-6 { + flex: 0 0 auto; + width:50% + } + + .col-xl-7 { + flex: 0 0 auto; + width:58.33333333% + } + + .col-xl-8 { + flex: 0 0 auto; + width:66.66666667% + } + + .col-xl-9 { + flex: 0 0 auto; + width:75% + } + + .col-xl-10 { + flex: 0 0 auto; + width:83.33333333% + } + + .col-xl-11 { + flex: 0 0 auto; + width:91.66666667% + } + + .col-xl-12 { + flex: 0 0 auto; + width:100% + } + + .offset-xl-0 { + margin-left:0 + } + + .offset-xl-1 { + margin-left:8.33333333% + } + + .offset-xl-2 { + margin-left:16.66666667% + } + + .offset-xl-3 { + margin-left:25% + } + + .offset-xl-4 { + margin-left:33.33333333% + } + + .offset-xl-5 { + margin-left:41.66666667% + } + + .offset-xl-6 { + margin-left:50% + } + + .offset-xl-7 { + margin-left:58.33333333% + } + + .offset-xl-8 { + margin-left:66.66666667% + } + + .offset-xl-9 { + margin-left:75% + } + + .offset-xl-10 { + margin-left:83.33333333% + } + + .offset-xl-11 { + margin-left:91.66666667% + } + + .g-xl-0, .gx-xl-0 { + --bs-gutter-x: 0 + } + + .g-xl-0, .gy-xl-0 { + --bs-gutter-y: 0 + } + + .g-xl-1, .gx-xl-1 { + --bs-gutter-x: 0.25rem + } + + .g-xl-1, .gy-xl-1 { + --bs-gutter-y: 0.25rem + } + + .g-xl-2, .gx-xl-2 { + --bs-gutter-x: 0.5rem + } + + .g-xl-2, .gy-xl-2 { + --bs-gutter-y: 0.5rem + } + + .g-xl-3, .gx-xl-3 { + --bs-gutter-x: 1rem + } + + .g-xl-3, .gy-xl-3 { + --bs-gutter-y: 1rem + } + + .g-xl-4, .gx-xl-4 { + --bs-gutter-x: 1.5rem + } + + .g-xl-4, .gy-xl-4 { + --bs-gutter-y: 1.5rem + } + + .g-xl-5, .gx-xl-5 { + --bs-gutter-x: 3rem + } + + .g-xl-5, .gy-xl-5 { + --bs-gutter-y: 3rem + } +} + +@media (min-width: 1400px) { + .col-xxl { + flex:1 0 0% + } + + .row-cols-xxl-auto > * { + flex: 0 0 auto; + width:auto + } + + .row-cols-xxl-1 > * { + flex: 0 0 auto; + width:100% + } + + .row-cols-xxl-2 > * { + flex: 0 0 auto; + width:50% + } + + .row-cols-xxl-3 > * { + flex: 0 0 auto; + width:33.3333333333% + } + + .row-cols-xxl-4 > * { + flex: 0 0 auto; + width:25% + } + + .row-cols-xxl-5 > * { + flex: 0 0 auto; + width:20% + } + + .row-cols-xxl-6 > * { + flex: 0 0 auto; + width:16.6666666667% + } + + .col-xxl-auto { + flex: 0 0 auto; + width:auto + } + + .col-xxl-1 { + flex: 0 0 auto; + width:8.33333333% + } + + .col-xxl-2 { + flex: 0 0 auto; + width:16.66666667% + } + + .col-xxl-3 { + flex: 0 0 auto; + width:25% + } + + .col-xxl-4 { + flex: 0 0 auto; + width:33.33333333% + } + + .col-xxl-5 { + flex: 0 0 auto; + width:41.66666667% + } + + .col-xxl-6 { + flex: 0 0 auto; + width:50% + } + + .col-xxl-7 { + flex: 0 0 auto; + width:58.33333333% + } + + .col-xxl-8 { + flex: 0 0 auto; + width:66.66666667% + } + + .col-xxl-9 { + flex: 0 0 auto; + width:75% + } + + .col-xxl-10 { + flex: 0 0 auto; + width:83.33333333% + } + + .col-xxl-11 { + flex: 0 0 auto; + width:91.66666667% + } + + .col-xxl-12 { + flex: 0 0 auto; + width:100% + } + + .offset-xxl-0 { + margin-left:0 + } + + .offset-xxl-1 { + margin-left:8.33333333% + } + + .offset-xxl-2 { + margin-left:16.66666667% + } + + .offset-xxl-3 { + margin-left:25% + } + + .offset-xxl-4 { + margin-left:33.33333333% + } + + .offset-xxl-5 { + margin-left:41.66666667% + } + + .offset-xxl-6 { + margin-left:50% + } + + .offset-xxl-7 { + margin-left:58.33333333% + } + + .offset-xxl-8 { + margin-left:66.66666667% + } + + .offset-xxl-9 { + margin-left:75% + } + + .offset-xxl-10 { + margin-left:83.33333333% + } + + .offset-xxl-11 { + margin-left:91.66666667% + } + + .g-xxl-0, .gx-xxl-0 { + --bs-gutter-x: 0 + } + + .g-xxl-0, .gy-xxl-0 { + --bs-gutter-y: 0 + } + + .g-xxl-1, .gx-xxl-1 { + --bs-gutter-x: 0.25rem + } + + .g-xxl-1, .gy-xxl-1 { + --bs-gutter-y: 0.25rem + } + + .g-xxl-2, .gx-xxl-2 { + --bs-gutter-x: 0.5rem + } + + .g-xxl-2, .gy-xxl-2 { + --bs-gutter-y: 0.5rem + } + + .g-xxl-3, .gx-xxl-3 { + --bs-gutter-x: 1rem + } + + .g-xxl-3, .gy-xxl-3 { + --bs-gutter-y: 1rem + } + + .g-xxl-4, .gx-xxl-4 { + --bs-gutter-x: 1.5rem + } + + .g-xxl-4, .gy-xxl-4 { + --bs-gutter-y: 1.5rem + } + + .g-xxl-5, .gx-xxl-5 { + --bs-gutter-x: 3rem + } + + .g-xxl-5, .gy-xxl-5 { + --bs-gutter-y: 3rem + } +} + +.table { + --bs-table-color: var(--bs-body-color); + --bs-table-bg: transparent; + --bs-table-border-color: var(--bs-border-color); + --bs-table-accent-bg: transparent; + --bs-table-striped-color: var(--bs-body-color); + --bs-table-striped-bg: rgba(0, 0, 0, 0.05); + --bs-table-active-color: var(--bs-body-color); + --bs-table-active-bg: rgba(0, 0, 0, 0.1); + --bs-table-hover-color: var(--bs-body-color); + --bs-table-hover-bg: rgba(0, 0, 0, 0.075); + width: 100%; + margin-bottom: 1rem; + color: var(--bs-table-color); + vertical-align: top; + border-color:var(--bs-table-border-color) +} + +.table > :not(caption) > * > * { + padding: .5rem .5rem; + background-color: var(--bs-table-bg); + border-bottom-width: 1px; + box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg) +} + +.table > tbody { + vertical-align:inherit +} + +.table > thead { + vertical-align:bottom +} + +.table-group-divider { + border-top:2px solid currentcolor +} + +.caption-top { + caption-side:top +} + +.table-sm > :not(caption) > * > * { + padding:.25rem .25rem +} + +.table-bordered > :not(caption) > * { + border-width:1px 0 +} + +.table-bordered > :not(caption) > * > * { + border-width:0 1px +} + +.table-borderless > :not(caption) > * > * { + border-bottom-width:0 +} + +.table-borderless > :not(:first-child) { + border-top-width:0 +} + +.table-striped > tbody > tr:nth-of-type(odd) > * { + --bs-table-accent-bg: var(--bs-table-striped-bg); + color:var(--bs-table-striped-color) +} + +.table-striped-columns > :not(caption) > tr > :nth-child(even) { + --bs-table-accent-bg: var(--bs-table-striped-bg); + color:var(--bs-table-striped-color) +} + +.table-active { + --bs-table-accent-bg: var(--bs-table-active-bg); + color:var(--bs-table-active-color) +} + +.table-hover > tbody > tr:hover > * { + --bs-table-accent-bg: var(--bs-table-hover-bg); + color:var(--bs-table-hover-color) +} + +.table-primary { + --bs-table-color: #000; + --bs-table-bg: #d4dddd; + --bs-table-border-color: #bfc7c7; + --bs-table-striped-bg: #c9d2d2; + --bs-table-striped-color: #000; + --bs-table-active-bg: #bfc7c7; + --bs-table-active-color: #000; + --bs-table-hover-bg: #c4cccc; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-secondary { + --bs-table-color: #000; + --bs-table-bg: #e2e3e5; + --bs-table-border-color: #cbccce; + --bs-table-striped-bg: #d7d8da; + --bs-table-striped-color: #000; + --bs-table-active-bg: #cbccce; + --bs-table-active-color: #000; + --bs-table-hover-bg: #d1d2d4; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-success { + --bs-table-color: #000; + --bs-table-bg: #d1e7dd; + --bs-table-border-color: #bcd0c7; + --bs-table-striped-bg: #c7dbd2; + --bs-table-striped-color: #000; + --bs-table-active-bg: #bcd0c7; + --bs-table-active-color: #000; + --bs-table-hover-bg: #c1d6cc; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-info { + --bs-table-color: #000; + --bs-table-bg: #cff4fc; + --bs-table-border-color: #badce3; + --bs-table-striped-bg: #c5e8ef; + --bs-table-striped-color: #000; + --bs-table-active-bg: #badce3; + --bs-table-active-color: #000; + --bs-table-hover-bg: #bfe2e9; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-warning { + --bs-table-color: #000; + --bs-table-bg: #fff3cd; + --bs-table-border-color: #e6dbb9; + --bs-table-striped-bg: #f2e7c3; + --bs-table-striped-color: #000; + --bs-table-active-bg: #e6dbb9; + --bs-table-active-color: #000; + --bs-table-hover-bg: #ece1be; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-danger { + --bs-table-color: #000; + --bs-table-bg: #f8d7da; + --bs-table-border-color: #dfc2c4; + --bs-table-striped-bg: #eccccf; + --bs-table-striped-color: #000; + --bs-table-active-bg: #dfc2c4; + --bs-table-active-color: #000; + --bs-table-hover-bg: #e5c7ca; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-light { + --bs-table-color: #000; + --bs-table-bg: #f8f9fa; + --bs-table-border-color: #dfe0e1; + --bs-table-striped-bg: #ecedee; + --bs-table-striped-color: #000; + --bs-table-active-bg: #dfe0e1; + --bs-table-active-color: #000; + --bs-table-hover-bg: #e5e6e7; + --bs-table-hover-color: #000; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-dark { + --bs-table-color: #fff; + --bs-table-bg: #000000; + --bs-table-border-color: #1a1a1a; + --bs-table-striped-bg: #0d0d0d; + --bs-table-striped-color: #fff; + --bs-table-active-bg: #1a1a1a; + --bs-table-active-color: #fff; + --bs-table-hover-bg: #131313; + --bs-table-hover-color: #fff; + color: var(--bs-table-color); + border-color:var(--bs-table-border-color) +} + +.table-responsive { + overflow-x: auto; + -webkit-overflow-scrolling:touch +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + overflow-x: auto; + -webkit-overflow-scrolling:touch + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + overflow-x: auto; + -webkit-overflow-scrolling:touch + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + overflow-x: auto; + -webkit-overflow-scrolling:touch + } +} + +@media (max-width: 1199.98px) { + .table-responsive-xl { + overflow-x: auto; + -webkit-overflow-scrolling:touch + } +} + +@media (max-width: 1399.98px) { + .table-responsive-xxl { + overflow-x: auto; + -webkit-overflow-scrolling:touch + } +} + +.form-label { + margin-bottom:.5rem +} + +.col-form-label { + padding-top: calc(.375rem + 1px); + padding-bottom: calc(.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height:1.5 +} + +.col-form-label-lg { + padding-top: calc(.5rem + 1px); + padding-bottom: calc(.5rem + 1px); + font-size:1.25rem +} + +.col-form-label-sm { + padding-top: calc(.25rem + 1px); + padding-bottom: calc(.25rem + 1px); + font-size:.875rem +} + +.form-text { + margin-top: .25rem; + font-size: .875em; + color:#6c757d +} + +.form-control { + display: block; + width: 100%; + padding: .375rem .75rem; + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: #000; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #ced4da; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + border-radius: .375rem; + transition:border-color .15s ease-in-out, box-shadow .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .form-control { + transition:none + } +} + +.form-control[type=file] { + overflow:hidden +} + +.form-control[type=file]:not(:disabled):not([readonly]) { + cursor:pointer +} + +.form-control:focus { + color: #000; + background-color: #fff; + border-color: #95aaaa; + outline: 0; + box-shadow:0 0 0 .25rem rgba(42, 85, 85, .25) +} + +.form-control::-webkit-date-and-time-value { + height:1.5em +} + +.form-control::-moz-placeholder { + color: #6c757d; + opacity:1 +} + +.form-control::placeholder { + color: #6c757d; + opacity:1 +} + +.form-control:disabled { + background-color: #e9ecef; + opacity:1 +} + +.form-control::file-selector-button { + padding: .375rem .75rem; + margin: -0.375rem -0.75rem; + -webkit-margin-end: .75rem; + margin-inline-end: .75rem; + color: #000; + background-color: #e9ecef; + pointer-events: none; + border-color: inherit; + border-style: solid; + border-width: 0; + border-inline-end-width: 1px; + border-radius: 0; + transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .form-control::file-selector-button { + transition:none + } +} + +.form-control:hover:not(:disabled):not([readonly])::file-selector-button { + background-color:#dde0e3 +} + +.form-control-plaintext { + display: block; + width: 100%; + padding: .375rem 0; + margin-bottom: 0; + line-height: 1.5; + color: #000; + background-color: rgba(0, 0, 0, 0); + border: solid rgba(0, 0, 0, 0); + border-width:1px 0 +} + +.form-control-plaintext:focus { + outline:0 +} + +.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg { + padding-right: 0; + padding-left:0 +} + +.form-control-sm { + min-height: calc(1.5em + .5rem + 2px); + padding: .25rem .5rem; + font-size: .875rem; + border-radius:.25rem +} + +.form-control-sm::file-selector-button { + padding: .25rem .5rem; + margin: -0.25rem -0.5rem; + -webkit-margin-end: .5rem; + margin-inline-end:.5rem +} + +.form-control-lg { + min-height: calc(1.5em + 1rem + 2px); + padding: .5rem 1rem; + font-size: 1.25rem; + border-radius:.5rem +} + +.form-control-lg::file-selector-button { + padding: .5rem 1rem; + margin: -0.5rem -1rem; + -webkit-margin-end: 1rem; + margin-inline-end:1rem +} + +textarea.form-control { + min-height:calc(1.5em + .75rem + 2px) +} + +textarea.form-control-sm { + min-height:calc(1.5em + .5rem + 2px) +} + +textarea.form-control-lg { + min-height:calc(1.5em + 1rem + 2px) +} + +.form-control-color { + width: 3rem; + height: calc(1.5em + .75rem + 2px); + padding:.375rem +} + +.form-control-color:not(:disabled):not([readonly]) { + cursor:pointer +} + +.form-control-color::-moz-color-swatch { + border: 0 !important; + border-radius:.375rem +} + +.form-control-color::-webkit-color-swatch { + border-radius:.375rem +} + +.form-control-color.form-control-sm { + height:calc(1.5em + .5rem + 2px) +} + +.form-control-color.form-control-lg { + height:calc(1.5em + 1rem + 2px) +} + +.form-select { + display: block; + width: 100%; + padding: .375rem 2.25rem .375rem .75rem; + -moz-padding-start: calc(.75rem - 3px); + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: #000; + background-color: #fff; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right .75rem center; + background-size: 16px 12px; + border: 1px solid #ced4da; + border-radius: .375rem; + transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out; + -webkit-appearance: none; + -moz-appearance: none; + appearance:none +} + +@media (prefers-reduced-motion: reduce) { + .form-select { + transition:none + } +} + +.form-select:focus { + border-color: #95aaaa; + outline: 0; + box-shadow: 0 0 0 .25rem rgba(42, 85, 85, .25) +} + +.form-select[multiple], .form-select[size]:not([size="1"]) { + padding-right: .75rem; + background-image:none +} + +.form-select:disabled { + background-color:#e9ecef +} + +.form-select:-moz-focusring { + color: rgba(0, 0, 0, 0); + text-shadow:0 0 0 #000 +} + +.form-select-sm { + padding-top: .25rem; + padding-bottom: .25rem; + padding-left: .5rem; + font-size: .875rem; + border-radius:.25rem +} + +.form-select-lg { + padding-top: .5rem; + padding-bottom: .5rem; + padding-left: 1rem; + font-size: 1.25rem; + border-radius:.5rem +} + +.form-check { + display: block; + min-height: 1.5rem; + padding-left: 1.5em; + margin-bottom:.125rem +} + +.form-check .form-check-input { + float: left; + margin-left:-1.5em +} + +.form-check-reverse { + padding-right: 1.5em; + padding-left: 0; + text-align:right +} + +.form-check-reverse .form-check-input { + float: right; + margin-right: -1.5em; + margin-left:0 +} + +.form-check-input { + width: 1em; + height: 1em; + margin-top: .25em; + vertical-align: top; + background-color: #fff; + background-repeat: no-repeat; + background-position: center; + background-size: contain; + border: 1px solid rgba(0, 0, 0, .25); + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + -webkit-print-color-adjust: exact; + print-color-adjust:exact +} + +.form-check-input[type=checkbox] { + border-radius:.25em +} + +.form-check-input[type=radio] { + border-radius:50% +} + +.form-check-input:active { + filter:brightness(90%) +} + +.form-check-input:focus { + border-color: #95aaaa; + outline: 0; + box-shadow:0 0 0 .25rem rgba(42, 85, 85, .25) +} + +.form-check-input:checked { + background-color: #2a5555; + border-color:#2a5555 +} + +.form-check-input:checked[type=checkbox] { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e") +} + +.form-check-input:checked[type=radio] { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e") +} + +.form-check-input[type=checkbox]:indeterminate { + background-color: #2a5555; + border-color: #2a5555; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e") +} + +.form-check-input:disabled { + pointer-events: none; + filter: none; + opacity:.5 +} + +.form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label { + cursor: default; + opacity:.5 +} + +.form-switch { + padding-left:2.5em +} + +.form-switch .form-check-input { + width: 2em; + margin-left: -2.5em; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e"); + background-position: left center; + border-radius: 2em; + transition:background-position .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .form-switch .form-check-input { + transition:none + } +} + +.form-switch .form-check-input:focus { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2395aaaa'/%3e%3c/svg%3e") +} + +.form-switch .form-check-input:checked { + background-position: right center; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e") +} + +.form-switch.form-check-reverse { + padding-right: 2.5em; + padding-left:0 +} + +.form-switch.form-check-reverse .form-check-input { + margin-right: -2.5em; + margin-left:0 +} + +.form-check-inline { + display: inline-block; + margin-right:1rem +} + +.btn-check { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events:none +} + +.btn-check[disabled] + .btn, .btn-check:disabled + .btn { + pointer-events: none; + filter: none; + opacity:.65 +} + +.form-range { + width: 100%; + height: 1.5rem; + padding: 0; + background-color: rgba(0, 0, 0, 0); + -webkit-appearance: none; + -moz-appearance: none; + appearance:none +} + +.form-range:focus { + outline:0 +} + +.form-range:focus::-webkit-slider-thumb { + box-shadow:0 0 0 1px #fff, 0 0 0 .25rem rgba(42, 85, 85, .25) +} + +.form-range:focus::-moz-range-thumb { + box-shadow:0 0 0 1px #fff, 0 0 0 .25rem rgba(42, 85, 85, .25) +} + +.form-range::-moz-focus-outer { + border:0 +} + +.form-range::-webkit-slider-thumb { + width: 1rem; + height: 1rem; + margin-top: -0.25rem; + background-color: #2a5555; + border: 0; + border-radius: 1rem; + -webkit-transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out; + transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out; + -webkit-appearance: none; + appearance:none +} + +@media (prefers-reduced-motion: reduce) { + .form-range::-webkit-slider-thumb { + -webkit-transition: none; + transition:none + } +} + +.form-range::-webkit-slider-thumb:active { + background-color:#bfcccc +} + +.form-range::-webkit-slider-runnable-track { + width: 100%; + height: .5rem; + color: rgba(0, 0, 0, 0); + cursor: pointer; + background-color: #dee2e6; + border-color: rgba(0, 0, 0, 0); + border-radius:1rem +} + +.form-range::-moz-range-thumb { + width: 1rem; + height: 1rem; + background-color: #2a5555; + border: 0; + border-radius: 1rem; + -moz-transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out; + transition: background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out; + -moz-appearance: none; + appearance:none +} + +@media (prefers-reduced-motion: reduce) { + .form-range::-moz-range-thumb { + -moz-transition: none; + transition:none + } +} + +.form-range::-moz-range-thumb:active { + background-color:#bfcccc +} + +.form-range::-moz-range-track { + width: 100%; + height: .5rem; + color: rgba(0, 0, 0, 0); + cursor: pointer; + background-color: #dee2e6; + border-color: rgba(0, 0, 0, 0); + border-radius:1rem +} + +.form-range:disabled { + pointer-events:none +} + +.form-range:disabled::-webkit-slider-thumb { + background-color:#adb5bd +} + +.form-range:disabled::-moz-range-thumb { + background-color:#adb5bd +} + +.form-floating { + position:relative +} + +.form-floating > .form-control, .form-floating > .form-control-plaintext, .form-floating > .form-select { + height: calc(3.5rem + 2px); + line-height:1.25 +} + +.form-floating > label { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + padding: 1rem .75rem; + overflow: hidden; + text-align: start; + text-overflow: ellipsis; + white-space: nowrap; + pointer-events: none; + border: 1px solid rgba(0, 0, 0, 0); + transform-origin: 0 0; + transition:opacity .1s ease-in-out, transform .1s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .form-floating > label { + transition:none + } +} + +.form-floating > .form-control, .form-floating > .form-control-plaintext { + padding:1rem .75rem +} + +.form-floating > .form-control::-moz-placeholder, .form-floating > .form-control-plaintext::-moz-placeholder { + color:rgba(0, 0, 0, 0) +} + +.form-floating > .form-control::placeholder, .form-floating > .form-control-plaintext::placeholder { + color:rgba(0, 0, 0, 0) +} + +.form-floating > .form-control:not(:-moz-placeholder-shown), .form-floating > .form-control-plaintext:not(:-moz-placeholder-shown) { + padding-top: 1.625rem; + padding-bottom:.625rem +} + +.form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown), .form-floating > .form-control-plaintext:focus, .form-floating > .form-control-plaintext:not(:placeholder-shown) { + padding-top: 1.625rem; + padding-bottom:.625rem +} + +.form-floating > .form-control:-webkit-autofill, .form-floating > .form-control-plaintext:-webkit-autofill { + padding-top: 1.625rem; + padding-bottom:.625rem +} + +.form-floating > .form-select { + padding-top: 1.625rem; + padding-bottom:.625rem +} + +.form-floating > .form-control:not(:-moz-placeholder-shown) ~ label { + opacity: .65; + transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem) +} + +.form-floating > .form-control:focus ~ label, .form-floating > .form-control:not(:placeholder-shown) ~ label, .form-floating > .form-control-plaintext ~ label, .form-floating > .form-select ~ label { + opacity: .65; + transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem) +} + +.form-floating > .form-control:-webkit-autofill ~ label { + opacity: .65; + transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem) +} + +.form-floating > .form-control-plaintext ~ label { + border-width:1px 0 +} + +.input-group { + position: relative; + display: flex; + flex-wrap: wrap; + align-items: stretch; + width:100% +} + +.input-group > .form-control, .input-group > .form-select, .input-group > .form-floating { + position: relative; + flex: 1 1 auto; + width: 1%; + min-width:0 +} + +.input-group > .form-control:focus, .input-group > .form-select:focus, .input-group > .form-floating:focus-within { + z-index:5 +} + +.input-group .btn { + position: relative; + z-index:2 +} + +.input-group .btn:focus { + z-index:5 +} + +.input-group-text { + display: flex; + align-items: center; + padding: .375rem .75rem; + font-size: 1rem; + font-weight: 400; + line-height: 1.5; + color: #000; + text-align: center; + white-space: nowrap; + background-color: #e9ecef; + border: 1px solid #ced4da; + border-radius:.375rem +} + +.input-group-lg > .form-control, .input-group-lg > .form-select, .input-group-lg > .input-group-text, .input-group-lg > .btn { + padding: .5rem 1rem; + font-size: 1.25rem; + border-radius:.5rem +} + +.input-group-sm > .form-control, .input-group-sm > .form-select, .input-group-sm > .input-group-text, .input-group-sm > .btn { + padding: .25rem .5rem; + font-size: .875rem; + border-radius:.25rem +} + +.input-group-lg > .form-select, .input-group-sm > .form-select { + padding-right:3rem +} + +.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), .input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n + 3), .input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control, .input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius:0 +} + +.input-group.has-validation > :nth-last-child(n + 3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating), .input-group.has-validation > .dropdown-toggle:nth-last-child(n + 4), .input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-control, .input-group.has-validation > .form-floating:nth-last-child(n + 3) > .form-select { + border-top-right-radius: 0; + border-bottom-right-radius:0 +} + +.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) { + margin-left: -1px; + border-top-left-radius: 0; + border-bottom-left-radius:0 +} + +.input-group > .form-floating:not(:first-child) > .form-control, .input-group > .form-floating:not(:first-child) > .form-select { + border-top-left-radius: 0; + border-bottom-left-radius:0 +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: .25rem; + font-size: .875em; + color:#198754 +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .25rem .5rem; + margin-top: .1rem; + font-size: .875rem; + color: #fff; + background-color: rgba(25, 135, 84, .9); + border-radius:.375rem +} + +.was-validated :valid ~ .valid-feedback, .was-validated :valid ~ .valid-tooltip, .is-valid ~ .valid-feedback, .is-valid ~ .valid-tooltip { + display:block +} + +.was-validated .form-control:valid, .form-control.is-valid { + border-color: #198754; + padding-right: calc(1.5em + .75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(.375em + .1875rem) center; + background-size:calc(.75em + .375rem) calc(.75em + .375rem) +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus { + border-color: #198754; + box-shadow:0 0 0 .25rem rgba(25, 135, 84, .25) +} + +.was-validated textarea.form-control:valid, textarea.form-control.is-valid { + padding-right: calc(1.5em + .75rem); + background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem) +} + +.was-validated .form-select:valid, .form-select.is-valid { + border-color: #198754 +} + +.was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] { + padding-right: 4.125rem; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"), url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); + background-position: right .75rem center, center right 2.25rem; + background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem) +} + +.was-validated .form-select:valid:focus, .form-select.is-valid:focus { + border-color: #198754; + box-shadow:0 0 0 .25rem rgba(25, 135, 84, .25) +} + +.was-validated .form-control-color:valid, .form-control-color.is-valid { + width:calc(3rem + 1.5em + .75rem) +} + +.was-validated .form-check-input:valid, .form-check-input.is-valid { + border-color:#198754 +} + +.was-validated .form-check-input:valid:checked, .form-check-input.is-valid:checked { + background-color:#198754 +} + +.was-validated .form-check-input:valid:focus, .form-check-input.is-valid:focus { + box-shadow:0 0 0 .25rem rgba(25, 135, 84, .25) +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color:#198754 +} + +.form-check-inline .form-check-input ~ .valid-feedback { + margin-left:.5em +} + +.was-validated .input-group > .form-control:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid, .was-validated .input-group > .form-select:not(:focus):valid, .input-group > .form-select:not(:focus).is-valid, .was-validated .input-group > .form-floating:not(:focus-within):valid, .input-group > .form-floating:not(:focus-within).is-valid { + z-index:3 +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: .25rem; + font-size: .875em; + color:#dc3545 +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .25rem .5rem; + margin-top: .1rem; + font-size: .875rem; + color: #fff; + background-color: rgba(220, 53, 69, .9); + border-radius:.375rem +} + +.was-validated :invalid ~ .invalid-feedback, .was-validated :invalid ~ .invalid-tooltip, .is-invalid ~ .invalid-feedback, .is-invalid ~ .invalid-tooltip { + display:block +} + +.was-validated .form-control:invalid, .form-control.is-invalid { + border-color: #dc3545; + padding-right: calc(1.5em + .75rem); + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); + background-repeat: no-repeat; + background-position: right calc(.375em + .1875rem) center; + background-size:calc(.75em + .375rem) calc(.75em + .375rem) +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus { + border-color: #dc3545; + box-shadow:0 0 0 .25rem rgba(220, 53, 69, .25) +} + +.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid { + padding-right: calc(1.5em + .75rem); + background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem) +} + +.was-validated .form-select:invalid, .form-select.is-invalid { + border-color: #dc3545 +} + +.was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] { + padding-right: 4.125rem; + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"), url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); + background-position: right .75rem center, center right 2.25rem; + background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem) +} + +.was-validated .form-select:invalid:focus, .form-select.is-invalid:focus { + border-color: #dc3545; + box-shadow:0 0 0 .25rem rgba(220, 53, 69, .25) +} + +.was-validated .form-control-color:invalid, .form-control-color.is-invalid { + width:calc(3rem + 1.5em + .75rem) +} + +.was-validated .form-check-input:invalid, .form-check-input.is-invalid { + border-color:#dc3545 +} + +.was-validated .form-check-input:invalid:checked, .form-check-input.is-invalid:checked { + background-color:#dc3545 +} + +.was-validated .form-check-input:invalid:focus, .form-check-input.is-invalid:focus { + box-shadow:0 0 0 .25rem rgba(220, 53, 69, .25) +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color:#dc3545 +} + +.form-check-inline .form-check-input ~ .invalid-feedback { + margin-left:.5em +} + +.was-validated .input-group > .form-control:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid, .was-validated .input-group > .form-select:not(:focus):invalid, .input-group > .form-select:not(:focus).is-invalid, .was-validated .input-group > .form-floating:not(:focus-within):invalid, .input-group > .form-floating:not(:focus-within).is-invalid { + z-index:4 +} + +.btn { + --bs-btn-padding-x: 0.75rem; + --bs-btn-padding-y: 0.375rem; + --bs-btn-font-family:; + --bs-btn-font-size: 1rem; + --bs-btn-font-weight: 400; + --bs-btn-line-height: 1.5; + --bs-btn-color: #000000; + --bs-btn-bg: transparent; + --bs-btn-border-width: 1px; + --bs-btn-border-color: transparent; + --bs-btn-border-radius: 0.375rem; + --bs-btn-hover-border-color: transparent; + --bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075); + --bs-btn-disabled-opacity: 0.65; + --bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5); + display: inline-block; + padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x); + font-family: var(--bs-btn-font-family); + font-size: var(--bs-btn-font-size); + font-weight: var(--bs-btn-font-weight); + line-height: var(--bs-btn-line-height); + color: var(--bs-btn-color); + text-align: center; + text-decoration: none; + vertical-align: middle; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + user-select: none; + border: var(--bs-btn-border-width) solid var(--bs-btn-border-color); + border-radius: var(--bs-btn-border-radius); + background-color: var(--bs-btn-bg); + transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .btn { + transition:none + } +} + +.btn:hover { + color: var(--bs-btn-hover-color); + background-color: var(--bs-btn-hover-bg); + border-color:var(--bs-btn-hover-border-color) +} + +.btn-check + .btn:hover { + color: var(--bs-btn-color); + background-color: var(--bs-btn-bg); + border-color:var(--bs-btn-border-color) +} + +.btn:focus-visible { + color: var(--bs-btn-hover-color); + background-color: var(--bs-btn-hover-bg); + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow:var(--bs-btn-focus-box-shadow) +} + +.btn-check:focus-visible + .btn { + border-color: var(--bs-btn-hover-border-color); + outline: 0; + box-shadow:var(--bs-btn-focus-box-shadow) +} + +.btn-check:checked + .btn, :not(.btn-check) + .btn:active, .btn:first-child:active, .btn.active, .btn.show { + color: var(--bs-btn-active-color); + background-color: var(--bs-btn-active-bg); + border-color:var(--bs-btn-active-border-color) +} + +.btn-check:checked + .btn:focus-visible, :not(.btn-check) + .btn:active:focus-visible, .btn:first-child:active:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible { + box-shadow:var(--bs-btn-focus-box-shadow) +} + +.btn:disabled, .btn.disabled, fieldset:disabled .btn { + color: var(--bs-btn-disabled-color); + pointer-events: none; + background-color: var(--bs-btn-disabled-bg); + border-color: var(--bs-btn-disabled-border-color); + opacity:var(--bs-btn-disabled-opacity) +} + +.btn-primary { + --bs-btn-color: #fff; + --bs-btn-bg: #2a5555; + --bs-btn-border-color: #2a5555; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #244848; + --bs-btn-hover-border-color: #224444; + --bs-btn-focus-shadow-rgb: 74, 111, 111; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #224444; + --bs-btn-active-border-color: #204040; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #2a5555; + --bs-btn-disabled-border-color: #2a5555 +} + +.btn-secondary { + --bs-btn-color: #fff; + --bs-btn-bg: #6c757d; + --bs-btn-border-color: #6c757d; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #5c636a; + --bs-btn-hover-border-color: #565e64; + --bs-btn-focus-shadow-rgb: 130, 138, 145; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #565e64; + --bs-btn-active-border-color: #51585e; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #6c757d; + --bs-btn-disabled-border-color: #6c757d +} + +.btn-success { + --bs-btn-color: #fff; + --bs-btn-bg: #198754; + --bs-btn-border-color: #198754; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #157347; + --bs-btn-hover-border-color: #146c43; + --bs-btn-focus-shadow-rgb: 60, 153, 110; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #146c43; + --bs-btn-active-border-color: #13653f; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #198754; + --bs-btn-disabled-border-color: #198754 +} + +.btn-info { + --bs-btn-color: #000; + --bs-btn-bg: #0dcaf0; + --bs-btn-border-color: #0dcaf0; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #31d2f2; + --bs-btn-hover-border-color: #25cff2; + --bs-btn-focus-shadow-rgb: 11, 172, 204; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #3dd5f3; + --bs-btn-active-border-color: #25cff2; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #0dcaf0; + --bs-btn-disabled-border-color: #0dcaf0 +} + +.btn-warning { + --bs-btn-color: #000; + --bs-btn-bg: #ffc107; + --bs-btn-border-color: #ffc107; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #ffca2c; + --bs-btn-hover-border-color: #ffc720; + --bs-btn-focus-shadow-rgb: 217, 164, 6; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #ffcd39; + --bs-btn-active-border-color: #ffc720; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #ffc107; + --bs-btn-disabled-border-color: #ffc107 +} + +.btn-danger { + --bs-btn-color: #fff; + --bs-btn-bg: #dc3545; + --bs-btn-border-color: #dc3545; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #bb2d3b; + --bs-btn-hover-border-color: #b02a37; + --bs-btn-focus-shadow-rgb: 225, 83, 97; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #b02a37; + --bs-btn-active-border-color: #a52834; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #dc3545; + --bs-btn-disabled-border-color: #dc3545 +} + +.btn-light { + --bs-btn-color: #000; + --bs-btn-bg: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #d3d4d5; + --bs-btn-hover-border-color: #c6c7c8; + --bs-btn-focus-shadow-rgb: 211, 212, 213; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #c6c7c8; + --bs-btn-active-border-color: #babbbc; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000; + --bs-btn-disabled-bg: #f8f9fa; + --bs-btn-disabled-border-color: #f8f9fa +} + +.btn-dark { + --bs-btn-color: #fff; + --bs-btn-bg: #000000; + --bs-btn-border-color: #000000; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #262626; + --bs-btn-hover-border-color: #1a1a1a; + --bs-btn-focus-shadow-rgb: 38, 38, 38; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #333333; + --bs-btn-active-border-color: #1a1a1a; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #fff; + --bs-btn-disabled-bg: #000000; + --bs-btn-disabled-border-color: #000000 +} + +.btn-outline-primary { + --bs-btn-color: #2a5555; + --bs-btn-border-color: #2a5555; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #2a5555; + --bs-btn-hover-border-color: #2a5555; + --bs-btn-focus-shadow-rgb: 42, 85, 85; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #2a5555; + --bs-btn-active-border-color: #2a5555; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #2a5555; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #2a5555; + --bs-gradient: none +} + +.btn-outline-secondary { + --bs-btn-color: #6c757d; + --bs-btn-border-color: #6c757d; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #6c757d; + --bs-btn-hover-border-color: #6c757d; + --bs-btn-focus-shadow-rgb: 108, 117, 125; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #6c757d; + --bs-btn-active-border-color: #6c757d; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #6c757d; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #6c757d; + --bs-gradient: none +} + +.btn-outline-success { + --bs-btn-color: #198754; + --bs-btn-border-color: #198754; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #198754; + --bs-btn-hover-border-color: #198754; + --bs-btn-focus-shadow-rgb: 25, 135, 84; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #198754; + --bs-btn-active-border-color: #198754; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #198754; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #198754; + --bs-gradient: none +} + +.btn-outline-info { + --bs-btn-color: #0dcaf0; + --bs-btn-border-color: #0dcaf0; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #0dcaf0; + --bs-btn-hover-border-color: #0dcaf0; + --bs-btn-focus-shadow-rgb: 13, 202, 240; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #0dcaf0; + --bs-btn-active-border-color: #0dcaf0; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #0dcaf0; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #0dcaf0; + --bs-gradient: none +} + +.btn-outline-warning { + --bs-btn-color: #ffc107; + --bs-btn-border-color: #ffc107; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #ffc107; + --bs-btn-hover-border-color: #ffc107; + --bs-btn-focus-shadow-rgb: 255, 193, 7; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #ffc107; + --bs-btn-active-border-color: #ffc107; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #ffc107; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #ffc107; + --bs-gradient: none +} + +.btn-outline-danger { + --bs-btn-color: #dc3545; + --bs-btn-border-color: #dc3545; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #dc3545; + --bs-btn-hover-border-color: #dc3545; + --bs-btn-focus-shadow-rgb: 220, 53, 69; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #dc3545; + --bs-btn-active-border-color: #dc3545; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #dc3545; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #dc3545; + --bs-gradient: none +} + +.btn-outline-light { + --bs-btn-color: #f8f9fa; + --bs-btn-border-color: #f8f9fa; + --bs-btn-hover-color: #000; + --bs-btn-hover-bg: #f8f9fa; + --bs-btn-hover-border-color: #f8f9fa; + --bs-btn-focus-shadow-rgb: 248, 249, 250; + --bs-btn-active-color: #000; + --bs-btn-active-bg: #f8f9fa; + --bs-btn-active-border-color: #f8f9fa; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #f8f9fa; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #f8f9fa; + --bs-gradient: none +} + +.btn-outline-dark { + --bs-btn-color: #000000; + --bs-btn-border-color: #000000; + --bs-btn-hover-color: #fff; + --bs-btn-hover-bg: #000000; + --bs-btn-hover-border-color: #000000; + --bs-btn-focus-shadow-rgb: 0, 0, 0; + --bs-btn-active-color: #fff; + --bs-btn-active-bg: #000000; + --bs-btn-active-border-color: #000000; + --bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125); + --bs-btn-disabled-color: #000000; + --bs-btn-disabled-bg: transparent; + --bs-btn-disabled-border-color: #000000; + --bs-gradient: none +} + +.btn-link { + --bs-btn-font-weight: 400; + --bs-btn-color: var(--bs-link-color); + --bs-btn-bg: transparent; + --bs-btn-border-color: transparent; + --bs-btn-hover-color: var(--bs-link-hover-color); + --bs-btn-hover-border-color: transparent; + --bs-btn-active-color: var(--bs-link-hover-color); + --bs-btn-active-border-color: transparent; + --bs-btn-disabled-color: #6c757d; + --bs-btn-disabled-border-color: transparent; + --bs-btn-box-shadow: none; + --bs-btn-focus-shadow-rgb: 74, 111, 111; + text-decoration:underline +} + +.btn-link:focus-visible { + color:var(--bs-btn-color) +} + +.btn-link:hover { + color:var(--bs-btn-hover-color) +} + +.btn-lg, .btn-group-lg > .btn { + --bs-btn-padding-y: 0.5rem; + --bs-btn-padding-x: 1rem; + --bs-btn-font-size: 1.25rem; + --bs-btn-border-radius: 0.5rem +} + +.btn-sm, .btn-group-sm > .btn { + --bs-btn-padding-y: 0.25rem; + --bs-btn-padding-x: 0.5rem; + --bs-btn-font-size: 0.875rem; + --bs-btn-border-radius: 0.25rem +} + +.fade { + transition:opacity .15s linear +} + +@media (prefers-reduced-motion: reduce) { + .fade { + transition:none + } +} + +.fade:not(.show) { + opacity:0 +} + +.collapse:not(.show) { + display:none +} + +.collapsing { + height: 0; + overflow: hidden; + transition:height .35s ease +} + +@media (prefers-reduced-motion: reduce) { + .collapsing { + transition:none + } +} + +.collapsing.collapse-horizontal { + width: 0; + height: auto; + transition:width .35s ease +} + +@media (prefers-reduced-motion: reduce) { + .collapsing.collapse-horizontal { + transition:none + } +} + +.dropup, .dropend, .dropdown, .dropstart, .dropup-center, .dropdown-center { + position:relative +} + +.dropdown-toggle { + white-space:nowrap +} + +.dropdown-toggle::after { + display: inline-block; + margin-left: .255em; + vertical-align: .255em; + content: ""; + border-top: .3em solid; + border-right: .3em solid rgba(0, 0, 0, 0); + border-bottom: 0; + border-left:.3em solid rgba(0, 0, 0, 0) +} + +.dropdown-toggle:empty::after { + margin-left:0 +} + +.dropdown-menu { + --bs-dropdown-zindex: 1000; + --bs-dropdown-min-width: 10rem; + --bs-dropdown-padding-x: 0; + --bs-dropdown-padding-y: 0.5rem; + --bs-dropdown-spacer: 0.125rem; + --bs-dropdown-font-size: 1rem; + --bs-dropdown-color: #000000; + --bs-dropdown-bg: #fff; + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-border-radius: 0.375rem; + --bs-dropdown-border-width: 1px; + --bs-dropdown-inner-border-radius: calc(0.375rem - 1px); + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-divider-margin-y: 0.5rem; + --bs-dropdown-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15); + --bs-dropdown-link-color: #000000; + --bs-dropdown-link-hover-color: black; + --bs-dropdown-link-hover-bg: #e9ecef; + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #2a5555; + --bs-dropdown-link-disabled-color: #adb5bd; + --bs-dropdown-item-padding-x: 1rem; + --bs-dropdown-item-padding-y: 0.25rem; + --bs-dropdown-header-color: #6c757d; + --bs-dropdown-header-padding-x: 1rem; + --bs-dropdown-header-padding-y: 0.5rem; + position: absolute; + z-index: var(--bs-dropdown-zindex); + display: none; + min-width: var(--bs-dropdown-min-width); + padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x); + margin: 0; + font-size: var(--bs-dropdown-font-size); + color: var(--bs-dropdown-color); + text-align: left; + list-style: none; + background-color: var(--bs-dropdown-bg); + background-clip: padding-box; + border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color); + border-radius:var(--bs-dropdown-border-radius) +} + +.dropdown-menu[data-bs-popper] { + top: 100%; + left: 0; + margin-top:var(--bs-dropdown-spacer) +} + +.dropdown-menu-start { + --bs-position: start +} + +.dropdown-menu-start[data-bs-popper] { + right: auto; + left:0 +} + +.dropdown-menu-end { + --bs-position: end +} + +.dropdown-menu-end[data-bs-popper] { + right: 0; + left:auto +} + +@media (min-width: 576px) { + .dropdown-menu-sm-start { + --bs-position: start + } + + .dropdown-menu-sm-start[data-bs-popper] { + right: auto; + left:0 + } + + .dropdown-menu-sm-end { + --bs-position: end + } + + .dropdown-menu-sm-end[data-bs-popper] { + right: 0; + left:auto + } +} + +@media (min-width: 768px) { + .dropdown-menu-md-start { + --bs-position: start + } + + .dropdown-menu-md-start[data-bs-popper] { + right: auto; + left:0 + } + + .dropdown-menu-md-end { + --bs-position: end + } + + .dropdown-menu-md-end[data-bs-popper] { + right: 0; + left:auto + } +} + +@media (min-width: 992px) { + .dropdown-menu-lg-start { + --bs-position: start + } + + .dropdown-menu-lg-start[data-bs-popper] { + right: auto; + left:0 + } + + .dropdown-menu-lg-end { + --bs-position: end + } + + .dropdown-menu-lg-end[data-bs-popper] { + right: 0; + left:auto + } +} + +@media (min-width: 1200px) { + .dropdown-menu-xl-start { + --bs-position: start + } + + .dropdown-menu-xl-start[data-bs-popper] { + right: auto; + left:0 + } + + .dropdown-menu-xl-end { + --bs-position: end + } + + .dropdown-menu-xl-end[data-bs-popper] { + right: 0; + left:auto + } +} + +@media (min-width: 1400px) { + .dropdown-menu-xxl-start { + --bs-position: start + } + + .dropdown-menu-xxl-start[data-bs-popper] { + right: auto; + left:0 + } + + .dropdown-menu-xxl-end { + --bs-position: end + } + + .dropdown-menu-xxl-end[data-bs-popper] { + right: 0; + left:auto + } +} + +.dropup .dropdown-menu[data-bs-popper] { + top: auto; + bottom: 100%; + margin-top: 0; + margin-bottom:var(--bs-dropdown-spacer) +} + +.dropup .dropdown-toggle::after { + display: inline-block; + margin-left: .255em; + vertical-align: .255em; + content: ""; + border-top: 0; + border-right: .3em solid rgba(0, 0, 0, 0); + border-bottom: .3em solid; + border-left:.3em solid rgba(0, 0, 0, 0) +} + +.dropup .dropdown-toggle:empty::after { + margin-left:0 +} + +.dropend .dropdown-menu[data-bs-popper] { + top: 0; + right: auto; + left: 100%; + margin-top: 0; + margin-left:var(--bs-dropdown-spacer) +} + +.dropend .dropdown-toggle::after { + display: inline-block; + margin-left: .255em; + vertical-align: .255em; + content: ""; + border-top: .3em solid rgba(0, 0, 0, 0); + border-right: 0; + border-bottom: .3em solid rgba(0, 0, 0, 0); + border-left:.3em solid +} + +.dropend .dropdown-toggle:empty::after { + margin-left:0 +} + +.dropend .dropdown-toggle::after { + vertical-align:0 +} + +.dropstart .dropdown-menu[data-bs-popper] { + top: 0; + right: 100%; + left: auto; + margin-top: 0; + margin-right:var(--bs-dropdown-spacer) +} + +.dropstart .dropdown-toggle::after { + display: inline-block; + margin-left: .255em; + vertical-align: .255em; + content: "" +} + +.dropstart .dropdown-toggle::after { + display:none +} + +.dropstart .dropdown-toggle::before { + display: inline-block; + margin-right: .255em; + vertical-align: .255em; + content: ""; + border-top: .3em solid rgba(0, 0, 0, 0); + border-right: .3em solid; + border-bottom:.3em solid rgba(0, 0, 0, 0) +} + +.dropstart .dropdown-toggle:empty::after { + margin-left:0 +} + +.dropstart .dropdown-toggle::before { + vertical-align:0 +} + +.dropdown-divider { + height: 0; + margin: var(--bs-dropdown-divider-margin-y) 0; + overflow: hidden; + border-top: 1px solid var(--bs-dropdown-divider-bg); + opacity:1 +} + +.dropdown-item { + display: block; + width: 100%; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + clear: both; + font-weight: 400; + color: var(--bs-dropdown-link-color); + text-align: inherit; + text-decoration: none; + white-space: nowrap; + background-color: rgba(0, 0, 0, 0); + border:0 +} + +.dropdown-item:hover, .dropdown-item:focus { + color: var(--bs-dropdown-link-hover-color); + background-color:var(--bs-dropdown-link-hover-bg) +} + +.dropdown-item.active, .dropdown-item:active { + color: var(--bs-dropdown-link-active-color); + text-decoration: none; + background-color:var(--bs-dropdown-link-active-bg) +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: var(--bs-dropdown-link-disabled-color); + pointer-events: none; + background-color:rgba(0, 0, 0, 0) +} + +.dropdown-menu.show { + display:block +} + +.dropdown-header { + display: block; + padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x); + margin-bottom: 0; + font-size: .875rem; + color: var(--bs-dropdown-header-color); + white-space:nowrap +} + +.dropdown-item-text { + display: block; + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + color:var(--bs-dropdown-link-color) +} + +.dropdown-menu-dark { + --bs-dropdown-color: #dee2e6; + --bs-dropdown-bg: #343a40; + --bs-dropdown-border-color: var(--bs-border-color-translucent); + --bs-dropdown-box-shadow:; + --bs-dropdown-link-color: #dee2e6; + --bs-dropdown-link-hover-color: #fff; + --bs-dropdown-divider-bg: var(--bs-border-color-translucent); + --bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15); + --bs-dropdown-link-active-color: #fff; + --bs-dropdown-link-active-bg: #2a5555; + --bs-dropdown-link-disabled-color: #adb5bd; + --bs-dropdown-header-color: #adb5bd +} + +.btn-group, .btn-group-vertical { + position: relative; + display: inline-flex; + vertical-align:middle +} + +.btn-group > .btn, .btn-group-vertical > .btn { + position: relative; + flex:1 1 auto +} + +.btn-group > .btn-check:checked + .btn, .btn-group > .btn-check:focus + .btn, .btn-group > .btn:hover, .btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, .btn-group-vertical > .btn-check:checked + .btn, .btn-group-vertical > .btn-check:focus + .btn, .btn-group-vertical > .btn:hover, .btn-group-vertical > .btn:focus, .btn-group-vertical > .btn:active, .btn-group-vertical > .btn.active { + z-index:1 +} + +.btn-toolbar { + display: flex; + flex-wrap: wrap; + justify-content:flex-start +} + +.btn-toolbar .input-group { + width:auto +} + +.btn-group { + border-radius:.375rem +} + +.btn-group > :not(.btn-check:first-child) + .btn, .btn-group > .btn-group:not(:first-child) { + margin-left:-1px +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), .btn-group > .btn.dropdown-toggle-split:first-child, .btn-group > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius:0 +} + +.btn-group > .btn:nth-child(n + 3), .btn-group > :not(.btn-check) + .btn, .btn-group > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius:0 +} + +.dropdown-toggle-split { + padding-right: .5625rem; + padding-left:.5625rem +} + +.dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after { + margin-left:0 +} + +.dropstart .dropdown-toggle-split::before { + margin-right:0 +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-right: .375rem; + padding-left:.375rem +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-right: .75rem; + padding-left:.75rem +} + +.btn-group-vertical { + flex-direction: column; + align-items: flex-start; + justify-content:center +} + +.btn-group-vertical > .btn, .btn-group-vertical > .btn-group { + width:100% +} + +.btn-group-vertical > .btn:not(:first-child), .btn-group-vertical > .btn-group:not(:first-child) { + margin-top:-1px +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), .btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-bottom-left-radius:0 +} + +.btn-group-vertical > .btn ~ .btn, .btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-top-right-radius:0 +} + +.nav { + --bs-nav-link-padding-x: 1rem; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight:; + --bs-nav-link-color: var(--bs-link-color); + --bs-nav-link-hover-color: var(--bs-link-hover-color); + --bs-nav-link-disabled-color: #6c757d; + display: flex; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style:none +} + +.nav-link { + display: block; + padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x); + font-size: var(--bs-nav-link-font-size); + font-weight: var(--bs-nav-link-font-weight); + color: var(--bs-nav-link-color); + text-decoration: none; + transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .nav-link { + transition:none + } +} + +.nav-link:hover, .nav-link:focus { + color:var(--bs-nav-link-hover-color) +} + +.nav-link.disabled { + color: var(--bs-nav-link-disabled-color); + pointer-events: none; + cursor:default +} + +.nav-tabs { + --bs-nav-tabs-border-width: 1px; + --bs-nav-tabs-border-color: #dee2e6; + --bs-nav-tabs-border-radius: 0.375rem; + --bs-nav-tabs-link-hover-border-color: #e9ecef #e9ecef #dee2e6; + --bs-nav-tabs-link-active-color: #495057; + --bs-nav-tabs-link-active-bg: #fff; + --bs-nav-tabs-link-active-border-color: #dee2e6 #dee2e6 #fff; + border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color) +} + +.nav-tabs .nav-link { + margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width)); + background: none; + border: var(--bs-nav-tabs-border-width) solid rgba(0, 0, 0, 0); + border-top-left-radius: var(--bs-nav-tabs-border-radius); + border-top-right-radius:var(--bs-nav-tabs-border-radius) +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + isolation: isolate; + border-color:var(--bs-nav-tabs-link-hover-border-color) +} + +.nav-tabs .nav-link.disabled, .nav-tabs .nav-link:disabled { + color: var(--bs-nav-link-disabled-color); + background-color: rgba(0, 0, 0, 0); + border-color:rgba(0, 0, 0, 0) +} + +.nav-tabs .nav-link.active, .nav-tabs .nav-item.show .nav-link { + color: var(--bs-nav-tabs-link-active-color); + background-color: var(--bs-nav-tabs-link-active-bg); + border-color:var(--bs-nav-tabs-link-active-border-color) +} + +.nav-tabs .dropdown-menu { + margin-top: calc(-1 * var(--bs-nav-tabs-border-width)); + border-top-left-radius: 0; + border-top-right-radius:0 +} + +.nav-pills { + --bs-nav-pills-border-radius: 0.375rem; + --bs-nav-pills-link-active-color: #fff; + --bs-nav-pills-link-active-bg: #2a5555 +} + +.nav-pills .nav-link { + background: none; + border: 0; + border-radius:var(--bs-nav-pills-border-radius) +} + +.nav-pills .nav-link:disabled { + color: var(--bs-nav-link-disabled-color); + background-color: rgba(0, 0, 0, 0); + border-color:rgba(0, 0, 0, 0) +} + +.nav-pills .nav-link.active, .nav-pills .show > .nav-link { + color: var(--bs-nav-pills-link-active-color); + background-color:var(--bs-nav-pills-link-active-bg) +} + +.nav-fill > .nav-link, .nav-fill .nav-item { + flex: 1 1 auto; + text-align:center +} + +.nav-justified > .nav-link, .nav-justified .nav-item { + flex-basis: 0; + flex-grow: 1; + text-align:center +} + +.nav-fill .nav-item .nav-link, .nav-justified .nav-item .nav-link { + width:100% +} + +.tab-content > .tab-pane { + display:none +} + +.tab-content > .active { + display:block +} + +.navbar { + --bs-navbar-padding-x: 0; + --bs-navbar-padding-y: 0.5rem; + --bs-navbar-color: rgba(0, 0, 0, 0.55); + --bs-navbar-hover-color: rgba(0, 0, 0, 0.7); + --bs-navbar-disabled-color: rgba(0, 0, 0, 0.3); + --bs-navbar-active-color: rgba(0, 0, 0, 0.9); + --bs-navbar-brand-padding-y: 0.3125rem; + --bs-navbar-brand-margin-end: 1rem; + --bs-navbar-brand-font-size: 1.25rem; + --bs-navbar-brand-color: rgba(0, 0, 0, 0.9); + --bs-navbar-brand-hover-color: rgba(0, 0, 0, 0.9); + --bs-navbar-nav-link-padding-x: 0.5rem; + --bs-navbar-toggler-padding-y: 0.25rem; + --bs-navbar-toggler-padding-x: 0.75rem; + --bs-navbar-toggler-font-size: 1.25rem; + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); + --bs-navbar-toggler-border-color: rgba(0, 0, 0, 0.1); + --bs-navbar-toggler-border-radius: 0.375rem; + --bs-navbar-toggler-focus-width: 0.25rem; + --bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out; + position: relative; + display: flex; + flex-wrap: wrap; + align-items: center; + justify-content: space-between; + padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x) +} + +.navbar > .container, .navbar > .container-fluid, .navbar > .container-sm, .navbar > .container-md, .navbar > .container-lg, .navbar > .container-xl, .navbar > .container-xxl { + display: flex; + flex-wrap: inherit; + align-items: center; + justify-content:space-between +} + +.navbar-brand { + padding-top: var(--bs-navbar-brand-padding-y); + padding-bottom: var(--bs-navbar-brand-padding-y); + margin-right: var(--bs-navbar-brand-margin-end); + font-size: var(--bs-navbar-brand-font-size); + color: var(--bs-navbar-brand-color); + text-decoration: none; + white-space:nowrap +} + +.navbar-brand:hover, .navbar-brand:focus { + color:var(--bs-navbar-brand-hover-color) +} + +.navbar-nav { + --bs-nav-link-padding-x: 0; + --bs-nav-link-padding-y: 0.5rem; + --bs-nav-link-font-weight:; + --bs-nav-link-color: var(--bs-navbar-color); + --bs-nav-link-hover-color: var(--bs-navbar-hover-color); + --bs-nav-link-disabled-color: var(--bs-navbar-disabled-color); + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style:none +} + +.navbar-nav .show > .nav-link, .navbar-nav .nav-link.active { + color:var(--bs-navbar-active-color) +} + +.navbar-nav .dropdown-menu { + position:static +} + +.navbar-text { + padding-top: .5rem; + padding-bottom: .5rem; + color:var(--bs-navbar-color) +} + +.navbar-text a, .navbar-text a:hover, .navbar-text a:focus { + color:var(--bs-navbar-active-color) +} + +.navbar-collapse { + flex-basis: 100%; + flex-grow: 1; + align-items:center +} + +.navbar-toggler { + padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x); + font-size: var(--bs-navbar-toggler-font-size); + line-height: 1; + color: var(--bs-navbar-color); + background-color: rgba(0, 0, 0, 0); + border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color); + border-radius: var(--bs-navbar-toggler-border-radius); + transition:var(--bs-navbar-toggler-transition) +} + +@media (prefers-reduced-motion: reduce) { + .navbar-toggler { + transition:none + } +} + +.navbar-toggler:hover { + text-decoration:none +} + +.navbar-toggler:focus { + text-decoration: none; + outline: 0; + box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width) +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + background-image: var(--bs-navbar-toggler-icon-bg); + background-repeat: no-repeat; + background-position: center; + background-size:100% +} + +.navbar-nav-scroll { + max-height: var(--bs-scroll-height, 75vh); + overflow-y:auto +} + +@media (min-width: 576px) { + .navbar-expand-sm { + flex-wrap: nowrap; + justify-content:flex-start + } + + .navbar-expand-sm .navbar-nav { + flex-direction:row + } + + .navbar-expand-sm .navbar-nav .dropdown-menu { + position:absolute + } + + .navbar-expand-sm .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) + } + + .navbar-expand-sm .navbar-nav-scroll { + overflow:visible + } + + .navbar-expand-sm .navbar-collapse { + display: flex !important; + flex-basis:auto + } + + .navbar-expand-sm .navbar-toggler { + display:none + } + + .navbar-expand-sm .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none + } + + .navbar-expand-sm .offcanvas .offcanvas-header { + display:none + } + + .navbar-expand-sm .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + flex-wrap: nowrap; + justify-content:flex-start + } + + .navbar-expand-md .navbar-nav { + flex-direction:row + } + + .navbar-expand-md .navbar-nav .dropdown-menu { + position:absolute + } + + .navbar-expand-md .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) + } + + .navbar-expand-md .navbar-nav-scroll { + overflow:visible + } + + .navbar-expand-md .navbar-collapse { + display: flex !important; + flex-basis:auto + } + + .navbar-expand-md .navbar-toggler { + display:none + } + + .navbar-expand-md .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none + } + + .navbar-expand-md .offcanvas .offcanvas-header { + display:none + } + + .navbar-expand-md .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + flex-wrap: nowrap; + justify-content:flex-start + } + + .navbar-expand-lg .navbar-nav { + flex-direction:row + } + + .navbar-expand-lg .navbar-nav .dropdown-menu { + position:absolute + } + + .navbar-expand-lg .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) + } + + .navbar-expand-lg .navbar-nav-scroll { + overflow:visible + } + + .navbar-expand-lg .navbar-collapse { + display: flex !important; + flex-basis:auto + } + + .navbar-expand-lg .navbar-toggler { + display:none + } + + .navbar-expand-lg .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none + } + + .navbar-expand-lg .offcanvas .offcanvas-header { + display:none + } + + .navbar-expand-lg .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible + } +} + +@media (min-width: 1200px) { + .navbar-expand-xl { + flex-wrap: nowrap; + justify-content:flex-start + } + + .navbar-expand-xl .navbar-nav { + flex-direction:row + } + + .navbar-expand-xl .navbar-nav .dropdown-menu { + position:absolute + } + + .navbar-expand-xl .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) + } + + .navbar-expand-xl .navbar-nav-scroll { + overflow:visible + } + + .navbar-expand-xl .navbar-collapse { + display: flex !important; + flex-basis:auto + } + + .navbar-expand-xl .navbar-toggler { + display:none + } + + .navbar-expand-xl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none + } + + .navbar-expand-xl .offcanvas .offcanvas-header { + display:none + } + + .navbar-expand-xl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible + } +} + +@media (min-width: 1400px) { + .navbar-expand-xxl { + flex-wrap: nowrap; + justify-content:flex-start + } + + .navbar-expand-xxl .navbar-nav { + flex-direction:row + } + + .navbar-expand-xxl .navbar-nav .dropdown-menu { + position:absolute + } + + .navbar-expand-xxl .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) + } + + .navbar-expand-xxl .navbar-nav-scroll { + overflow:visible + } + + .navbar-expand-xxl .navbar-collapse { + display: flex !important; + flex-basis:auto + } + + .navbar-expand-xxl .navbar-toggler { + display:none + } + + .navbar-expand-xxl .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none + } + + .navbar-expand-xxl .offcanvas .offcanvas-header { + display:none + } + + .navbar-expand-xxl .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible + } +} + +.navbar-expand { + flex-wrap: nowrap; + justify-content:flex-start +} + +.navbar-expand .navbar-nav { + flex-direction:row +} + +.navbar-expand .navbar-nav .dropdown-menu { + position:absolute +} + +.navbar-expand .navbar-nav .nav-link { + padding-right: var(--bs-navbar-nav-link-padding-x); + padding-left:var(--bs-navbar-nav-link-padding-x) +} + +.navbar-expand .navbar-nav-scroll { + overflow:visible +} + +.navbar-expand .navbar-collapse { + display: flex !important; + flex-basis:auto +} + +.navbar-expand .navbar-toggler { + display:none +} + +.navbar-expand .offcanvas { + position: static; + z-index: auto; + flex-grow: 1; + width: auto !important; + height: auto !important; + visibility: visible !important; + background-color: rgba(0, 0, 0, 0) !important; + border: 0 !important; + transform: none !important; + transition:none +} + +.navbar-expand .offcanvas .offcanvas-header { + display:none +} + +.navbar-expand .offcanvas .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y:visible +} + +.navbar-dark { + --bs-navbar-color: rgba(255, 255, 255, 0.55); + --bs-navbar-hover-color: rgba(255, 255, 255, 0.75); + --bs-navbar-disabled-color: rgba(255, 255, 255, 0.25); + --bs-navbar-active-color: #fff; + --bs-navbar-brand-color: #fff; + --bs-navbar-brand-hover-color: #fff; + --bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1); + --bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e") +} + +.card { + --bs-card-spacer-y: 1rem; + --bs-card-spacer-x: 1rem; + --bs-card-title-spacer-y: 0.5rem; + --bs-card-border-width: 1px; + --bs-card-border-color: var(--bs-border-color-translucent); + --bs-card-border-radius: 0.375rem; + --bs-card-box-shadow:; + --bs-card-inner-border-radius: calc(0.375rem - 1px); + --bs-card-cap-padding-y: 0.5rem; + --bs-card-cap-padding-x: 1rem; + --bs-card-cap-bg: rgba(0, 0, 0, 0.03); + --bs-card-cap-color:; + --bs-card-height:; + --bs-card-color:; + --bs-card-bg: #fff; + --bs-card-img-overlay-padding: 1rem; + --bs-card-group-margin: 0.75rem; + position: relative; + display: flex; + flex-direction: column; + min-width: 0; + height: var(--bs-card-height); + word-wrap: break-word; + background-color: var(--bs-card-bg); + background-clip: border-box; + border: var(--bs-card-border-width) solid var(--bs-card-border-color); + border-radius:var(--bs-card-border-radius) +} + +.card > hr { + margin-right: 0; + margin-left:0 +} + +.card > .list-group { + border-top: inherit; + border-bottom:inherit +} + +.card > .list-group:first-child { + border-top-width: 0; + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius:var(--bs-card-inner-border-radius) +} + +.card > .list-group:last-child { + border-bottom-width: 0; + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius:var(--bs-card-inner-border-radius) +} + +.card > .card-header + .list-group, .card > .list-group + .card-footer { + border-top:0 +} + +.card-body { + flex: 1 1 auto; + padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x); + color:var(--bs-card-color) +} + +.card-title { + margin-bottom:var(--bs-card-title-spacer-y) +} + +.card-subtitle { + margin-top: calc(-0.5 * var(--bs-card-title-spacer-y)); + margin-bottom:0 +} + +.card-text:last-child { + margin-bottom:0 +} + +.card-link + .card-link { + margin-left:var(--bs-card-spacer-x) +} + +.card-header { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + margin-bottom: 0; + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color) +} + +.card-header:first-child { + border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0 +} + +.card-footer { + padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x); + color: var(--bs-card-cap-color); + background-color: var(--bs-card-cap-bg); + border-top:var(--bs-card-border-width) solid var(--bs-card-border-color) +} + +.card-footer:last-child { + border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) +} + +.card-header-tabs { + margin-right: calc(-0.5 * var(--bs-card-cap-padding-x)); + margin-bottom: calc(-1 * var(--bs-card-cap-padding-y)); + margin-left: calc(-0.5 * var(--bs-card-cap-padding-x)); + border-bottom:0 +} + +.card-header-tabs .nav-link.active { + background-color: var(--bs-card-bg); + border-bottom-color:var(--bs-card-bg) +} + +.card-header-pills { + margin-right: calc(-0.5 * var(--bs-card-cap-padding-x)); + margin-left:calc(-0.5 * var(--bs-card-cap-padding-x)) +} + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: var(--bs-card-img-overlay-padding); + border-radius:var(--bs-card-inner-border-radius) +} + +.card-img, .card-img-top, .card-img-bottom { + width:100% +} + +.card-img, .card-img-top { + border-top-left-radius: var(--bs-card-inner-border-radius); + border-top-right-radius:var(--bs-card-inner-border-radius) +} + +.card-img, .card-img-bottom { + border-bottom-right-radius: var(--bs-card-inner-border-radius); + border-bottom-left-radius:var(--bs-card-inner-border-radius) +} + +.card-group > .card { + margin-bottom:var(--bs-card-group-margin) +} + +@media (min-width: 576px) { + .card-group { + display: flex; + flex-flow:row wrap + } + + .card-group > .card { + flex: 1 0 0%; + margin-bottom:0 + } + + .card-group > .card + .card { + margin-left: 0; + border-left:0 + } + + .card-group > .card:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius:0 + } + + .card-group > .card:not(:last-child) .card-img-top, .card-group > .card:not(:last-child) .card-header { + border-top-right-radius:0 + } + + .card-group > .card:not(:last-child) .card-img-bottom, .card-group > .card:not(:last-child) .card-footer { + border-bottom-right-radius:0 + } + + .card-group > .card:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius:0 + } + + .card-group > .card:not(:first-child) .card-img-top, .card-group > .card:not(:first-child) .card-header { + border-top-left-radius:0 + } + + .card-group > .card:not(:first-child) .card-img-bottom, .card-group > .card:not(:first-child) .card-footer { + border-bottom-left-radius:0 + } +} + +.accordion { + --bs-accordion-color: #000000; + --bs-accordion-bg: #fff; + --bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease; + --bs-accordion-border-color: var(--bs-border-color); + --bs-accordion-border-width: 1px; + --bs-accordion-border-radius: 0.375rem; + --bs-accordion-inner-border-radius: calc(0.375rem - 1px); + --bs-accordion-btn-padding-x: 1.25rem; + --bs-accordion-btn-padding-y: 1rem; + --bs-accordion-btn-color: #000000; + --bs-accordion-btn-bg: var(--bs-accordion-bg); + --bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000000'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); + --bs-accordion-btn-icon-width: 1.25rem; + --bs-accordion-btn-icon-transform: rotate(-180deg); + --bs-accordion-btn-icon-transition: transform 0.2s ease-in-out; + --bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23264d4d'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e"); + --bs-accordion-btn-focus-border-color: #95aaaa; + --bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(42, 85, 85, 0.25); + --bs-accordion-body-padding-x: 1.25rem; + --bs-accordion-body-padding-y: 1rem; + --bs-accordion-active-color: #264d4d; + --bs-accordion-active-bg: #eaeeee +} + +.accordion-button { + position: relative; + display: flex; + align-items: center; + width: 100%; + padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x); + font-size: 1rem; + color: var(--bs-accordion-btn-color); + text-align: left; + background-color: var(--bs-accordion-btn-bg); + border: 0; + border-radius: 0; + overflow-anchor: none; + transition:var(--bs-accordion-transition) +} + +@media (prefers-reduced-motion: reduce) { + .accordion-button { + transition:none + } +} + +.accordion-button:not(.collapsed) { + color: var(--bs-accordion-active-color); + background-color: var(--bs-accordion-active-bg); + box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color) +} + +.accordion-button:not(.collapsed)::after { + background-image: var(--bs-accordion-btn-active-icon); + transform:var(--bs-accordion-btn-icon-transform) +} + +.accordion-button::after { + flex-shrink: 0; + width: var(--bs-accordion-btn-icon-width); + height: var(--bs-accordion-btn-icon-width); + margin-left: auto; + content: ""; + background-image: var(--bs-accordion-btn-icon); + background-repeat: no-repeat; + background-size: var(--bs-accordion-btn-icon-width); + transition:var(--bs-accordion-btn-icon-transition) +} + +@media (prefers-reduced-motion: reduce) { + .accordion-button::after { + transition:none + } +} + +.accordion-button:hover { + z-index:2 +} + +.accordion-button:focus { + z-index: 3; + border-color: var(--bs-accordion-btn-focus-border-color); + outline: 0; + box-shadow:var(--bs-accordion-btn-focus-box-shadow) +} + +.accordion-header { + margin-bottom:0 +} + +.accordion-item { + color: var(--bs-accordion-color); + background-color: var(--bs-accordion-bg); + border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color) +} + +.accordion-item:first-of-type { + border-top-left-radius: var(--bs-accordion-border-radius); + border-top-right-radius:var(--bs-accordion-border-radius) +} + +.accordion-item:first-of-type .accordion-button { + border-top-left-radius: var(--bs-accordion-inner-border-radius); + border-top-right-radius:var(--bs-accordion-inner-border-radius) +} + +.accordion-item:not(:first-of-type) { + border-top:0 +} + +.accordion-item:last-of-type { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius:var(--bs-accordion-border-radius) +} + +.accordion-item:last-of-type .accordion-button.collapsed { + border-bottom-right-radius: var(--bs-accordion-inner-border-radius); + border-bottom-left-radius:var(--bs-accordion-inner-border-radius) +} + +.accordion-item:last-of-type .accordion-collapse { + border-bottom-right-radius: var(--bs-accordion-border-radius); + border-bottom-left-radius:var(--bs-accordion-border-radius) +} + +.accordion-body { + padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x) +} + +.accordion-flush .accordion-collapse { + border-width:0 +} + +.accordion-flush .accordion-item { + border-right: 0; + border-left: 0; + border-radius:0 +} + +.accordion-flush .accordion-item:first-child { + border-top:0 +} + +.accordion-flush .accordion-item:last-child { + border-bottom:0 +} + +.accordion-flush .accordion-item .accordion-button, .accordion-flush .accordion-item .accordion-button.collapsed { + border-radius:0 +} + +.breadcrumb { + --bs-breadcrumb-padding-x: 0; + --bs-breadcrumb-padding-y: 0; + --bs-breadcrumb-margin-bottom: 1rem; + --bs-breadcrumb-bg:; + --bs-breadcrumb-border-radius:; + --bs-breadcrumb-divider-color: #6c757d; + --bs-breadcrumb-item-padding-x: 0.5rem; + --bs-breadcrumb-item-active-color: #6c757d; + display: flex; + flex-wrap: wrap; + padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x); + margin-bottom: var(--bs-breadcrumb-margin-bottom); + font-size: var(--bs-breadcrumb-font-size); + list-style: none; + background-color: var(--bs-breadcrumb-bg); + border-radius:var(--bs-breadcrumb-border-radius) +} + +.breadcrumb-item + .breadcrumb-item { + padding-left:var(--bs-breadcrumb-item-padding-x) +} + +.breadcrumb-item + .breadcrumb-item::before { + float: left; + padding-right: var(--bs-breadcrumb-item-padding-x); + color: var(--bs-breadcrumb-divider-color); + content: var(--bs-breadcrumb-divider, "/") +} + +.breadcrumb-item.active { + color:var(--bs-breadcrumb-item-active-color) +} + +.pagination { + --bs-pagination-padding-x: 0.75rem; + --bs-pagination-padding-y: 0.375rem; + --bs-pagination-font-size: 1rem; + --bs-pagination-color: var(--bs-link-color); + --bs-pagination-bg: #fff; + --bs-pagination-border-width: 1px; + --bs-pagination-border-color: #dee2e6; + --bs-pagination-border-radius: 0.375rem; + --bs-pagination-hover-color: var(--bs-link-hover-color); + --bs-pagination-hover-bg: #e9ecef; + --bs-pagination-hover-border-color: #dee2e6; + --bs-pagination-focus-color: var(--bs-link-hover-color); + --bs-pagination-focus-bg: #e9ecef; + --bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(42, 85, 85, 0.25); + --bs-pagination-active-color: #fff; + --bs-pagination-active-bg: #2a5555; + --bs-pagination-active-border-color: #2a5555; + --bs-pagination-disabled-color: #6c757d; + --bs-pagination-disabled-bg: #fff; + --bs-pagination-disabled-border-color: #dee2e6; + display: flex; + padding-left: 0; + list-style:none +} + +.page-link { + position: relative; + display: block; + padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x); + font-size: var(--bs-pagination-font-size); + color: var(--bs-pagination-color); + text-decoration: none; + background-color: var(--bs-pagination-bg); + border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color); + transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .page-link { + transition:none + } +} + +.page-link:hover { + z-index: 2; + color: var(--bs-pagination-hover-color); + background-color: var(--bs-pagination-hover-bg); + border-color:var(--bs-pagination-hover-border-color) +} + +.page-link:focus { + z-index: 3; + color: var(--bs-pagination-focus-color); + background-color: var(--bs-pagination-focus-bg); + outline: 0; + box-shadow:var(--bs-pagination-focus-box-shadow) +} + +.page-link.active, .active > .page-link { + z-index: 3; + color: var(--bs-pagination-active-color); + background-color: var(--bs-pagination-active-bg); + border-color:var(--bs-pagination-active-border-color) +} + +.page-link.disabled, .disabled > .page-link { + color: var(--bs-pagination-disabled-color); + pointer-events: none; + background-color: var(--bs-pagination-disabled-bg); + border-color:var(--bs-pagination-disabled-border-color) +} + +.page-item:not(:first-child) .page-link { + margin-left:-1px +} + +.page-item:first-child .page-link { + border-top-left-radius: var(--bs-pagination-border-radius); + border-bottom-left-radius:var(--bs-pagination-border-radius) +} + +.page-item:last-child .page-link { + border-top-right-radius: var(--bs-pagination-border-radius); + border-bottom-right-radius:var(--bs-pagination-border-radius) +} + +.pagination-lg { + --bs-pagination-padding-x: 1.5rem; + --bs-pagination-padding-y: 0.75rem; + --bs-pagination-font-size: 1.25rem; + --bs-pagination-border-radius: 0.5rem +} + +.pagination-sm { + --bs-pagination-padding-x: 0.5rem; + --bs-pagination-padding-y: 0.25rem; + --bs-pagination-font-size: 0.875rem; + --bs-pagination-border-radius: 0.25rem +} + +.badge { + --bs-badge-padding-x: 0.65em; + --bs-badge-padding-y: 0.35em; + --bs-badge-font-size: 0.75em; + --bs-badge-font-weight: 700; + --bs-badge-color: #fff; + --bs-badge-border-radius: 0.375rem; + display: inline-block; + padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x); + font-size: var(--bs-badge-font-size); + font-weight: var(--bs-badge-font-weight); + line-height: 1; + color: var(--bs-badge-color); + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius:var(--bs-badge-border-radius) +} + +.badge:empty { + display:none +} + +.btn .badge { + position: relative; + top:-1px +} + +.alert { + --bs-alert-bg: transparent; + --bs-alert-padding-x: 1rem; + --bs-alert-padding-y: 1rem; + --bs-alert-margin-bottom: 1rem; + --bs-alert-color: inherit; + --bs-alert-border-color: transparent; + --bs-alert-border: 1px solid var(--bs-alert-border-color); + --bs-alert-border-radius: 0.375rem; + position: relative; + padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x); + margin-bottom: var(--bs-alert-margin-bottom); + color: var(--bs-alert-color); + background-color: var(--bs-alert-bg); + border: var(--bs-alert-border); + border-radius:var(--bs-alert-border-radius) +} + +.alert-heading { + color:inherit +} + +.alert-link { + font-weight:700 +} + +.alert-dismissible { + padding-right:3rem +} + +.alert-dismissible .btn-close { + position: absolute; + top: 0; + right: 0; + z-index: 2; + padding:1.25rem 1rem +} + +.alert-primary { + --bs-alert-color: #193333; + --bs-alert-bg: #d4dddd; + --bs-alert-border-color: #bfcccc +} + +.alert-primary .alert-link { + color:#142929 +} + +.alert-secondary { + --bs-alert-color: #41464b; + --bs-alert-bg: #e2e3e5; + --bs-alert-border-color: #d3d6d8 +} + +.alert-secondary .alert-link { + color:#34383c +} + +.alert-success { + --bs-alert-color: #0f5132; + --bs-alert-bg: #d1e7dd; + --bs-alert-border-color: #badbcc +} + +.alert-success .alert-link { + color:#0c4128 +} + +.alert-info { + --bs-alert-color: #055160; + --bs-alert-bg: #cff4fc; + --bs-alert-border-color: #b6effb +} + +.alert-info .alert-link { + color:#04414d +} + +.alert-warning { + --bs-alert-color: #664d03; + --bs-alert-bg: #fff3cd; + --bs-alert-border-color: #ffecb5 +} + +.alert-warning .alert-link { + color:#523e02 +} + +.alert-danger { + --bs-alert-color: #842029; + --bs-alert-bg: #f8d7da; + --bs-alert-border-color: #f5c2c7 +} + +.alert-danger .alert-link { + color:#6a1a21 +} + +.alert-light { + --bs-alert-color: #636464; + --bs-alert-bg: #fefefe; + --bs-alert-border-color: #fdfdfe +} + +.alert-light .alert-link { + color:#4f5050 +} + +.alert-dark { + --bs-alert-color: black; + --bs-alert-bg: #cccccc; + --bs-alert-border-color: #b3b3b3 +} + +.alert-dark .alert-link { + color:#000 +} + +@keyframes progress-bar-stripes { + 0% { + background-position-x:1rem + } +} + +.progress { + --bs-progress-height: 1rem; + --bs-progress-font-size: 0.75rem; + --bs-progress-bg: #e9ecef; + --bs-progress-border-radius: 0.375rem; + --bs-progress-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075); + --bs-progress-bar-color: #fff; + --bs-progress-bar-bg: #2a5555; + --bs-progress-bar-transition: width 0.6s ease; + display: flex; + height: var(--bs-progress-height); + overflow: hidden; + font-size: var(--bs-progress-font-size); + background-color: var(--bs-progress-bg); + border-radius:var(--bs-progress-border-radius) +} + +.progress-bar { + display: flex; + flex-direction: column; + justify-content: center; + overflow: hidden; + color: var(--bs-progress-bar-color); + text-align: center; + white-space: nowrap; + background-color: var(--bs-progress-bar-bg); + transition:var(--bs-progress-bar-transition) +} + +@media (prefers-reduced-motion: reduce) { + .progress-bar { + transition:none + } +} + +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size:var(--bs-progress-height) var(--bs-progress-height) +} + +.progress-bar-animated { + animation:1s linear infinite progress-bar-stripes +} + +@media (prefers-reduced-motion: reduce) { + .progress-bar-animated { + animation:none + } +} + +.list-group { + --bs-list-group-color: #000000; + --bs-list-group-bg: #fff; + --bs-list-group-border-color: rgba(0, 0, 0, 0.125); + --bs-list-group-border-width: 1px; + --bs-list-group-border-radius: 0.375rem; + --bs-list-group-item-padding-x: 1rem; + --bs-list-group-item-padding-y: 0.5rem; + --bs-list-group-action-color: #495057; + --bs-list-group-action-hover-color: #495057; + --bs-list-group-action-hover-bg: #f8f9fa; + --bs-list-group-action-active-color: #000000; + --bs-list-group-action-active-bg: #e9ecef; + --bs-list-group-disabled-color: #6c757d; + --bs-list-group-disabled-bg: #fff; + --bs-list-group-active-color: #fff; + --bs-list-group-active-bg: #2a5555; + --bs-list-group-active-border-color: #2a5555; + display: flex; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + border-radius:var(--bs-list-group-border-radius) +} + +.list-group-numbered { + list-style-type: none; + counter-reset:section +} + +.list-group-numbered > .list-group-item::before { + content: counters(section, ".") ". "; + counter-increment:section +} + +.list-group-item-action { + width: 100%; + color: var(--bs-list-group-action-color); + text-align:inherit +} + +.list-group-item-action:hover, .list-group-item-action:focus { + z-index: 1; + color: var(--bs-list-group-action-hover-color); + text-decoration: none; + background-color:var(--bs-list-group-action-hover-bg) +} + +.list-group-item-action:active { + color: var(--bs-list-group-action-active-color); + background-color:var(--bs-list-group-action-active-bg) +} + +.list-group-item { + position: relative; + display: block; + padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x); + color: var(--bs-list-group-color); + text-decoration: none; + background-color: var(--bs-list-group-bg); + border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color) +} + +.list-group-item:first-child { + border-top-left-radius: inherit; + border-top-right-radius:inherit +} + +.list-group-item:last-child { + border-bottom-right-radius: inherit; + border-bottom-left-radius:inherit +} + +.list-group-item.disabled, .list-group-item:disabled { + color: var(--bs-list-group-disabled-color); + pointer-events: none; + background-color:var(--bs-list-group-disabled-bg) +} + +.list-group-item.active { + z-index: 2; + color: var(--bs-list-group-active-color); + background-color: var(--bs-list-group-active-bg); + border-color:var(--bs-list-group-active-border-color) +} + +.list-group-item + .list-group-item { + border-top-width:0 +} + +.list-group-item + .list-group-item.active { + margin-top: calc(-1 * var(--bs-list-group-border-width)); + border-top-width:var(--bs-list-group-border-width) +} + +.list-group-horizontal { + flex-direction:row +} + +.list-group-horizontal > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 +} + +.list-group-horizontal > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 +} + +.list-group-horizontal > .list-group-item.active { + margin-top:0 +} + +.list-group-horizontal > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 +} + +.list-group-horizontal > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) +} + +@media (min-width: 576px) { + .list-group-horizontal-sm { + flex-direction:row + } + + .list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 + } + + .list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 + } + + .list-group-horizontal-sm > .list-group-item.active { + margin-top:0 + } + + .list-group-horizontal-sm > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 + } + + .list-group-horizontal-sm > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) + } +} + +@media (min-width: 768px) { + .list-group-horizontal-md { + flex-direction:row + } + + .list-group-horizontal-md > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 + } + + .list-group-horizontal-md > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 + } + + .list-group-horizontal-md > .list-group-item.active { + margin-top:0 + } + + .list-group-horizontal-md > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 + } + + .list-group-horizontal-md > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) + } +} + +@media (min-width: 992px) { + .list-group-horizontal-lg { + flex-direction:row + } + + .list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 + } + + .list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 + } + + .list-group-horizontal-lg > .list-group-item.active { + margin-top:0 + } + + .list-group-horizontal-lg > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 + } + + .list-group-horizontal-lg > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) + } +} + +@media (min-width: 1200px) { + .list-group-horizontal-xl { + flex-direction:row + } + + .list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 + } + + .list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 + } + + .list-group-horizontal-xl > .list-group-item.active { + margin-top:0 + } + + .list-group-horizontal-xl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 + } + + .list-group-horizontal-xl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) + } +} + +@media (min-width: 1400px) { + .list-group-horizontal-xxl { + flex-direction:row + } + + .list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) { + border-bottom-left-radius: var(--bs-list-group-border-radius); + border-top-right-radius:0 + } + + .list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) { + border-top-right-radius: var(--bs-list-group-border-radius); + border-bottom-left-radius:0 + } + + .list-group-horizontal-xxl > .list-group-item.active { + margin-top:0 + } + + .list-group-horizontal-xxl > .list-group-item + .list-group-item { + border-top-width: var(--bs-list-group-border-width); + border-left-width:0 + } + + .list-group-horizontal-xxl > .list-group-item + .list-group-item.active { + margin-left: calc(-1 * var(--bs-list-group-border-width)); + border-left-width:var(--bs-list-group-border-width) + } +} + +.list-group-flush { + border-radius:0 +} + +.list-group-flush > .list-group-item { + border-width:0 0 var(--bs-list-group-border-width) +} + +.list-group-flush > .list-group-item:last-child { + border-bottom-width:0 +} + +.list-group-item-primary { + color: #193333; + background-color:#d4dddd +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #193333; + background-color:#bfc7c7 +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #193333; + border-color:#193333 +} + +.list-group-item-secondary { + color: #41464b; + background-color:#e2e3e5 +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #41464b; + background-color:#cbccce +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #41464b; + border-color:#41464b +} + +.list-group-item-success { + color: #0f5132; + background-color:#d1e7dd +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #0f5132; + background-color:#bcd0c7 +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #0f5132; + border-color:#0f5132 +} + +.list-group-item-info { + color: #055160; + background-color:#cff4fc +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #055160; + background-color:#badce3 +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #055160; + border-color:#055160 +} + +.list-group-item-warning { + color: #664d03; + background-color:#fff3cd +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #664d03; + background-color:#e6dbb9 +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #664d03; + border-color:#664d03 +} + +.list-group-item-danger { + color: #842029; + background-color:#f8d7da +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #842029; + background-color:#dfc2c4 +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #842029; + border-color:#842029 +} + +.list-group-item-light { + color: #636464; + background-color:#fefefe +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #636464; + background-color:#e5e5e5 +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #636464; + border-color:#636464 +} + +.list-group-item-dark { + color: #000; + background-color:#ccc +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #000; + background-color:#b8b8b8 +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #000; + border-color:#000 +} + +.btn-close { + box-sizing: content-box; + width: 1em; + height: 1em; + padding: .25em .25em; + color: #000; + background: rgba(0, 0, 0, 0) url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat; + border: 0; + border-radius: .375rem; + opacity:.5 +} + +.btn-close:hover { + color: #000; + text-decoration: none; + opacity:.75 +} + +.btn-close:focus { + outline: 0; + box-shadow: 0 0 0 .25rem rgba(42, 85, 85, .25); + opacity:1 +} + +.btn-close:disabled, .btn-close.disabled { + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + user-select: none; + opacity:.25 +} + +.btn-close-white { + filter:invert(1) grayscale(100%) brightness(200%) +} + +.toast { + --bs-toast-zindex: 1090; + --bs-toast-padding-x: 0.75rem; + --bs-toast-padding-y: 0.5rem; + --bs-toast-spacing: 1.5rem; + --bs-toast-max-width: 350px; + --bs-toast-font-size: 0.875rem; + --bs-toast-color:; + --bs-toast-bg: rgba(255, 255, 255, 0.85); + --bs-toast-border-width: 1px; + --bs-toast-border-color: var(--bs-border-color-translucent); + --bs-toast-border-radius: 0.375rem; + --bs-toast-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15); + --bs-toast-header-color: #6c757d; + --bs-toast-header-bg: rgba(255, 255, 255, 0.85); + --bs-toast-header-border-color: rgba(0, 0, 0, 0.05); + width: var(--bs-toast-max-width); + max-width: 100%; + font-size: var(--bs-toast-font-size); + color: var(--bs-toast-color); + pointer-events: auto; + background-color: var(--bs-toast-bg); + background-clip: padding-box; + border: var(--bs-toast-border-width) solid var(--bs-toast-border-color); + box-shadow: var(--bs-toast-box-shadow); + border-radius:var(--bs-toast-border-radius) +} + +.toast.showing { + opacity:0 +} + +.toast:not(.show) { + display:none +} + +.toast-container { + --bs-toast-zindex: 1090; + position: absolute; + z-index: var(--bs-toast-zindex); + width: -moz-max-content; + width: max-content; + max-width: 100%; + pointer-events:none +} + +.toast-container > :not(:last-child) { + margin-bottom:var(--bs-toast-spacing) +} + +.toast-header { + display: flex; + align-items: center; + padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x); + color: var(--bs-toast-header-color); + background-color: var(--bs-toast-header-bg); + background-clip: padding-box; + border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color); + border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)); + border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width)) +} + +.toast-header .btn-close { + margin-right: calc(-0.5 * var(--bs-toast-padding-x)); + margin-left:var(--bs-toast-padding-x) +} + +.toast-body { + padding: var(--bs-toast-padding-x); + word-wrap:break-word +} + +.modal { + --bs-modal-zindex: 1055; + --bs-modal-width: 500px; + --bs-modal-padding: 1rem; + --bs-modal-margin: 0.5rem; + --bs-modal-color:; + --bs-modal-bg: #fff; + --bs-modal-border-color: var(--bs-border-color-translucent); + --bs-modal-border-width: 1px; + --bs-modal-border-radius: 0.5rem; + --bs-modal-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075); + --bs-modal-inner-border-radius: calc(0.5rem - 1px); + --bs-modal-header-padding-x: 1rem; + --bs-modal-header-padding-y: 1rem; + --bs-modal-header-padding: 1rem 1rem; + --bs-modal-header-border-color: var(--bs-border-color); + --bs-modal-header-border-width: 1px; + --bs-modal-title-line-height: 1.5; + --bs-modal-footer-gap: 0.5rem; + --bs-modal-footer-bg:; + --bs-modal-footer-border-color: var(--bs-border-color); + --bs-modal-footer-border-width: 1px; + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-modal-zindex); + display: none; + width: 100%; + height: 100%; + overflow-x: hidden; + overflow-y: auto; + outline:0 +} + +.modal-dialog { + position: relative; + width: auto; + margin: var(--bs-modal-margin); + pointer-events:none +} + +.modal.fade .modal-dialog { + transition: transform .3s ease-out; + transform:translate(0, -50px) +} + +@media (prefers-reduced-motion: reduce) { + .modal.fade .modal-dialog { + transition:none + } +} + +.modal.show .modal-dialog { + transform:none +} + +.modal.modal-static .modal-dialog { + transform:scale(1.02) +} + +.modal-dialog-scrollable { + height:calc(100% - var(--bs-modal-margin) * 2) +} + +.modal-dialog-scrollable .modal-content { + max-height: 100%; + overflow:hidden +} + +.modal-dialog-scrollable .modal-body { + overflow-y:auto +} + +.modal-dialog-centered { + display: flex; + align-items: center; + min-height:calc(100% - var(--bs-modal-margin) * 2) +} + +.modal-content { + position: relative; + display: flex; + flex-direction: column; + width: 100%; + color: var(--bs-modal-color); + pointer-events: auto; + background-color: var(--bs-modal-bg); + background-clip: padding-box; + border: var(--bs-modal-border-width) solid var(--bs-modal-border-color); + border-radius: var(--bs-modal-border-radius); + outline:0 +} + +.modal-backdrop { + --bs-backdrop-zindex: 1050; + --bs-backdrop-bg: #000; + --bs-backdrop-opacity: 0.5; + position: fixed; + top: 0; + left: 0; + z-index: var(--bs-backdrop-zindex); + width: 100vw; + height: 100vh; + background-color:var(--bs-backdrop-bg) +} + +.modal-backdrop.fade { + opacity:0 +} + +.modal-backdrop.show { + opacity:var(--bs-backdrop-opacity) +} + +.modal-header { + display: flex; + flex-shrink: 0; + align-items: center; + justify-content: space-between; + padding: var(--bs-modal-header-padding); + border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color); + border-top-left-radius: var(--bs-modal-inner-border-radius); + border-top-right-radius:var(--bs-modal-inner-border-radius) +} + +.modal-header .btn-close { + padding: calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5); + margin:calc(-0.5 * var(--bs-modal-header-padding-y)) calc(-0.5 * var(--bs-modal-header-padding-x)) calc(-0.5 * var(--bs-modal-header-padding-y)) auto +} + +.modal-title { + margin-bottom: 0; + line-height:var(--bs-modal-title-line-height) +} + +.modal-body { + position: relative; + flex: 1 1 auto; + padding:var(--bs-modal-padding) +} + +.modal-footer { + display: flex; + flex-shrink: 0; + flex-wrap: wrap; + align-items: center; + justify-content: flex-end; + padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5); + background-color: var(--bs-modal-footer-bg); + border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color); + border-bottom-right-radius: var(--bs-modal-inner-border-radius); + border-bottom-left-radius:var(--bs-modal-inner-border-radius) +} + +.modal-footer > * { + margin:calc(var(--bs-modal-footer-gap) * .5) +} + +@media (min-width: 576px) { + .modal { + --bs-modal-margin: 1.75rem; + --bs-modal-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) + } + + .modal-dialog { + max-width: var(--bs-modal-width); + margin-right: auto; + margin-left:auto + } + + .modal-sm { + --bs-modal-width: 300px + } +} + +@media (min-width: 992px) { + .modal-lg, .modal-xl { + --bs-modal-width: 800px + } +} + +@media (min-width: 1200px) { + .modal-xl { + --bs-modal-width: 1140px + } +} + +.modal-fullscreen { + width: 100vw; + max-width: none; + height: 100%; + margin:0 +} + +.modal-fullscreen .modal-content { + height: 100%; + border: 0; + border-radius:0 +} + +.modal-fullscreen .modal-header, .modal-fullscreen .modal-footer { + border-radius:0 +} + +.modal-fullscreen .modal-body { + overflow-y:auto +} + +@media (max-width: 575.98px) { + .modal-fullscreen-sm-down { + width: 100vw; + max-width: none; + height: 100%; + margin:0 + } + + .modal-fullscreen-sm-down .modal-content { + height: 100%; + border: 0; + border-radius:0 + } + + .modal-fullscreen-sm-down .modal-header, .modal-fullscreen-sm-down .modal-footer { + border-radius:0 + } + + .modal-fullscreen-sm-down .modal-body { + overflow-y:auto + } +} + +@media (max-width: 767.98px) { + .modal-fullscreen-md-down { + width: 100vw; + max-width: none; + height: 100%; + margin:0 + } + + .modal-fullscreen-md-down .modal-content { + height: 100%; + border: 0; + border-radius:0 + } + + .modal-fullscreen-md-down .modal-header, .modal-fullscreen-md-down .modal-footer { + border-radius:0 + } + + .modal-fullscreen-md-down .modal-body { + overflow-y:auto + } +} + +@media (max-width: 991.98px) { + .modal-fullscreen-lg-down { + width: 100vw; + max-width: none; + height: 100%; + margin:0 + } + + .modal-fullscreen-lg-down .modal-content { + height: 100%; + border: 0; + border-radius:0 + } + + .modal-fullscreen-lg-down .modal-header, .modal-fullscreen-lg-down .modal-footer { + border-radius:0 + } + + .modal-fullscreen-lg-down .modal-body { + overflow-y:auto + } +} + +@media (max-width: 1199.98px) { + .modal-fullscreen-xl-down { + width: 100vw; + max-width: none; + height: 100%; + margin:0 + } + + .modal-fullscreen-xl-down .modal-content { + height: 100%; + border: 0; + border-radius:0 + } + + .modal-fullscreen-xl-down .modal-header, .modal-fullscreen-xl-down .modal-footer { + border-radius:0 + } + + .modal-fullscreen-xl-down .modal-body { + overflow-y:auto + } +} + +@media (max-width: 1399.98px) { + .modal-fullscreen-xxl-down { + width: 100vw; + max-width: none; + height: 100%; + margin:0 + } + + .modal-fullscreen-xxl-down .modal-content { + height: 100%; + border: 0; + border-radius:0 + } + + .modal-fullscreen-xxl-down .modal-header, .modal-fullscreen-xxl-down .modal-footer { + border-radius:0 + } + + .modal-fullscreen-xxl-down .modal-body { + overflow-y:auto + } +} + +.tooltip { + --bs-tooltip-zindex: 1080; + --bs-tooltip-max-width: 200px; + --bs-tooltip-padding-x: 0.5rem; + --bs-tooltip-padding-y: 0.25rem; + --bs-tooltip-margin:; + --bs-tooltip-font-size: 0.875rem; + --bs-tooltip-color: #fff; + --bs-tooltip-bg: #000; + --bs-tooltip-border-radius: 0.375rem; + --bs-tooltip-opacity: 0.9; + --bs-tooltip-arrow-width: 0.8rem; + --bs-tooltip-arrow-height: 0.4rem; + z-index: var(--bs-tooltip-zindex); + display: block; + padding: var(--bs-tooltip-arrow-height); + margin: var(--bs-tooltip-margin); + font-family: "Open Sauce Sans", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-tooltip-font-size); + word-wrap: break-word; + opacity:0 +} + +.tooltip.show { + opacity:var(--bs-tooltip-opacity) +} + +.tooltip .tooltip-arrow { + display: block; + width: var(--bs-tooltip-arrow-width); + height:var(--bs-tooltip-arrow-height) +} + +.tooltip .tooltip-arrow::before { + position: absolute; + content: ""; + border-color: rgba(0, 0, 0, 0); + border-style:solid +} + +.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow { + bottom:0 +} + +.bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before { + top: -1px; + border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-top-color:var(--bs-tooltip-bg) +} + +.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow { + left: 0; + width: var(--bs-tooltip-arrow-height); + height:var(--bs-tooltip-arrow-width) +} + +.bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before { + right: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0; + border-right-color:var(--bs-tooltip-bg) +} + +.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow { + top:0 +} + +.bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before { + bottom: -1px; + border-width: 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-bottom-color:var(--bs-tooltip-bg) +} + +.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow { + right: 0; + width: var(--bs-tooltip-arrow-height); + height:var(--bs-tooltip-arrow-width) +} + +.bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before { + left: -1px; + border-width: calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height); + border-left-color:var(--bs-tooltip-bg) +} + +.tooltip-inner { + max-width: var(--bs-tooltip-max-width); + padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x); + color: var(--bs-tooltip-color); + text-align: center; + background-color: var(--bs-tooltip-bg); + border-radius:var(--bs-tooltip-border-radius) +} + +.popover { + --bs-popover-zindex: 1070; + --bs-popover-max-width: 276px; + --bs-popover-font-size: 0.875rem; + --bs-popover-bg: #fff; + --bs-popover-border-width: 1px; + --bs-popover-border-color: var(--bs-border-color-translucent); + --bs-popover-border-radius: 0.5rem; + --bs-popover-inner-border-radius: calc(0.5rem - 1px); + --bs-popover-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15); + --bs-popover-header-padding-x: 1rem; + --bs-popover-header-padding-y: 0.5rem; + --bs-popover-header-font-size: 1rem; + --bs-popover-header-color:; + --bs-popover-header-bg: #f0f0f0; + --bs-popover-body-padding-x: 1rem; + --bs-popover-body-padding-y: 1rem; + --bs-popover-body-color: #000000; + --bs-popover-arrow-width: 1rem; + --bs-popover-arrow-height: 0.5rem; + --bs-popover-arrow-border: var(--bs-popover-border-color); + z-index: var(--bs-popover-zindex); + display: block; + max-width: var(--bs-popover-max-width); + font-family: "Open Sauce Sans", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + white-space: normal; + word-spacing: normal; + line-break: auto; + font-size: var(--bs-popover-font-size); + word-wrap: break-word; + background-color: var(--bs-popover-bg); + background-clip: padding-box; + border: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-radius:var(--bs-popover-border-radius) +} + +.popover .popover-arrow { + display: block; + width: var(--bs-popover-arrow-width); + height:var(--bs-popover-arrow-height) +} + +.popover .popover-arrow::before, .popover .popover-arrow::after { + position: absolute; + display: block; + content: ""; + border-color: rgba(0, 0, 0, 0); + border-style: solid; + border-width:0 +} + +.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow { + bottom:calc(-1 *(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)) +} + +.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after { + border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0 +} + +.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before { + bottom: 0; + border-top-color:var(--bs-popover-arrow-border) +} + +.bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after { + bottom: var(--bs-popover-border-width); + border-top-color:var(--bs-popover-bg) +} + +.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow { + left: calc(-1 *(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height:var(--bs-popover-arrow-width) +} + +.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after { + border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0 +} + +.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before { + left: 0; + border-right-color:var(--bs-popover-arrow-border) +} + +.bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after { + left: var(--bs-popover-border-width); + border-right-color:var(--bs-popover-bg) +} + +.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow { + top:calc(-1 *(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)) +} + +.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after { + border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) +} + +.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before { + top: 0; + border-bottom-color:var(--bs-popover-arrow-border) +} + +.bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after { + top: var(--bs-popover-border-width); + border-bottom-color:var(--bs-popover-bg) +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^=bottom] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: var(--bs-popover-arrow-width); + margin-left: calc(-0.5 * var(--bs-popover-arrow-width)); + content: ""; + border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg) +} + +.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow { + right: calc(-1 *(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width)); + width: var(--bs-popover-arrow-height); + height:var(--bs-popover-arrow-width) +} + +.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after { + border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) +} + +.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before { + right: 0; + border-left-color:var(--bs-popover-arrow-border) +} + +.bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after { + right: var(--bs-popover-border-width); + border-left-color:var(--bs-popover-bg) +} + +.popover-header { + padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x); + margin-bottom: 0; + font-size: var(--bs-popover-header-font-size); + color: var(--bs-popover-header-color); + background-color: var(--bs-popover-header-bg); + border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color); + border-top-left-radius: var(--bs-popover-inner-border-radius); + border-top-right-radius:var(--bs-popover-inner-border-radius) +} + +.popover-header:empty { + display:none +} + +.popover-body { + padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x); + color:var(--bs-popover-body-color) +} + +.carousel { + position:relative +} + +.carousel.pointer-event { + touch-action:pan-y +} + +.carousel-inner { + position: relative; + width: 100%; + overflow:hidden +} + +.carousel-inner::after { + display: block; + clear: both; + content: "" +} + +.carousel-item { + position: relative; + display: none; + float: left; + width: 100%; + margin-right: -100%; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + transition:transform .6s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .carousel-item { + transition:none + } +} + +.carousel-item.active, .carousel-item-next, .carousel-item-prev { + display:block +} + +.carousel-item-next:not(.carousel-item-start), .active.carousel-item-end { + transform:translateX(100%) +} + +.carousel-item-prev:not(.carousel-item-end), .active.carousel-item-start { + transform:translateX(-100%) +} + +.carousel-fade .carousel-item { + opacity: 0; + transition-property: opacity; + transform:none +} + +.carousel-fade .carousel-item.active, .carousel-fade .carousel-item-next.carousel-item-start, .carousel-fade .carousel-item-prev.carousel-item-end { + z-index: 1; + opacity:1 +} + +.carousel-fade .active.carousel-item-start, .carousel-fade .active.carousel-item-end { + z-index: 0; + opacity: 0; + transition:opacity 0s .6s +} + +@media (prefers-reduced-motion: reduce) { + .carousel-fade .active.carousel-item-start, .carousel-fade .active.carousel-item-end { + transition:none + } +} + +.carousel-control-prev, .carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + z-index: 1; + display: flex; + align-items: center; + justify-content: center; + width: 15%; + padding: 0; + color: #fff; + text-align: center; + background: none; + border: 0; + opacity: .5; + transition:opacity .15s ease +} + +@media (prefers-reduced-motion: reduce) { + .carousel-control-prev, .carousel-control-next { + transition:none + } +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, .carousel-control-next:hover, .carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity:.9 +} + +.carousel-control-prev { + left:0 +} + +.carousel-control-next { + right:0 +} + +.carousel-control-prev-icon, .carousel-control-next-icon { + display: inline-block; + width: 2rem; + height: 2rem; + background-repeat: no-repeat; + background-position: 50%; + background-size:100% 100% +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e") +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e") +} + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 0; + left: 0; + z-index: 2; + display: flex; + justify-content: center; + padding: 0; + margin-right: 15%; + margin-bottom: 1rem; + margin-left: 15%; + list-style:none +} + +.carousel-indicators [data-bs-target] { + box-sizing: content-box; + flex: 0 1 auto; + width: 30px; + height: 3px; + padding: 0; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + cursor: pointer; + background-color: #fff; + background-clip: padding-box; + border: 0; + border-top: 10px solid rgba(0, 0, 0, 0); + border-bottom: 10px solid rgba(0, 0, 0, 0); + opacity: .5; + transition:opacity .6s ease +} + +@media (prefers-reduced-motion: reduce) { + .carousel-indicators [data-bs-target] { + transition:none + } +} + +.carousel-indicators .active { + opacity:1 +} + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 1.25rem; + left: 15%; + padding-top: 1.25rem; + padding-bottom: 1.25rem; + color: #fff; + text-align:center +} + +.carousel-dark .carousel-control-prev-icon, .carousel-dark .carousel-control-next-icon { + filter:invert(1) grayscale(100) +} + +.carousel-dark .carousel-indicators [data-bs-target] { + background-color:#000 +} + +.carousel-dark .carousel-caption { + color:#000 +} + +.spinner-grow, .spinner-border { + display: inline-block; + width: var(--bs-spinner-width); + height: var(--bs-spinner-height); + vertical-align: var(--bs-spinner-vertical-align); + border-radius: 50%; + animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name) +} + +@keyframes spinner-border { + to { + transform:rotate(360deg) + } +} + +.spinner-border { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-border-width: 0.25em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-border; + border: var(--bs-spinner-border-width) solid currentcolor; + border-right-color:rgba(0, 0, 0, 0) +} + +.spinner-border-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem; + --bs-spinner-border-width: 0.2em +} + +@keyframes spinner-grow { + 0% { + transform:scale(0) + } + + 50% { + opacity: 1; + transform:none + } +} + +.spinner-grow { + --bs-spinner-width: 2rem; + --bs-spinner-height: 2rem; + --bs-spinner-vertical-align: -0.125em; + --bs-spinner-animation-speed: 0.75s; + --bs-spinner-animation-name: spinner-grow; + background-color: currentcolor; + opacity:0 +} + +.spinner-grow-sm { + --bs-spinner-width: 1rem; + --bs-spinner-height: 1rem +} + +@media (prefers-reduced-motion: reduce) { + .spinner-border, .spinner-grow { + --bs-spinner-animation-speed: 1.5s + } +} + +.offcanvas, .offcanvas-xxl, .offcanvas-xl, .offcanvas-lg, .offcanvas-md, .offcanvas-sm { + --bs-offcanvas-zindex: 1045; + --bs-offcanvas-width: 400px; + --bs-offcanvas-height: 30vh; + --bs-offcanvas-padding-x: 1rem; + --bs-offcanvas-padding-y: 1rem; + --bs-offcanvas-color:; + --bs-offcanvas-bg: #fff; + --bs-offcanvas-border-width: 1px; + --bs-offcanvas-border-color: var(--bs-border-color-translucent); + --bs-offcanvas-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) +} + +@media (max-width: 575.98px) { + .offcanvas-sm { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out + } +} + +@media (max-width: 575.98px) and(prefers-reduced-motion: reduce) { + .offcanvas-sm { + transition:none + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) { + transform:none + } +} + +@media (max-width: 575.98px) { + .offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show { + visibility:visible + } +} + +@media (min-width: 576px) { + .offcanvas-sm { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color:rgba(0, 0, 0, 0) !important + } + + .offcanvas-sm .offcanvas-header { + display:none + } + + .offcanvas-sm .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color:rgba(0, 0, 0, 0) !important + } +} + +@media (max-width: 767.98px) { + .offcanvas-md { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out + } +} + +@media (max-width: 767.98px) and(prefers-reduced-motion: reduce) { + .offcanvas-md { + transition:none + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.showing, .offcanvas-md.show:not(.hiding) { + transform:none + } +} + +@media (max-width: 767.98px) { + .offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show { + visibility:visible + } +} + +@media (min-width: 768px) { + .offcanvas-md { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color:rgba(0, 0, 0, 0) !important + } + + .offcanvas-md .offcanvas-header { + display:none + } + + .offcanvas-md .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color:rgba(0, 0, 0, 0) !important + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out + } +} + +@media (max-width: 991.98px) and(prefers-reduced-motion: reduce) { + .offcanvas-lg { + transition:none + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) { + transform:none + } +} + +@media (max-width: 991.98px) { + .offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show { + visibility:visible + } +} + +@media (min-width: 992px) { + .offcanvas-lg { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color:rgba(0, 0, 0, 0) !important + } + + .offcanvas-lg .offcanvas-header { + display:none + } + + .offcanvas-lg .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color:rgba(0, 0, 0, 0) !important + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out + } +} + +@media (max-width: 1199.98px) and(prefers-reduced-motion: reduce) { + .offcanvas-xl { + transition:none + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) { + transform:none + } +} + +@media (max-width: 1199.98px) { + .offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show { + visibility:visible + } +} + +@media (min-width: 1200px) { + .offcanvas-xl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color:rgba(0, 0, 0, 0) !important + } + + .offcanvas-xl .offcanvas-header { + display:none + } + + .offcanvas-xl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color:rgba(0, 0, 0, 0) !important + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out + } +} + +@media (max-width: 1399.98px) and(prefers-reduced-motion: reduce) { + .offcanvas-xxl { + transition:none + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) { + transform:none + } +} + +@media (max-width: 1399.98px) { + .offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show { + visibility:visible + } +} + +@media (min-width: 1400px) { + .offcanvas-xxl { + --bs-offcanvas-height: auto; + --bs-offcanvas-border-width: 0; + background-color:rgba(0, 0, 0, 0) !important + } + + .offcanvas-xxl .offcanvas-header { + display:none + } + + .offcanvas-xxl .offcanvas-body { + display: flex; + flex-grow: 0; + padding: 0; + overflow-y: visible; + background-color:rgba(0, 0, 0, 0) !important + } +} + +.offcanvas { + position: fixed; + bottom: 0; + z-index: var(--bs-offcanvas-zindex); + display: flex; + flex-direction: column; + max-width: 100%; + color: var(--bs-offcanvas-color); + visibility: hidden; + background-color: var(--bs-offcanvas-bg); + background-clip: padding-box; + outline: 0; + transition:transform .3s ease-in-out +} + +@media (prefers-reduced-motion: reduce) { + .offcanvas { + transition:none + } +} + +.offcanvas.offcanvas-start { + top: 0; + left: 0; + width: var(--bs-offcanvas-width); + border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(-100%) +} + +.offcanvas.offcanvas-end { + top: 0; + right: 0; + width: var(--bs-offcanvas-width); + border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateX(100%) +} + +.offcanvas.offcanvas-top { + top: 0; + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(-100%) +} + +.offcanvas.offcanvas-bottom { + right: 0; + left: 0; + height: var(--bs-offcanvas-height); + max-height: 100%; + border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color); + transform:translateY(100%) +} + +.offcanvas.showing, .offcanvas.show:not(.hiding) { + transform:none +} + +.offcanvas.showing, .offcanvas.hiding, .offcanvas.show { + visibility:visible +} + +.offcanvas-backdrop { + position: fixed; + top: 0; + left: 0; + z-index: 1040; + width: 100vw; + height: 100vh; + background-color:#000 +} + +.offcanvas-backdrop.fade { + opacity:0 +} + +.offcanvas-backdrop.show { + opacity:.5 +} + +.offcanvas-header { + display: flex; + align-items: center; + justify-content: space-between; + padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x) +} + +.offcanvas-header .btn-close { + padding: calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5); + margin-top: calc(-0.5 * var(--bs-offcanvas-padding-y)); + margin-right: calc(-0.5 * var(--bs-offcanvas-padding-x)); + margin-bottom:calc(-0.5 * var(--bs-offcanvas-padding-y)) +} + +.offcanvas-title { + margin-bottom: 0; + line-height:1.5 +} + +.offcanvas-body { + flex-grow: 1; + padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x); + overflow-y:auto +} + +.placeholder { + display: inline-block; + min-height: 1em; + vertical-align: middle; + cursor: wait; + background-color: currentcolor; + opacity:.5 +} + +.placeholder.btn::before { + display: inline-block; + content: "" +} + +.placeholder-xs { + min-height:.6em +} + +.placeholder-sm { + min-height:.8em +} + +.placeholder-lg { + min-height:1.2em +} + +.placeholder-glow .placeholder { + animation:placeholder-glow 2s ease-in-out infinite +} + +@keyframes placeholder-glow { + 50% { + opacity:.2 + } +} + +.placeholder-wave { + -webkit-mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%); + mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%); + -webkit-mask-size: 200% 100%; + mask-size: 200% 100%; + animation:placeholder-wave 2s linear infinite +} + +@keyframes placeholder-wave { + 100% { + -webkit-mask-position: -200% 0%; + mask-position:-200% 0% + } +} + +.clearfix::after { + display: block; + clear: both; + content: "" +} + +.text-bg-primary { + color: #fff !important; + background-color:RGBA(42, 85, 85, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-secondary { + color: #fff !important; + background-color:RGBA(108, 117, 125, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-success { + color: #fff !important; + background-color:RGBA(25, 135, 84, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-info { + color: #000 !important; + background-color:RGBA(13, 202, 240, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-warning { + color: #000 !important; + background-color:RGBA(255, 193, 7, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-danger { + color: #fff !important; + background-color:RGBA(220, 53, 69, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-light { + color: #000 !important; + background-color:RGBA(248, 249, 250, var(--bs-bg-opacity, 1)) !important +} + +.text-bg-dark { + color: #fff !important; + background-color:RGBA(0, 0, 0, var(--bs-bg-opacity, 1)) !important +} + +.link-primary { + color:#2a5555 !important +} + +.link-primary:hover, .link-primary:focus { + color:#244 !important +} + +.link-secondary { + color:#6c757d !important +} + +.link-secondary:hover, .link-secondary:focus { + color:#565e64 !important +} + +.link-success { + color:#198754 !important +} + +.link-success:hover, .link-success:focus { + color:#146c43 !important +} + +.link-info { + color:#0dcaf0 !important +} + +.link-info:hover, .link-info:focus { + color:#3dd5f3 !important +} + +.link-warning { + color:#ffc107 !important +} + +.link-warning:hover, .link-warning:focus { + color:#ffcd39 !important +} + +.link-danger { + color:#dc3545 !important +} + +.link-danger:hover, .link-danger:focus { + color:#b02a37 !important +} + +.link-light { + color:#f8f9fa !important +} + +.link-light:hover, .link-light:focus { + color:#f9fafb !important +} + +.link-dark { + color:#000 !important +} + +.link-dark:hover, .link-dark:focus { + color:#000 !important +} + +.ratio { + position: relative; + width:100% +} + +.ratio::before { + display: block; + padding-top: var(--bs-aspect-ratio); + content: "" +} + +.ratio > * { + position: absolute; + top: 0; + left: 0; + width: 100%; + height:100% +} + +.ratio-1x1 { + --bs-aspect-ratio: 100% +} + +.ratio-4x3 { + --bs-aspect-ratio: 75% +} + +.ratio-16x9 { + --bs-aspect-ratio: 56.25% +} + +.ratio-21x9 { + --bs-aspect-ratio: 42.8571428571% +} + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index:1030 +} + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index:1030 +} + +.sticky-top { + position: sticky; + top: 0; + z-index:1020 +} + +.sticky-bottom { + position: sticky; + bottom: 0; + z-index:1020 +} + +@media (min-width: 576px) { + .sticky-sm-top { + position: sticky; + top: 0; + z-index:1020 + } + + .sticky-sm-bottom { + position: sticky; + bottom: 0; + z-index:1020 + } +} + +@media (min-width: 768px) { + .sticky-md-top { + position: sticky; + top: 0; + z-index:1020 + } + + .sticky-md-bottom { + position: sticky; + bottom: 0; + z-index:1020 + } +} + +@media (min-width: 992px) { + .sticky-lg-top { + position: sticky; + top: 0; + z-index:1020 + } + + .sticky-lg-bottom { + position: sticky; + bottom: 0; + z-index:1020 + } +} + +@media (min-width: 1200px) { + .sticky-xl-top { + position: sticky; + top: 0; + z-index:1020 + } + + .sticky-xl-bottom { + position: sticky; + bottom: 0; + z-index:1020 + } +} + +@media (min-width: 1400px) { + .sticky-xxl-top { + position: sticky; + top: 0; + z-index:1020 + } + + .sticky-xxl-bottom { + position: sticky; + bottom: 0; + z-index:1020 + } +} + +.hstack { + display: flex; + flex-direction: row; + align-items: center; + align-self:stretch +} + +.vstack { + display: flex; + flex: 1 1 auto; + flex-direction: column; + align-self:stretch +} + +.visually-hidden, .visually-hidden-focusable:not(:focus):not(:focus-within) { + position: absolute !important; + width: 1px !important; + height: 1px !important; + padding: 0 !important; + margin: -1px !important; + overflow: hidden !important; + clip: rect(0, 0, 0, 0) !important; + white-space: nowrap !important; + border:0 !important +} + +.stretched-link::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1; + content: "" +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space:nowrap +} + +.vr { + display: inline-block; + align-self: stretch; + width: 1px; + min-height: 1em; + background-color: currentcolor; + opacity:.25 +} + +.align-baseline { + vertical-align:baseline !important +} + +.align-top { + vertical-align:top !important +} + +.align-middle { + vertical-align:middle !important +} + +.align-bottom { + vertical-align:bottom !important +} + +.align-text-bottom { + vertical-align:text-bottom !important +} + +.align-text-top { + vertical-align:text-top !important +} + +.float-start { + float:left !important +} + +.float-end { + float:right !important +} + +.float-none { + float:none !important +} + +.opacity-0 { + opacity:0 !important +} + +.opacity-25 { + opacity:.25 !important +} + +.opacity-50 { + opacity:.5 !important +} + +.opacity-75 { + opacity:.75 !important +} + +.opacity-100 { + opacity:1 !important +} + +.overflow-auto { + overflow:auto !important +} + +.overflow-hidden { + overflow:hidden !important +} + +.overflow-visible { + overflow:visible !important +} + +.overflow-scroll { + overflow:scroll !important +} + +.d-inline { + display:inline !important +} + +.d-inline-block { + display:inline-block !important +} + +.d-block { + display:block !important +} + +.d-grid { + display:grid !important +} + +.d-table { + display:table !important +} + +.d-table-row { + display:table-row !important +} + +.d-table-cell { + display:table-cell !important +} + +.d-flex { + display:flex !important +} + +.d-inline-flex { + display:inline-flex !important +} + +.d-none { + display:none !important +} + +.shadow { + box-shadow:0 .5rem 1rem rgba(0, 0, 0, .15) !important +} + +.shadow-sm { + box-shadow:0 .125rem .25rem rgba(0, 0, 0, .075) !important +} + +.shadow-lg { + box-shadow:0 1rem 3rem rgba(0, 0, 0, .175) !important +} + +.shadow-none { + box-shadow:none !important +} + +.position-static { + position:static !important +} + +.position-relative { + position:relative !important +} + +.position-absolute { + position:absolute !important +} + +.position-fixed { + position:fixed !important +} + +.position-sticky { + position:sticky !important +} + +.top-0 { + top:0 !important +} + +.top-50 { + top:50% !important +} + +.top-100 { + top:100% !important +} + +.bottom-0 { + bottom:0 !important +} + +.bottom-50 { + bottom:50% !important +} + +.bottom-100 { + bottom:100% !important +} + +.start-0 { + left:0 !important +} + +.start-50 { + left:50% !important +} + +.start-100 { + left:100% !important +} + +.end-0 { + right:0 !important +} + +.end-50 { + right:50% !important +} + +.end-100 { + right:100% !important +} + +.translate-middle { + transform:translate(-50%, -50%) !important +} + +.translate-middle-x { + transform:translateX(-50%) !important +} + +.translate-middle-y { + transform:translateY(-50%) !important +} + +.border { + border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important +} + +.border-0 { + border:0 !important +} + +.border-top { + border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important +} + +.border-top-0 { + border-top:0 !important +} + +.border-end { + border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important +} + +.border-end-0 { + border-right:0 !important +} + +.border-bottom { + border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important +} + +.border-bottom-0 { + border-bottom:0 !important +} + +.border-start { + border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important +} + +.border-start-0 { + border-left:0 !important +} + +.border-primary { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important +} + +.border-secondary { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important +} + +.border-success { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important +} + +.border-info { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important +} + +.border-warning { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important +} + +.border-danger { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important +} + +.border-light { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important +} + +.border-dark { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important +} + +.border-white { + --bs-border-opacity: 1; + border-color:rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important +} + +.border-1 { + --bs-border-width: 1px +} + +.border-2 { + --bs-border-width: 2px +} + +.border-3 { + --bs-border-width: 3px +} + +.border-4 { + --bs-border-width: 4px +} + +.border-5 { + --bs-border-width: 5px +} + +.border-opacity-10 { + --bs-border-opacity: 0.1 +} + +.border-opacity-25 { + --bs-border-opacity: 0.25 +} + +.border-opacity-50 { + --bs-border-opacity: 0.5 +} + +.border-opacity-75 { + --bs-border-opacity: 0.75 +} + +.border-opacity-100 { + --bs-border-opacity: 1 +} + +.w-25 { + width:25% !important +} + +.w-50 { + width:50% !important +} + +.w-75 { + width:75% !important +} + +.w-100 { + width:100% !important +} + +.w-auto { + width:auto !important +} + +.mw-100 { + max-width:100% !important +} + +.vw-100 { + width:100vw !important +} + +.min-vw-100 { + min-width:100vw !important +} + +.h-25 { + height:25% !important +} + +.h-50 { + height:50% !important +} + +.h-75 { + height:75% !important +} + +.h-100 { + height:100% !important +} + +.h-auto { + height:auto !important +} + +.mh-100 { + max-height:100% !important +} + +.vh-100 { + height:100vh !important +} + +.min-vh-100 { + min-height:100vh !important +} + +.flex-fill { + flex:1 1 auto !important +} + +.flex-row { + flex-direction:row !important +} + +.flex-column { + flex-direction:column !important +} + +.flex-row-reverse { + flex-direction:row-reverse !important +} + +.flex-column-reverse { + flex-direction:column-reverse !important +} + +.flex-grow-0 { + flex-grow:0 !important +} + +.flex-grow-1 { + flex-grow:1 !important +} + +.flex-shrink-0 { + flex-shrink:0 !important +} + +.flex-shrink-1 { + flex-shrink:1 !important +} + +.flex-wrap { + flex-wrap:wrap !important +} + +.flex-nowrap { + flex-wrap:nowrap !important +} + +.flex-wrap-reverse { + flex-wrap:wrap-reverse !important +} + +.justify-content-start { + justify-content:flex-start !important +} + +.justify-content-end { + justify-content:flex-end !important +} + +.justify-content-center { + justify-content:center !important +} + +.justify-content-between { + justify-content:space-between !important +} + +.justify-content-around { + justify-content:space-around !important +} + +.justify-content-evenly { + justify-content:space-evenly !important +} + +.align-items-start { + align-items:flex-start !important +} + +.align-items-end { + align-items:flex-end !important +} + +.align-items-center { + align-items:center !important +} + +.align-items-baseline { + align-items:baseline !important +} + +.align-items-stretch { + align-items:stretch !important +} + +.align-content-start { + align-content:flex-start !important +} + +.align-content-end { + align-content:flex-end !important +} + +.align-content-center { + align-content:center !important +} + +.align-content-between { + align-content:space-between !important +} + +.align-content-around { + align-content:space-around !important +} + +.align-content-stretch { + align-content:stretch !important +} + +.align-self-auto { + align-self:auto !important +} + +.align-self-start { + align-self:flex-start !important +} + +.align-self-end { + align-self:flex-end !important +} + +.align-self-center { + align-self:center !important +} + +.align-self-baseline { + align-self:baseline !important +} + +.align-self-stretch { + align-self:stretch !important +} + +.order-first { + order:-1 !important +} + +.order-0 { + order:0 !important +} + +.order-1 { + order:1 !important +} + +.order-2 { + order:2 !important +} + +.order-3 { + order:3 !important +} + +.order-4 { + order:4 !important +} + +.order-5 { + order:5 !important +} + +.order-last { + order:6 !important +} + +.m-0 { + margin:0 !important +} + +.m-1 { + margin:.25rem !important +} + +.m-2 { + margin:.5rem !important +} + +.m-3 { + margin:1rem !important +} + +.m-4 { + margin:1.5rem !important +} + +.m-5 { + margin:3rem !important +} + +.m-auto { + margin:auto !important +} + +.mx-0 { + margin-right: 0 !important; + margin-left:0 !important +} + +.mx-1 { + margin-right: .25rem !important; + margin-left:.25rem !important +} + +.mx-2 { + margin-right: .5rem !important; + margin-left:.5rem !important +} + +.mx-3 { + margin-right: 1rem !important; + margin-left:1rem !important +} + +.mx-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important +} + +.mx-5 { + margin-right: 3rem !important; + margin-left:3rem !important +} + +.mx-auto { + margin-right: auto !important; + margin-left:auto !important +} + +.my-0 { + margin-top: 0 !important; + margin-bottom:0 !important +} + +.my-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important +} + +.my-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important +} + +.my-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important +} + +.my-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important +} + +.my-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important +} + +.my-auto { + margin-top: auto !important; + margin-bottom:auto !important +} + +.mt-0 { + margin-top:0 !important +} + +.mt-1 { + margin-top:.25rem !important +} + +.mt-2 { + margin-top:.5rem !important +} + +.mt-3 { + margin-top:1rem !important +} + +.mt-4 { + margin-top:1.5rem !important +} + +.mt-5 { + margin-top:3rem !important +} + +.mt-auto { + margin-top:auto !important +} + +.me-0 { + margin-right:0 !important +} + +.me-1 { + margin-right:.25rem !important +} + +.me-2 { + margin-right:.5rem !important +} + +.me-3 { + margin-right:1rem !important +} + +.me-4 { + margin-right:1.5rem !important +} + +.me-5 { + margin-right:3rem !important +} + +.me-auto { + margin-right:auto !important +} + +.mb-0 { + margin-bottom:0 !important +} + +.mb-1 { + margin-bottom:.25rem !important +} + +.mb-2 { + margin-bottom:.5rem !important +} + +.mb-3 { + margin-bottom:1rem !important +} + +.mb-4 { + margin-bottom:1.5rem !important +} + +.mb-5 { + margin-bottom:3rem !important +} + +.mb-auto { + margin-bottom:auto !important +} + +.ms-0 { + margin-left:0 !important +} + +.ms-1 { + margin-left:.25rem !important +} + +.ms-2 { + margin-left:.5rem !important +} + +.ms-3 { + margin-left:1rem !important +} + +.ms-4 { + margin-left:1.5rem !important +} + +.ms-5 { + margin-left:3rem !important +} + +.ms-auto { + margin-left:auto !important +} + +.p-0 { + padding:0 !important +} + +.p-1 { + padding:.25rem !important +} + +.p-2 { + padding:.5rem !important +} + +.p-3 { + padding:1rem !important +} + +.p-4 { + padding:1.5rem !important +} + +.p-5 { + padding:3rem !important +} + +.px-0 { + padding-right: 0 !important; + padding-left:0 !important +} + +.px-1 { + padding-right: .25rem !important; + padding-left:.25rem !important +} + +.px-2 { + padding-right: .5rem !important; + padding-left:.5rem !important +} + +.px-3 { + padding-right: 1rem !important; + padding-left:1rem !important +} + +.px-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important +} + +.px-5 { + padding-right: 3rem !important; + padding-left:3rem !important +} + +.py-0 { + padding-top: 0 !important; + padding-bottom:0 !important +} + +.py-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important +} + +.py-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important +} + +.py-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important +} + +.py-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important +} + +.py-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important +} + +.pt-0 { + padding-top:0 !important +} + +.pt-1 { + padding-top:.25rem !important +} + +.pt-2 { + padding-top:.5rem !important +} + +.pt-3 { + padding-top:1rem !important +} + +.pt-4 { + padding-top:1.5rem !important +} + +.pt-5 { + padding-top:3rem !important +} + +.pe-0 { + padding-right:0 !important +} + +.pe-1 { + padding-right:.25rem !important +} + +.pe-2 { + padding-right:.5rem !important +} + +.pe-3 { + padding-right:1rem !important +} + +.pe-4 { + padding-right:1.5rem !important +} + +.pe-5 { + padding-right:3rem !important +} + +.pb-0 { + padding-bottom:0 !important +} + +.pb-1 { + padding-bottom:.25rem !important +} + +.pb-2 { + padding-bottom:.5rem !important +} + +.pb-3 { + padding-bottom:1rem !important +} + +.pb-4 { + padding-bottom:1.5rem !important +} + +.pb-5 { + padding-bottom:3rem !important +} + +.ps-0 { + padding-left:0 !important +} + +.ps-1 { + padding-left:.25rem !important +} + +.ps-2 { + padding-left:.5rem !important +} + +.ps-3 { + padding-left:1rem !important +} + +.ps-4 { + padding-left:1.5rem !important +} + +.ps-5 { + padding-left:3rem !important +} + +.gap-0 { + gap:0 !important +} + +.gap-1 { + gap:.25rem !important +} + +.gap-2 { + gap:.5rem !important +} + +.gap-3 { + gap:1rem !important +} + +.gap-4 { + gap:1.5rem !important +} + +.gap-5 { + gap:3rem !important +} + +.font-monospace { + font-family:var(--bs-font-monospace) !important +} + +.fs-1 { + font-size:calc(1.375rem + 1.5vw) !important +} + +.fs-2 { + font-size:calc(1.325rem + .9vw) !important +} + +.fs-3 { + font-size:calc(1.3rem + .6vw) !important +} + +.fs-4 { + font-size:calc(1.275rem + .3vw) !important +} + +.fs-5 { + font-size:1.25rem !important +} + +.fs-6 { + font-size:1rem !important +} + +.fst-italic { + font-style:italic !important +} + +.fst-normal { + font-style:normal !important +} + +.fw-light { + font-weight:300 !important +} + +.fw-lighter { + font-weight:lighter !important +} + +.fw-normal { + font-weight:400 !important +} + +.fw-bold { + font-weight:700 !important +} + +.fw-semibold { + font-weight:600 !important +} + +.fw-bolder { + font-weight:bolder !important +} + +.lh-1 { + line-height:1 !important +} + +.lh-sm { + line-height:1.25 !important +} + +.lh-base { + line-height:1.5 !important +} + +.lh-lg { + line-height:2 !important +} + +.text-start { + text-align:left !important +} + +.text-end { + text-align:right !important +} + +.text-center { + text-align:center !important +} + +.text-decoration-none { + text-decoration:none !important +} + +.text-decoration-underline { + text-decoration:underline !important +} + +.text-decoration-line-through { + text-decoration:line-through !important +} + +.text-lowercase { + text-transform:lowercase !important +} + +.text-uppercase { + text-transform:uppercase !important +} + +.text-capitalize { + text-transform:capitalize !important +} + +.text-wrap { + white-space:normal !important +} + +.text-nowrap { + white-space:nowrap !important +} + +.text-break { + word-wrap: break-word !important; + word-break:break-word !important +} + +.text-primary { + --bs-text-opacity: 1; + color:rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important +} + +.text-secondary { + --bs-text-opacity: 1; + color:rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important +} + +.text-success { + --bs-text-opacity: 1; + color:rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important +} + +.text-info { + --bs-text-opacity: 1; + color:rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important +} + +.text-warning { + --bs-text-opacity: 1; + color:rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important +} + +.text-danger { + --bs-text-opacity: 1; + color:rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important +} + +.text-light { + --bs-text-opacity: 1; + color:rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important +} + +.text-dark { + --bs-text-opacity: 1; + color:rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important +} + +.text-black { + --bs-text-opacity: 1; + color:rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important +} + +.text-white { + --bs-text-opacity: 1; + color:rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important +} + +.text-body { + --bs-text-opacity: 1; + color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important +} + +.text-muted { + --bs-text-opacity: 1; + color:#6c757d !important +} + +.text-black-50 { + --bs-text-opacity: 1; + color:rgba(0, 0, 0, .5) !important +} + +.text-white-50 { + --bs-text-opacity: 1; + color:rgba(255, 255, 255, .5) !important +} + +.text-reset { + --bs-text-opacity: 1; + color:inherit !important +} + +.text-opacity-25 { + --bs-text-opacity: 0.25 +} + +.text-opacity-50 { + --bs-text-opacity: 0.5 +} + +.text-opacity-75 { + --bs-text-opacity: 0.75 +} + +.text-opacity-100 { + --bs-text-opacity: 1 +} + +.bg-primary { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important +} + +.bg-secondary { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important +} + +.bg-success { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important +} + +.bg-info { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important +} + +.bg-warning { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important +} + +.bg-danger { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important +} + +.bg-light { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important +} + +.bg-dark { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important +} + +.bg-black { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important +} + +.bg-white { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important +} + +.bg-body { + --bs-bg-opacity: 1; + background-color:rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important +} + +.bg-transparent { + --bs-bg-opacity: 1; + background-color:rgba(0, 0, 0, 0) !important +} + +.bg-opacity-10 { + --bs-bg-opacity: 0.1 +} + +.bg-opacity-25 { + --bs-bg-opacity: 0.25 +} + +.bg-opacity-50 { + --bs-bg-opacity: 0.5 +} + +.bg-opacity-75 { + --bs-bg-opacity: 0.75 +} + +.bg-opacity-100 { + --bs-bg-opacity: 1 +} + +.bg-gradient { + background-image:var(--bs-gradient) !important +} + +.user-select-all { + -webkit-user-select: all !important; + -moz-user-select: all !important; + user-select:all !important +} + +.user-select-auto { + -webkit-user-select: auto !important; + -moz-user-select: auto !important; + user-select:auto !important +} + +.user-select-none { + -webkit-user-select: none !important; + -moz-user-select: none !important; + user-select:none !important +} + +.pe-none { + pointer-events:none !important +} + +.pe-auto { + pointer-events:auto !important +} + +.rounded { + border-radius:var(--bs-border-radius) !important +} + +.rounded-0 { + border-radius:0 !important +} + +.rounded-1 { + border-radius:var(--bs-border-radius-sm) !important +} + +.rounded-2 { + border-radius:var(--bs-border-radius) !important +} + +.rounded-3 { + border-radius:var(--bs-border-radius-lg) !important +} + +.rounded-4 { + border-radius:var(--bs-border-radius-xl) !important +} + +.rounded-5 { + border-radius:var(--bs-border-radius-2xl) !important +} + +.rounded-circle { + border-radius:50% !important +} + +.rounded-pill { + border-radius:var(--bs-border-radius-pill) !important +} + +.rounded-top { + border-top-left-radius: var(--bs-border-radius) !important; + border-top-right-radius:var(--bs-border-radius) !important +} + +.rounded-end { + border-top-right-radius: var(--bs-border-radius) !important; + border-bottom-right-radius:var(--bs-border-radius) !important +} + +.rounded-bottom { + border-bottom-right-radius: var(--bs-border-radius) !important; + border-bottom-left-radius:var(--bs-border-radius) !important +} + +.rounded-start { + border-bottom-left-radius: var(--bs-border-radius) !important; + border-top-left-radius:var(--bs-border-radius) !important +} + +.visible { + visibility:visible !important +} + +.invisible { + visibility:hidden !important +} + +@media (min-width: 576px) { + .float-sm-start { + float:left !important + } + + .float-sm-end { + float:right !important + } + + .float-sm-none { + float:none !important + } + + .d-sm-inline { + display:inline !important + } + + .d-sm-inline-block { + display:inline-block !important + } + + .d-sm-block { + display:block !important + } + + .d-sm-grid { + display:grid !important + } + + .d-sm-table { + display:table !important + } + + .d-sm-table-row { + display:table-row !important + } + + .d-sm-table-cell { + display:table-cell !important + } + + .d-sm-flex { + display:flex !important + } + + .d-sm-inline-flex { + display:inline-flex !important + } + + .d-sm-none { + display:none !important + } + + .flex-sm-fill { + flex:1 1 auto !important + } + + .flex-sm-row { + flex-direction:row !important + } + + .flex-sm-column { + flex-direction:column !important + } + + .flex-sm-row-reverse { + flex-direction:row-reverse !important + } + + .flex-sm-column-reverse { + flex-direction:column-reverse !important + } + + .flex-sm-grow-0 { + flex-grow:0 !important + } + + .flex-sm-grow-1 { + flex-grow:1 !important + } + + .flex-sm-shrink-0 { + flex-shrink:0 !important + } + + .flex-sm-shrink-1 { + flex-shrink:1 !important + } + + .flex-sm-wrap { + flex-wrap:wrap !important + } + + .flex-sm-nowrap { + flex-wrap:nowrap !important + } + + .flex-sm-wrap-reverse { + flex-wrap:wrap-reverse !important + } + + .justify-content-sm-start { + justify-content:flex-start !important + } + + .justify-content-sm-end { + justify-content:flex-end !important + } + + .justify-content-sm-center { + justify-content:center !important + } + + .justify-content-sm-between { + justify-content:space-between !important + } + + .justify-content-sm-around { + justify-content:space-around !important + } + + .justify-content-sm-evenly { + justify-content:space-evenly !important + } + + .align-items-sm-start { + align-items:flex-start !important + } + + .align-items-sm-end { + align-items:flex-end !important + } + + .align-items-sm-center { + align-items:center !important + } + + .align-items-sm-baseline { + align-items:baseline !important + } + + .align-items-sm-stretch { + align-items:stretch !important + } + + .align-content-sm-start { + align-content:flex-start !important + } + + .align-content-sm-end { + align-content:flex-end !important + } + + .align-content-sm-center { + align-content:center !important + } + + .align-content-sm-between { + align-content:space-between !important + } + + .align-content-sm-around { + align-content:space-around !important + } + + .align-content-sm-stretch { + align-content:stretch !important + } + + .align-self-sm-auto { + align-self:auto !important + } + + .align-self-sm-start { + align-self:flex-start !important + } + + .align-self-sm-end { + align-self:flex-end !important + } + + .align-self-sm-center { + align-self:center !important + } + + .align-self-sm-baseline { + align-self:baseline !important + } + + .align-self-sm-stretch { + align-self:stretch !important + } + + .order-sm-first { + order:-1 !important + } + + .order-sm-0 { + order:0 !important + } + + .order-sm-1 { + order:1 !important + } + + .order-sm-2 { + order:2 !important + } + + .order-sm-3 { + order:3 !important + } + + .order-sm-4 { + order:4 !important + } + + .order-sm-5 { + order:5 !important + } + + .order-sm-last { + order:6 !important + } + + .m-sm-0 { + margin:0 !important + } + + .m-sm-1 { + margin:.25rem !important + } + + .m-sm-2 { + margin:.5rem !important + } + + .m-sm-3 { + margin:1rem !important + } + + .m-sm-4 { + margin:1.5rem !important + } + + .m-sm-5 { + margin:3rem !important + } + + .m-sm-auto { + margin:auto !important + } + + .mx-sm-0 { + margin-right: 0 !important; + margin-left:0 !important + } + + .mx-sm-1 { + margin-right: .25rem !important; + margin-left:.25rem !important + } + + .mx-sm-2 { + margin-right: .5rem !important; + margin-left:.5rem !important + } + + .mx-sm-3 { + margin-right: 1rem !important; + margin-left:1rem !important + } + + .mx-sm-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important + } + + .mx-sm-5 { + margin-right: 3rem !important; + margin-left:3rem !important + } + + .mx-sm-auto { + margin-right: auto !important; + margin-left:auto !important + } + + .my-sm-0 { + margin-top: 0 !important; + margin-bottom:0 !important + } + + .my-sm-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important + } + + .my-sm-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important + } + + .my-sm-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important + } + + .my-sm-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important + } + + .my-sm-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important + } + + .my-sm-auto { + margin-top: auto !important; + margin-bottom:auto !important + } + + .mt-sm-0 { + margin-top:0 !important + } + + .mt-sm-1 { + margin-top:.25rem !important + } + + .mt-sm-2 { + margin-top:.5rem !important + } + + .mt-sm-3 { + margin-top:1rem !important + } + + .mt-sm-4 { + margin-top:1.5rem !important + } + + .mt-sm-5 { + margin-top:3rem !important + } + + .mt-sm-auto { + margin-top:auto !important + } + + .me-sm-0 { + margin-right:0 !important + } + + .me-sm-1 { + margin-right:.25rem !important + } + + .me-sm-2 { + margin-right:.5rem !important + } + + .me-sm-3 { + margin-right:1rem !important + } + + .me-sm-4 { + margin-right:1.5rem !important + } + + .me-sm-5 { + margin-right:3rem !important + } + + .me-sm-auto { + margin-right:auto !important + } + + .mb-sm-0 { + margin-bottom:0 !important + } + + .mb-sm-1 { + margin-bottom:.25rem !important + } + + .mb-sm-2 { + margin-bottom:.5rem !important + } + + .mb-sm-3 { + margin-bottom:1rem !important + } + + .mb-sm-4 { + margin-bottom:1.5rem !important + } + + .mb-sm-5 { + margin-bottom:3rem !important + } + + .mb-sm-auto { + margin-bottom:auto !important + } + + .ms-sm-0 { + margin-left:0 !important + } + + .ms-sm-1 { + margin-left:.25rem !important + } + + .ms-sm-2 { + margin-left:.5rem !important + } + + .ms-sm-3 { + margin-left:1rem !important + } + + .ms-sm-4 { + margin-left:1.5rem !important + } + + .ms-sm-5 { + margin-left:3rem !important + } + + .ms-sm-auto { + margin-left:auto !important + } + + .p-sm-0 { + padding:0 !important + } + + .p-sm-1 { + padding:.25rem !important + } + + .p-sm-2 { + padding:.5rem !important + } + + .p-sm-3 { + padding:1rem !important + } + + .p-sm-4 { + padding:1.5rem !important + } + + .p-sm-5 { + padding:3rem !important + } + + .px-sm-0 { + padding-right: 0 !important; + padding-left:0 !important + } + + .px-sm-1 { + padding-right: .25rem !important; + padding-left:.25rem !important + } + + .px-sm-2 { + padding-right: .5rem !important; + padding-left:.5rem !important + } + + .px-sm-3 { + padding-right: 1rem !important; + padding-left:1rem !important + } + + .px-sm-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important + } + + .px-sm-5 { + padding-right: 3rem !important; + padding-left:3rem !important + } + + .py-sm-0 { + padding-top: 0 !important; + padding-bottom:0 !important + } + + .py-sm-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important + } + + .py-sm-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important + } + + .py-sm-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important + } + + .py-sm-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important + } + + .py-sm-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important + } + + .pt-sm-0 { + padding-top:0 !important + } + + .pt-sm-1 { + padding-top:.25rem !important + } + + .pt-sm-2 { + padding-top:.5rem !important + } + + .pt-sm-3 { + padding-top:1rem !important + } + + .pt-sm-4 { + padding-top:1.5rem !important + } + + .pt-sm-5 { + padding-top:3rem !important + } + + .pe-sm-0 { + padding-right:0 !important + } + + .pe-sm-1 { + padding-right:.25rem !important + } + + .pe-sm-2 { + padding-right:.5rem !important + } + + .pe-sm-3 { + padding-right:1rem !important + } + + .pe-sm-4 { + padding-right:1.5rem !important + } + + .pe-sm-5 { + padding-right:3rem !important + } + + .pb-sm-0 { + padding-bottom:0 !important + } + + .pb-sm-1 { + padding-bottom:.25rem !important + } + + .pb-sm-2 { + padding-bottom:.5rem !important + } + + .pb-sm-3 { + padding-bottom:1rem !important + } + + .pb-sm-4 { + padding-bottom:1.5rem !important + } + + .pb-sm-5 { + padding-bottom:3rem !important + } + + .ps-sm-0 { + padding-left:0 !important + } + + .ps-sm-1 { + padding-left:.25rem !important + } + + .ps-sm-2 { + padding-left:.5rem !important + } + + .ps-sm-3 { + padding-left:1rem !important + } + + .ps-sm-4 { + padding-left:1.5rem !important + } + + .ps-sm-5 { + padding-left:3rem !important + } + + .gap-sm-0 { + gap:0 !important + } + + .gap-sm-1 { + gap:.25rem !important + } + + .gap-sm-2 { + gap:.5rem !important + } + + .gap-sm-3 { + gap:1rem !important + } + + .gap-sm-4 { + gap:1.5rem !important + } + + .gap-sm-5 { + gap:3rem !important + } + + .text-sm-start { + text-align:left !important + } + + .text-sm-end { + text-align:right !important + } + + .text-sm-center { + text-align:center !important + } +} + +@media (min-width: 768px) { + .float-md-start { + float:left !important + } + + .float-md-end { + float:right !important + } + + .float-md-none { + float:none !important + } + + .d-md-inline { + display:inline !important + } + + .d-md-inline-block { + display:inline-block !important + } + + .d-md-block { + display:block !important + } + + .d-md-grid { + display:grid !important + } + + .d-md-table { + display:table !important + } + + .d-md-table-row { + display:table-row !important + } + + .d-md-table-cell { + display:table-cell !important + } + + .d-md-flex { + display:flex !important + } + + .d-md-inline-flex { + display:inline-flex !important + } + + .d-md-none { + display:none !important + } + + .flex-md-fill { + flex:1 1 auto !important + } + + .flex-md-row { + flex-direction:row !important + } + + .flex-md-column { + flex-direction:column !important + } + + .flex-md-row-reverse { + flex-direction:row-reverse !important + } + + .flex-md-column-reverse { + flex-direction:column-reverse !important + } + + .flex-md-grow-0 { + flex-grow:0 !important + } + + .flex-md-grow-1 { + flex-grow:1 !important + } + + .flex-md-shrink-0 { + flex-shrink:0 !important + } + + .flex-md-shrink-1 { + flex-shrink:1 !important + } + + .flex-md-wrap { + flex-wrap:wrap !important + } + + .flex-md-nowrap { + flex-wrap:nowrap !important + } + + .flex-md-wrap-reverse { + flex-wrap:wrap-reverse !important + } + + .justify-content-md-start { + justify-content:flex-start !important + } + + .justify-content-md-end { + justify-content:flex-end !important + } + + .justify-content-md-center { + justify-content:center !important + } + + .justify-content-md-between { + justify-content:space-between !important + } + + .justify-content-md-around { + justify-content:space-around !important + } + + .justify-content-md-evenly { + justify-content:space-evenly !important + } + + .align-items-md-start { + align-items:flex-start !important + } + + .align-items-md-end { + align-items:flex-end !important + } + + .align-items-md-center { + align-items:center !important + } + + .align-items-md-baseline { + align-items:baseline !important + } + + .align-items-md-stretch { + align-items:stretch !important + } + + .align-content-md-start { + align-content:flex-start !important + } + + .align-content-md-end { + align-content:flex-end !important + } + + .align-content-md-center { + align-content:center !important + } + + .align-content-md-between { + align-content:space-between !important + } + + .align-content-md-around { + align-content:space-around !important + } + + .align-content-md-stretch { + align-content:stretch !important + } + + .align-self-md-auto { + align-self:auto !important + } + + .align-self-md-start { + align-self:flex-start !important + } + + .align-self-md-end { + align-self:flex-end !important + } + + .align-self-md-center { + align-self:center !important + } + + .align-self-md-baseline { + align-self:baseline !important + } + + .align-self-md-stretch { + align-self:stretch !important + } + + .order-md-first { + order:-1 !important + } + + .order-md-0 { + order:0 !important + } + + .order-md-1 { + order:1 !important + } + + .order-md-2 { + order:2 !important + } + + .order-md-3 { + order:3 !important + } + + .order-md-4 { + order:4 !important + } + + .order-md-5 { + order:5 !important + } + + .order-md-last { + order:6 !important + } + + .m-md-0 { + margin:0 !important + } + + .m-md-1 { + margin:.25rem !important + } + + .m-md-2 { + margin:.5rem !important + } + + .m-md-3 { + margin:1rem !important + } + + .m-md-4 { + margin:1.5rem !important + } + + .m-md-5 { + margin:3rem !important + } + + .m-md-auto { + margin:auto !important + } + + .mx-md-0 { + margin-right: 0 !important; + margin-left:0 !important + } + + .mx-md-1 { + margin-right: .25rem !important; + margin-left:.25rem !important + } + + .mx-md-2 { + margin-right: .5rem !important; + margin-left:.5rem !important + } + + .mx-md-3 { + margin-right: 1rem !important; + margin-left:1rem !important + } + + .mx-md-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important + } + + .mx-md-5 { + margin-right: 3rem !important; + margin-left:3rem !important + } + + .mx-md-auto { + margin-right: auto !important; + margin-left:auto !important + } + + .my-md-0 { + margin-top: 0 !important; + margin-bottom:0 !important + } + + .my-md-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important + } + + .my-md-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important + } + + .my-md-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important + } + + .my-md-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important + } + + .my-md-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important + } + + .my-md-auto { + margin-top: auto !important; + margin-bottom:auto !important + } + + .mt-md-0 { + margin-top:0 !important + } + + .mt-md-1 { + margin-top:.25rem !important + } + + .mt-md-2 { + margin-top:.5rem !important + } + + .mt-md-3 { + margin-top:1rem !important + } + + .mt-md-4 { + margin-top:1.5rem !important + } + + .mt-md-5 { + margin-top:3rem !important + } + + .mt-md-auto { + margin-top:auto !important + } + + .me-md-0 { + margin-right:0 !important + } + + .me-md-1 { + margin-right:.25rem !important + } + + .me-md-2 { + margin-right:.5rem !important + } + + .me-md-3 { + margin-right:1rem !important + } + + .me-md-4 { + margin-right:1.5rem !important + } + + .me-md-5 { + margin-right:3rem !important + } + + .me-md-auto { + margin-right:auto !important + } + + .mb-md-0 { + margin-bottom:0 !important + } + + .mb-md-1 { + margin-bottom:.25rem !important + } + + .mb-md-2 { + margin-bottom:.5rem !important + } + + .mb-md-3 { + margin-bottom:1rem !important + } + + .mb-md-4 { + margin-bottom:1.5rem !important + } + + .mb-md-5 { + margin-bottom:3rem !important + } + + .mb-md-auto { + margin-bottom:auto !important + } + + .ms-md-0 { + margin-left:0 !important + } + + .ms-md-1 { + margin-left:.25rem !important + } + + .ms-md-2 { + margin-left:.5rem !important + } + + .ms-md-3 { + margin-left:1rem !important + } + + .ms-md-4 { + margin-left:1.5rem !important + } + + .ms-md-5 { + margin-left:3rem !important + } + + .ms-md-auto { + margin-left:auto !important + } + + .p-md-0 { + padding:0 !important + } + + .p-md-1 { + padding:.25rem !important + } + + .p-md-2 { + padding:.5rem !important + } + + .p-md-3 { + padding:1rem !important + } + + .p-md-4 { + padding:1.5rem !important + } + + .p-md-5 { + padding:3rem !important + } + + .px-md-0 { + padding-right: 0 !important; + padding-left:0 !important + } + + .px-md-1 { + padding-right: .25rem !important; + padding-left:.25rem !important + } + + .px-md-2 { + padding-right: .5rem !important; + padding-left:.5rem !important + } + + .px-md-3 { + padding-right: 1rem !important; + padding-left:1rem !important + } + + .px-md-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important + } + + .px-md-5 { + padding-right: 3rem !important; + padding-left:3rem !important + } + + .py-md-0 { + padding-top: 0 !important; + padding-bottom:0 !important + } + + .py-md-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important + } + + .py-md-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important + } + + .py-md-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important + } + + .py-md-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important + } + + .py-md-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important + } + + .pt-md-0 { + padding-top:0 !important + } + + .pt-md-1 { + padding-top:.25rem !important + } + + .pt-md-2 { + padding-top:.5rem !important + } + + .pt-md-3 { + padding-top:1rem !important + } + + .pt-md-4 { + padding-top:1.5rem !important + } + + .pt-md-5 { + padding-top:3rem !important + } + + .pe-md-0 { + padding-right:0 !important + } + + .pe-md-1 { + padding-right:.25rem !important + } + + .pe-md-2 { + padding-right:.5rem !important + } + + .pe-md-3 { + padding-right:1rem !important + } + + .pe-md-4 { + padding-right:1.5rem !important + } + + .pe-md-5 { + padding-right:3rem !important + } + + .pb-md-0 { + padding-bottom:0 !important + } + + .pb-md-1 { + padding-bottom:.25rem !important + } + + .pb-md-2 { + padding-bottom:.5rem !important + } + + .pb-md-3 { + padding-bottom:1rem !important + } + + .pb-md-4 { + padding-bottom:1.5rem !important + } + + .pb-md-5 { + padding-bottom:3rem !important + } + + .ps-md-0 { + padding-left:0 !important + } + + .ps-md-1 { + padding-left:.25rem !important + } + + .ps-md-2 { + padding-left:.5rem !important + } + + .ps-md-3 { + padding-left:1rem !important + } + + .ps-md-4 { + padding-left:1.5rem !important + } + + .ps-md-5 { + padding-left:3rem !important + } + + .gap-md-0 { + gap:0 !important + } + + .gap-md-1 { + gap:.25rem !important + } + + .gap-md-2 { + gap:.5rem !important + } + + .gap-md-3 { + gap:1rem !important + } + + .gap-md-4 { + gap:1.5rem !important + } + + .gap-md-5 { + gap:3rem !important + } + + .text-md-start { + text-align:left !important + } + + .text-md-end { + text-align:right !important + } + + .text-md-center { + text-align:center !important + } +} + +@media (min-width: 992px) { + .float-lg-start { + float:left !important + } + + .float-lg-end { + float:right !important + } + + .float-lg-none { + float:none !important + } + + .d-lg-inline { + display:inline !important + } + + .d-lg-inline-block { + display:inline-block !important + } + + .d-lg-block { + display:block !important + } + + .d-lg-grid { + display:grid !important + } + + .d-lg-table { + display:table !important + } + + .d-lg-table-row { + display:table-row !important + } + + .d-lg-table-cell { + display:table-cell !important + } + + .d-lg-flex { + display:flex !important + } + + .d-lg-inline-flex { + display:inline-flex !important + } + + .d-lg-none { + display:none !important + } + + .flex-lg-fill { + flex:1 1 auto !important + } + + .flex-lg-row { + flex-direction:row !important + } + + .flex-lg-column { + flex-direction:column !important + } + + .flex-lg-row-reverse { + flex-direction:row-reverse !important + } + + .flex-lg-column-reverse { + flex-direction:column-reverse !important + } + + .flex-lg-grow-0 { + flex-grow:0 !important + } + + .flex-lg-grow-1 { + flex-grow:1 !important + } + + .flex-lg-shrink-0 { + flex-shrink:0 !important + } + + .flex-lg-shrink-1 { + flex-shrink:1 !important + } + + .flex-lg-wrap { + flex-wrap:wrap !important + } + + .flex-lg-nowrap { + flex-wrap:nowrap !important + } + + .flex-lg-wrap-reverse { + flex-wrap:wrap-reverse !important + } + + .justify-content-lg-start { + justify-content:flex-start !important + } + + .justify-content-lg-end { + justify-content:flex-end !important + } + + .justify-content-lg-center { + justify-content:center !important + } + + .justify-content-lg-between { + justify-content:space-between !important + } + + .justify-content-lg-around { + justify-content:space-around !important + } + + .justify-content-lg-evenly { + justify-content:space-evenly !important + } + + .align-items-lg-start { + align-items:flex-start !important + } + + .align-items-lg-end { + align-items:flex-end !important + } + + .align-items-lg-center { + align-items:center !important + } + + .align-items-lg-baseline { + align-items:baseline !important + } + + .align-items-lg-stretch { + align-items:stretch !important + } + + .align-content-lg-start { + align-content:flex-start !important + } + + .align-content-lg-end { + align-content:flex-end !important + } + + .align-content-lg-center { + align-content:center !important + } + + .align-content-lg-between { + align-content:space-between !important + } + + .align-content-lg-around { + align-content:space-around !important + } + + .align-content-lg-stretch { + align-content:stretch !important + } + + .align-self-lg-auto { + align-self:auto !important + } + + .align-self-lg-start { + align-self:flex-start !important + } + + .align-self-lg-end { + align-self:flex-end !important + } + + .align-self-lg-center { + align-self:center !important + } + + .align-self-lg-baseline { + align-self:baseline !important + } + + .align-self-lg-stretch { + align-self:stretch !important + } + + .order-lg-first { + order:-1 !important + } + + .order-lg-0 { + order:0 !important + } + + .order-lg-1 { + order:1 !important + } + + .order-lg-2 { + order:2 !important + } + + .order-lg-3 { + order:3 !important + } + + .order-lg-4 { + order:4 !important + } + + .order-lg-5 { + order:5 !important + } + + .order-lg-last { + order:6 !important + } + + .m-lg-0 { + margin:0 !important + } + + .m-lg-1 { + margin:.25rem !important + } + + .m-lg-2 { + margin:.5rem !important + } + + .m-lg-3 { + margin:1rem !important + } + + .m-lg-4 { + margin:1.5rem !important + } + + .m-lg-5 { + margin:3rem !important + } + + .m-lg-auto { + margin:auto !important + } + + .mx-lg-0 { + margin-right: 0 !important; + margin-left:0 !important + } + + .mx-lg-1 { + margin-right: .25rem !important; + margin-left:.25rem !important + } + + .mx-lg-2 { + margin-right: .5rem !important; + margin-left:.5rem !important + } + + .mx-lg-3 { + margin-right: 1rem !important; + margin-left:1rem !important + } + + .mx-lg-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important + } + + .mx-lg-5 { + margin-right: 3rem !important; + margin-left:3rem !important + } + + .mx-lg-auto { + margin-right: auto !important; + margin-left:auto !important + } + + .my-lg-0 { + margin-top: 0 !important; + margin-bottom:0 !important + } + + .my-lg-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important + } + + .my-lg-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important + } + + .my-lg-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important + } + + .my-lg-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important + } + + .my-lg-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important + } + + .my-lg-auto { + margin-top: auto !important; + margin-bottom:auto !important + } + + .mt-lg-0 { + margin-top:0 !important + } + + .mt-lg-1 { + margin-top:.25rem !important + } + + .mt-lg-2 { + margin-top:.5rem !important + } + + .mt-lg-3 { + margin-top:1rem !important + } + + .mt-lg-4 { + margin-top:1.5rem !important + } + + .mt-lg-5 { + margin-top:3rem !important + } + + .mt-lg-auto { + margin-top:auto !important + } + + .me-lg-0 { + margin-right:0 !important + } + + .me-lg-1 { + margin-right:.25rem !important + } + + .me-lg-2 { + margin-right:.5rem !important + } + + .me-lg-3 { + margin-right:1rem !important + } + + .me-lg-4 { + margin-right:1.5rem !important + } + + .me-lg-5 { + margin-right:3rem !important + } + + .me-lg-auto { + margin-right:auto !important + } + + .mb-lg-0 { + margin-bottom:0 !important + } + + .mb-lg-1 { + margin-bottom:.25rem !important + } + + .mb-lg-2 { + margin-bottom:.5rem !important + } + + .mb-lg-3 { + margin-bottom:1rem !important + } + + .mb-lg-4 { + margin-bottom:1.5rem !important + } + + .mb-lg-5 { + margin-bottom:3rem !important + } + + .mb-lg-auto { + margin-bottom:auto !important + } + + .ms-lg-0 { + margin-left:0 !important + } + + .ms-lg-1 { + margin-left:.25rem !important + } + + .ms-lg-2 { + margin-left:.5rem !important + } + + .ms-lg-3 { + margin-left:1rem !important + } + + .ms-lg-4 { + margin-left:1.5rem !important + } + + .ms-lg-5 { + margin-left:3rem !important + } + + .ms-lg-auto { + margin-left:auto !important + } + + .p-lg-0 { + padding:0 !important + } + + .p-lg-1 { + padding:.25rem !important + } + + .p-lg-2 { + padding:.5rem !important + } + + .p-lg-3 { + padding:1rem !important + } + + .p-lg-4 { + padding:1.5rem !important + } + + .p-lg-5 { + padding:3rem !important + } + + .px-lg-0 { + padding-right: 0 !important; + padding-left:0 !important + } + + .px-lg-1 { + padding-right: .25rem !important; + padding-left:.25rem !important + } + + .px-lg-2 { + padding-right: .5rem !important; + padding-left:.5rem !important + } + + .px-lg-3 { + padding-right: 1rem !important; + padding-left:1rem !important + } + + .px-lg-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important + } + + .px-lg-5 { + padding-right: 3rem !important; + padding-left:3rem !important + } + + .py-lg-0 { + padding-top: 0 !important; + padding-bottom:0 !important + } + + .py-lg-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important + } + + .py-lg-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important + } + + .py-lg-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important + } + + .py-lg-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important + } + + .py-lg-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important + } + + .pt-lg-0 { + padding-top:0 !important + } + + .pt-lg-1 { + padding-top:.25rem !important + } + + .pt-lg-2 { + padding-top:.5rem !important + } + + .pt-lg-3 { + padding-top:1rem !important + } + + .pt-lg-4 { + padding-top:1.5rem !important + } + + .pt-lg-5 { + padding-top:3rem !important + } + + .pe-lg-0 { + padding-right:0 !important + } + + .pe-lg-1 { + padding-right:.25rem !important + } + + .pe-lg-2 { + padding-right:.5rem !important + } + + .pe-lg-3 { + padding-right:1rem !important + } + + .pe-lg-4 { + padding-right:1.5rem !important + } + + .pe-lg-5 { + padding-right:3rem !important + } + + .pb-lg-0 { + padding-bottom:0 !important + } + + .pb-lg-1 { + padding-bottom:.25rem !important + } + + .pb-lg-2 { + padding-bottom:.5rem !important + } + + .pb-lg-3 { + padding-bottom:1rem !important + } + + .pb-lg-4 { + padding-bottom:1.5rem !important + } + + .pb-lg-5 { + padding-bottom:3rem !important + } + + .ps-lg-0 { + padding-left:0 !important + } + + .ps-lg-1 { + padding-left:.25rem !important + } + + .ps-lg-2 { + padding-left:.5rem !important + } + + .ps-lg-3 { + padding-left:1rem !important + } + + .ps-lg-4 { + padding-left:1.5rem !important + } + + .ps-lg-5 { + padding-left:3rem !important + } + + .gap-lg-0 { + gap:0 !important + } + + .gap-lg-1 { + gap:.25rem !important + } + + .gap-lg-2 { + gap:.5rem !important + } + + .gap-lg-3 { + gap:1rem !important + } + + .gap-lg-4 { + gap:1.5rem !important + } + + .gap-lg-5 { + gap:3rem !important + } + + .text-lg-start { + text-align:left !important + } + + .text-lg-end { + text-align:right !important + } + + .text-lg-center { + text-align:center !important + } +} + +@media (min-width: 1200px) { + .float-xl-start { + float:left !important + } + + .float-xl-end { + float:right !important + } + + .float-xl-none { + float:none !important + } + + .d-xl-inline { + display:inline !important + } + + .d-xl-inline-block { + display:inline-block !important + } + + .d-xl-block { + display:block !important + } + + .d-xl-grid { + display:grid !important + } + + .d-xl-table { + display:table !important + } + + .d-xl-table-row { + display:table-row !important + } + + .d-xl-table-cell { + display:table-cell !important + } + + .d-xl-flex { + display:flex !important + } + + .d-xl-inline-flex { + display:inline-flex !important + } + + .d-xl-none { + display:none !important + } + + .flex-xl-fill { + flex:1 1 auto !important + } + + .flex-xl-row { + flex-direction:row !important + } + + .flex-xl-column { + flex-direction:column !important + } + + .flex-xl-row-reverse { + flex-direction:row-reverse !important + } + + .flex-xl-column-reverse { + flex-direction:column-reverse !important + } + + .flex-xl-grow-0 { + flex-grow:0 !important + } + + .flex-xl-grow-1 { + flex-grow:1 !important + } + + .flex-xl-shrink-0 { + flex-shrink:0 !important + } + + .flex-xl-shrink-1 { + flex-shrink:1 !important + } + + .flex-xl-wrap { + flex-wrap:wrap !important + } + + .flex-xl-nowrap { + flex-wrap:nowrap !important + } + + .flex-xl-wrap-reverse { + flex-wrap:wrap-reverse !important + } + + .justify-content-xl-start { + justify-content:flex-start !important + } + + .justify-content-xl-end { + justify-content:flex-end !important + } + + .justify-content-xl-center { + justify-content:center !important + } + + .justify-content-xl-between { + justify-content:space-between !important + } + + .justify-content-xl-around { + justify-content:space-around !important + } + + .justify-content-xl-evenly { + justify-content:space-evenly !important + } + + .align-items-xl-start { + align-items:flex-start !important + } + + .align-items-xl-end { + align-items:flex-end !important + } + + .align-items-xl-center { + align-items:center !important + } + + .align-items-xl-baseline { + align-items:baseline !important + } + + .align-items-xl-stretch { + align-items:stretch !important + } + + .align-content-xl-start { + align-content:flex-start !important + } + + .align-content-xl-end { + align-content:flex-end !important + } + + .align-content-xl-center { + align-content:center !important + } + + .align-content-xl-between { + align-content:space-between !important + } + + .align-content-xl-around { + align-content:space-around !important + } + + .align-content-xl-stretch { + align-content:stretch !important + } + + .align-self-xl-auto { + align-self:auto !important + } + + .align-self-xl-start { + align-self:flex-start !important + } + + .align-self-xl-end { + align-self:flex-end !important + } + + .align-self-xl-center { + align-self:center !important + } + + .align-self-xl-baseline { + align-self:baseline !important + } + + .align-self-xl-stretch { + align-self:stretch !important + } + + .order-xl-first { + order:-1 !important + } + + .order-xl-0 { + order:0 !important + } + + .order-xl-1 { + order:1 !important + } + + .order-xl-2 { + order:2 !important + } + + .order-xl-3 { + order:3 !important + } + + .order-xl-4 { + order:4 !important + } + + .order-xl-5 { + order:5 !important + } + + .order-xl-last { + order:6 !important + } + + .m-xl-0 { + margin:0 !important + } + + .m-xl-1 { + margin:.25rem !important + } + + .m-xl-2 { + margin:.5rem !important + } + + .m-xl-3 { + margin:1rem !important + } + + .m-xl-4 { + margin:1.5rem !important + } + + .m-xl-5 { + margin:3rem !important + } + + .m-xl-auto { + margin:auto !important + } + + .mx-xl-0 { + margin-right: 0 !important; + margin-left:0 !important + } + + .mx-xl-1 { + margin-right: .25rem !important; + margin-left:.25rem !important + } + + .mx-xl-2 { + margin-right: .5rem !important; + margin-left:.5rem !important + } + + .mx-xl-3 { + margin-right: 1rem !important; + margin-left:1rem !important + } + + .mx-xl-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important + } + + .mx-xl-5 { + margin-right: 3rem !important; + margin-left:3rem !important + } + + .mx-xl-auto { + margin-right: auto !important; + margin-left:auto !important + } + + .my-xl-0 { + margin-top: 0 !important; + margin-bottom:0 !important + } + + .my-xl-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important + } + + .my-xl-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important + } + + .my-xl-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important + } + + .my-xl-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important + } + + .my-xl-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important + } + + .my-xl-auto { + margin-top: auto !important; + margin-bottom:auto !important + } + + .mt-xl-0 { + margin-top:0 !important + } + + .mt-xl-1 { + margin-top:.25rem !important + } + + .mt-xl-2 { + margin-top:.5rem !important + } + + .mt-xl-3 { + margin-top:1rem !important + } + + .mt-xl-4 { + margin-top:1.5rem !important + } + + .mt-xl-5 { + margin-top:3rem !important + } + + .mt-xl-auto { + margin-top:auto !important + } + + .me-xl-0 { + margin-right:0 !important + } + + .me-xl-1 { + margin-right:.25rem !important + } + + .me-xl-2 { + margin-right:.5rem !important + } + + .me-xl-3 { + margin-right:1rem !important + } + + .me-xl-4 { + margin-right:1.5rem !important + } + + .me-xl-5 { + margin-right:3rem !important + } + + .me-xl-auto { + margin-right:auto !important + } + + .mb-xl-0 { + margin-bottom:0 !important + } + + .mb-xl-1 { + margin-bottom:.25rem !important + } + + .mb-xl-2 { + margin-bottom:.5rem !important + } + + .mb-xl-3 { + margin-bottom:1rem !important + } + + .mb-xl-4 { + margin-bottom:1.5rem !important + } + + .mb-xl-5 { + margin-bottom:3rem !important + } + + .mb-xl-auto { + margin-bottom:auto !important + } + + .ms-xl-0 { + margin-left:0 !important + } + + .ms-xl-1 { + margin-left:.25rem !important + } + + .ms-xl-2 { + margin-left:.5rem !important + } + + .ms-xl-3 { + margin-left:1rem !important + } + + .ms-xl-4 { + margin-left:1.5rem !important + } + + .ms-xl-5 { + margin-left:3rem !important + } + + .ms-xl-auto { + margin-left:auto !important + } + + .p-xl-0 { + padding:0 !important + } + + .p-xl-1 { + padding:.25rem !important + } + + .p-xl-2 { + padding:.5rem !important + } + + .p-xl-3 { + padding:1rem !important + } + + .p-xl-4 { + padding:1.5rem !important + } + + .p-xl-5 { + padding:3rem !important + } + + .px-xl-0 { + padding-right: 0 !important; + padding-left:0 !important + } + + .px-xl-1 { + padding-right: .25rem !important; + padding-left:.25rem !important + } + + .px-xl-2 { + padding-right: .5rem !important; + padding-left:.5rem !important + } + + .px-xl-3 { + padding-right: 1rem !important; + padding-left:1rem !important + } + + .px-xl-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important + } + + .px-xl-5 { + padding-right: 3rem !important; + padding-left:3rem !important + } + + .py-xl-0 { + padding-top: 0 !important; + padding-bottom:0 !important + } + + .py-xl-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important + } + + .py-xl-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important + } + + .py-xl-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important + } + + .py-xl-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important + } + + .py-xl-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important + } + + .pt-xl-0 { + padding-top:0 !important + } + + .pt-xl-1 { + padding-top:.25rem !important + } + + .pt-xl-2 { + padding-top:.5rem !important + } + + .pt-xl-3 { + padding-top:1rem !important + } + + .pt-xl-4 { + padding-top:1.5rem !important + } + + .pt-xl-5 { + padding-top:3rem !important + } + + .pe-xl-0 { + padding-right:0 !important + } + + .pe-xl-1 { + padding-right:.25rem !important + } + + .pe-xl-2 { + padding-right:.5rem !important + } + + .pe-xl-3 { + padding-right:1rem !important + } + + .pe-xl-4 { + padding-right:1.5rem !important + } + + .pe-xl-5 { + padding-right:3rem !important + } + + .pb-xl-0 { + padding-bottom:0 !important + } + + .pb-xl-1 { + padding-bottom:.25rem !important + } + + .pb-xl-2 { + padding-bottom:.5rem !important + } + + .pb-xl-3 { + padding-bottom:1rem !important + } + + .pb-xl-4 { + padding-bottom:1.5rem !important + } + + .pb-xl-5 { + padding-bottom:3rem !important + } + + .ps-xl-0 { + padding-left:0 !important + } + + .ps-xl-1 { + padding-left:.25rem !important + } + + .ps-xl-2 { + padding-left:.5rem !important + } + + .ps-xl-3 { + padding-left:1rem !important + } + + .ps-xl-4 { + padding-left:1.5rem !important + } + + .ps-xl-5 { + padding-left:3rem !important + } + + .gap-xl-0 { + gap:0 !important + } + + .gap-xl-1 { + gap:.25rem !important + } + + .gap-xl-2 { + gap:.5rem !important + } + + .gap-xl-3 { + gap:1rem !important + } + + .gap-xl-4 { + gap:1.5rem !important + } + + .gap-xl-5 { + gap:3rem !important + } + + .text-xl-start { + text-align:left !important + } + + .text-xl-end { + text-align:right !important + } + + .text-xl-center { + text-align:center !important + } +} + +@media (min-width: 1400px) { + .float-xxl-start { + float:left !important + } + + .float-xxl-end { + float:right !important + } + + .float-xxl-none { + float:none !important + } + + .d-xxl-inline { + display:inline !important + } + + .d-xxl-inline-block { + display:inline-block !important + } + + .d-xxl-block { + display:block !important + } + + .d-xxl-grid { + display:grid !important + } + + .d-xxl-table { + display:table !important + } + + .d-xxl-table-row { + display:table-row !important + } + + .d-xxl-table-cell { + display:table-cell !important + } + + .d-xxl-flex { + display:flex !important + } + + .d-xxl-inline-flex { + display:inline-flex !important + } + + .d-xxl-none { + display:none !important + } + + .flex-xxl-fill { + flex:1 1 auto !important + } + + .flex-xxl-row { + flex-direction:row !important + } + + .flex-xxl-column { + flex-direction:column !important + } + + .flex-xxl-row-reverse { + flex-direction:row-reverse !important + } + + .flex-xxl-column-reverse { + flex-direction:column-reverse !important + } + + .flex-xxl-grow-0 { + flex-grow:0 !important + } + + .flex-xxl-grow-1 { + flex-grow:1 !important + } + + .flex-xxl-shrink-0 { + flex-shrink:0 !important + } + + .flex-xxl-shrink-1 { + flex-shrink:1 !important + } + + .flex-xxl-wrap { + flex-wrap:wrap !important + } + + .flex-xxl-nowrap { + flex-wrap:nowrap !important + } + + .flex-xxl-wrap-reverse { + flex-wrap:wrap-reverse !important + } + + .justify-content-xxl-start { + justify-content:flex-start !important + } + + .justify-content-xxl-end { + justify-content:flex-end !important + } + + .justify-content-xxl-center { + justify-content:center !important + } + + .justify-content-xxl-between { + justify-content:space-between !important + } + + .justify-content-xxl-around { + justify-content:space-around !important + } + + .justify-content-xxl-evenly { + justify-content:space-evenly !important + } + + .align-items-xxl-start { + align-items:flex-start !important + } + + .align-items-xxl-end { + align-items:flex-end !important + } + + .align-items-xxl-center { + align-items:center !important + } + + .align-items-xxl-baseline { + align-items:baseline !important + } + + .align-items-xxl-stretch { + align-items:stretch !important + } + + .align-content-xxl-start { + align-content:flex-start !important + } + + .align-content-xxl-end { + align-content:flex-end !important + } + + .align-content-xxl-center { + align-content:center !important + } + + .align-content-xxl-between { + align-content:space-between !important + } + + .align-content-xxl-around { + align-content:space-around !important + } + + .align-content-xxl-stretch { + align-content:stretch !important + } + + .align-self-xxl-auto { + align-self:auto !important + } + + .align-self-xxl-start { + align-self:flex-start !important + } + + .align-self-xxl-end { + align-self:flex-end !important + } + + .align-self-xxl-center { + align-self:center !important + } + + .align-self-xxl-baseline { + align-self:baseline !important + } + + .align-self-xxl-stretch { + align-self:stretch !important + } + + .order-xxl-first { + order:-1 !important + } + + .order-xxl-0 { + order:0 !important + } + + .order-xxl-1 { + order:1 !important + } + + .order-xxl-2 { + order:2 !important + } + + .order-xxl-3 { + order:3 !important + } + + .order-xxl-4 { + order:4 !important + } + + .order-xxl-5 { + order:5 !important + } + + .order-xxl-last { + order:6 !important + } + + .m-xxl-0 { + margin:0 !important + } + + .m-xxl-1 { + margin:.25rem !important + } + + .m-xxl-2 { + margin:.5rem !important + } + + .m-xxl-3 { + margin:1rem !important + } + + .m-xxl-4 { + margin:1.5rem !important + } + + .m-xxl-5 { + margin:3rem !important + } + + .m-xxl-auto { + margin:auto !important + } + + .mx-xxl-0 { + margin-right: 0 !important; + margin-left:0 !important + } + + .mx-xxl-1 { + margin-right: .25rem !important; + margin-left:.25rem !important + } + + .mx-xxl-2 { + margin-right: .5rem !important; + margin-left:.5rem !important + } + + .mx-xxl-3 { + margin-right: 1rem !important; + margin-left:1rem !important + } + + .mx-xxl-4 { + margin-right: 1.5rem !important; + margin-left:1.5rem !important + } + + .mx-xxl-5 { + margin-right: 3rem !important; + margin-left:3rem !important + } + + .mx-xxl-auto { + margin-right: auto !important; + margin-left:auto !important + } + + .my-xxl-0 { + margin-top: 0 !important; + margin-bottom:0 !important + } + + .my-xxl-1 { + margin-top: .25rem !important; + margin-bottom:.25rem !important + } + + .my-xxl-2 { + margin-top: .5rem !important; + margin-bottom:.5rem !important + } + + .my-xxl-3 { + margin-top: 1rem !important; + margin-bottom:1rem !important + } + + .my-xxl-4 { + margin-top: 1.5rem !important; + margin-bottom:1.5rem !important + } + + .my-xxl-5 { + margin-top: 3rem !important; + margin-bottom:3rem !important + } + + .my-xxl-auto { + margin-top: auto !important; + margin-bottom:auto !important + } + + .mt-xxl-0 { + margin-top:0 !important + } + + .mt-xxl-1 { + margin-top:.25rem !important + } + + .mt-xxl-2 { + margin-top:.5rem !important + } + + .mt-xxl-3 { + margin-top:1rem !important + } + + .mt-xxl-4 { + margin-top:1.5rem !important + } + + .mt-xxl-5 { + margin-top:3rem !important + } + + .mt-xxl-auto { + margin-top:auto !important + } + + .me-xxl-0 { + margin-right:0 !important + } + + .me-xxl-1 { + margin-right:.25rem !important + } + + .me-xxl-2 { + margin-right:.5rem !important + } + + .me-xxl-3 { + margin-right:1rem !important + } + + .me-xxl-4 { + margin-right:1.5rem !important + } + + .me-xxl-5 { + margin-right:3rem !important + } + + .me-xxl-auto { + margin-right:auto !important + } + + .mb-xxl-0 { + margin-bottom:0 !important + } + + .mb-xxl-1 { + margin-bottom:.25rem !important + } + + .mb-xxl-2 { + margin-bottom:.5rem !important + } + + .mb-xxl-3 { + margin-bottom:1rem !important + } + + .mb-xxl-4 { + margin-bottom:1.5rem !important + } + + .mb-xxl-5 { + margin-bottom:3rem !important + } + + .mb-xxl-auto { + margin-bottom:auto !important + } + + .ms-xxl-0 { + margin-left:0 !important + } + + .ms-xxl-1 { + margin-left:.25rem !important + } + + .ms-xxl-2 { + margin-left:.5rem !important + } + + .ms-xxl-3 { + margin-left:1rem !important + } + + .ms-xxl-4 { + margin-left:1.5rem !important + } + + .ms-xxl-5 { + margin-left:3rem !important + } + + .ms-xxl-auto { + margin-left:auto !important + } + + .p-xxl-0 { + padding:0 !important + } + + .p-xxl-1 { + padding:.25rem !important + } + + .p-xxl-2 { + padding:.5rem !important + } + + .p-xxl-3 { + padding:1rem !important + } + + .p-xxl-4 { + padding:1.5rem !important + } + + .p-xxl-5 { + padding:3rem !important + } + + .px-xxl-0 { + padding-right: 0 !important; + padding-left:0 !important + } + + .px-xxl-1 { + padding-right: .25rem !important; + padding-left:.25rem !important + } + + .px-xxl-2 { + padding-right: .5rem !important; + padding-left:.5rem !important + } + + .px-xxl-3 { + padding-right: 1rem !important; + padding-left:1rem !important + } + + .px-xxl-4 { + padding-right: 1.5rem !important; + padding-left:1.5rem !important + } + + .px-xxl-5 { + padding-right: 3rem !important; + padding-left:3rem !important + } + + .py-xxl-0 { + padding-top: 0 !important; + padding-bottom:0 !important + } + + .py-xxl-1 { + padding-top: .25rem !important; + padding-bottom:.25rem !important + } + + .py-xxl-2 { + padding-top: .5rem !important; + padding-bottom:.5rem !important + } + + .py-xxl-3 { + padding-top: 1rem !important; + padding-bottom:1rem !important + } + + .py-xxl-4 { + padding-top: 1.5rem !important; + padding-bottom:1.5rem !important + } + + .py-xxl-5 { + padding-top: 3rem !important; + padding-bottom:3rem !important + } + + .pt-xxl-0 { + padding-top:0 !important + } + + .pt-xxl-1 { + padding-top:.25rem !important + } + + .pt-xxl-2 { + padding-top:.5rem !important + } + + .pt-xxl-3 { + padding-top:1rem !important + } + + .pt-xxl-4 { + padding-top:1.5rem !important + } + + .pt-xxl-5 { + padding-top:3rem !important + } + + .pe-xxl-0 { + padding-right:0 !important + } + + .pe-xxl-1 { + padding-right:.25rem !important + } + + .pe-xxl-2 { + padding-right:.5rem !important + } + + .pe-xxl-3 { + padding-right:1rem !important + } + + .pe-xxl-4 { + padding-right:1.5rem !important + } + + .pe-xxl-5 { + padding-right:3rem !important + } + + .pb-xxl-0 { + padding-bottom:0 !important + } + + .pb-xxl-1 { + padding-bottom:.25rem !important + } + + .pb-xxl-2 { + padding-bottom:.5rem !important + } + + .pb-xxl-3 { + padding-bottom:1rem !important + } + + .pb-xxl-4 { + padding-bottom:1.5rem !important + } + + .pb-xxl-5 { + padding-bottom:3rem !important + } + + .ps-xxl-0 { + padding-left:0 !important + } + + .ps-xxl-1 { + padding-left:.25rem !important + } + + .ps-xxl-2 { + padding-left:.5rem !important + } + + .ps-xxl-3 { + padding-left:1rem !important + } + + .ps-xxl-4 { + padding-left:1.5rem !important + } + + .ps-xxl-5 { + padding-left:3rem !important + } + + .gap-xxl-0 { + gap:0 !important + } + + .gap-xxl-1 { + gap:.25rem !important + } + + .gap-xxl-2 { + gap:.5rem !important + } + + .gap-xxl-3 { + gap:1rem !important + } + + .gap-xxl-4 { + gap:1.5rem !important + } + + .gap-xxl-5 { + gap:3rem !important + } + + .text-xxl-start { + text-align:left !important + } + + .text-xxl-end { + text-align:right !important + } + + .text-xxl-center { + text-align:center !important + } +} + +@media (min-width: 1200px) { + .fs-1 { + font-size:2.5rem !important + } + + .fs-2 { + font-size:2rem !important + } + + .fs-3 { + font-size:1.75rem !important + } + + .fs-4 { + font-size:1.5rem !important + } +} + +@media print { + .d-print-inline { + display:inline !important + } + + .d-print-inline-block { + display:inline-block !important + } + + .d-print-block { + display:block !important + } + + .d-print-grid { + display:grid !important + } + + .d-print-table { + display:table !important + } + + .d-print-table-row { + display:table-row !important + } + + .d-print-table-cell { + display:table-cell !important + } + + .d-print-flex { + display:flex !important + } + + .d-print-inline-flex { + display:inline-flex !important + } + + .d-print-none { + display:none !important + } +} + +html { + height:100% +} + +body { + height: 100%; + position:relative +} + +body:before { + content: ""; + position: fixed; + top: 0; + left: 0; + height: 100%; + width: 100%; + background-color: var(--body-bg-color); + opacity: .7; + z-index:1 +} + +video.bg-video { + position: fixed; + top: 50%; + left: 50%; + min-width: 100%; + min-height: 100%; + width: auto; + height: auto; + transform: translateX(-50%) translateY(-50%); + z-index:0 +} + +@media (pointer: coarse) and(hover: none) { + body { + background: url("../assets/img/bg-mobile-fallback.jpg") #2a5555 no-repeat center center scroll; + background-size:cover + } + + body video { + display:none + } +} + +.masthead { + position: relative; + overflow: hidden; + z-index: 2; + display: flex; + align-items: center; + justify-content:center +} + +.masthead:before { + content: ""; + position: absolute; + top: 0; + bottom: 0; + right: 0; + left: 0; + height: 100%; + width: 100%; + background-color:var(--masthead-bg-color) +} + +.masthead .masthead-content { + position: relative; + max-width: 40rem; + padding-top: 5rem; + padding-bottom:5rem +} + +.masthead .masthead-content h1, .masthead .masthead-content .h1 { + font-size:2.5rem +} + +.masthead .masthead-content p { + font-size:1.2rem +} + +.masthead .masthead-content p strong { + font-weight:700 +} + +.masthead .masthead-content .input-group-newsletter input { + height: auto; + width: 100%; + font-size: 1rem; + padding:1rem +} + +.masthead .masthead-content .input-group-newsletter button { + font-size: .85rem; + font-weight: 700; + text-transform: uppercase; + letter-spacing: 1px; + padding:calc(1rem + 2px) +} + +@media (min-width: 992px) { + .masthead { + height: 100%; + width: 75vw; + min-height: 0; + padding-bottom:0 + } + + .masthead:before { + transform: skewX(-9deg); + transform-origin:top right + } + + .masthead .masthead-content { + padding-top: 0; + padding-bottom: 0; + padding-left: 2rem; + padding-right:9rem + } + + .masthead .masthead-content h1, .masthead .masthead-content .h1 { + font-size:3.5rem + } + + .masthead .masthead-content p { + font-size:1.3rem + } +} + +@media (min-width: 1200px) { + .masthead { + width:55vw + } +} + +.social-icons { + position: relative; + z-index:10 +} + +.social-icons .btn { + display: inline-flex; + align-items: center; + justify-content: center; + padding: 0; + height: 4rem; + width: 4rem; + border-radius:100rem +} + +@media (min-width: 992px) { + .social-icons { + position: absolute; + height: 100%; + top: 0; + right: 2.5rem; + width:auto + } +} + +.footer { + font-size:.9rem !important +} + +#canvas { + position: absolute; + z-index: 2 +} +/*# sourceMappingURL=style.min.css.map */ \ No newline at end of file diff --git a/Source/ProofOfConcept/wwwroot/assets/img/favicon.ico b/Source/ProofOfConcept/wwwroot/assets/img/favicon.ico new file mode 100644 index 0000000..9356735 Binary files /dev/null and b/Source/ProofOfConcept/wwwroot/assets/img/favicon.ico differ diff --git a/Source/ProofOfConcept/wwwroot/assets/js/main.min.js b/Source/ProofOfConcept/wwwroot/assets/js/main.min.js new file mode 100644 index 0000000..86152ac --- /dev/null +++ b/Source/ProofOfConcept/wwwroot/assets/js/main.min.js @@ -0,0 +1,67 @@ +let c = i('canvas'), + w = (canvas.width = window.innerWidth), + h = (canvas.height = window.innerHeight); +class firefly { + constructor() + { + this.x = Math.random() * w; + this.y = Math.random() * h; + this.s = Math.random() * 2; + this.ang = Math.random() * 2 * Math.PI; + this.v = this.s * this.s / 4 + } + move() + { + this.x += this.v * Math.cos(this.ang); + this.y += this.v * Math.sin(this.ang); + this.ang += Math.random() * 20 * Math.PI / 180 - 10 * Math.PI / 180 + } + show() + { + c.beginPath(); + c.arc(this.x, this.y, this.s, 0, 2 * Math.PI); + c.fillStyle = '#fddba3'; + c.fill() + } +} +let f = []; +function a() { + if (f.length < 500) + for (let j = 0; j < 10; j++) + f.push(new firefly()); + for (let i = 0; i < f.length; i++) { + f[i].move(); + f[i].show(); + f[i].x < 0 || f[i].x > w || f[i].y < 0 || f[i].y > h && f.splice(i, 1) + } +} +let g = {}; +let A = {}; +canvas.addEventListener('mousemove', function(e) { + A.x = g.x; + A.y = g.y; + g.x = e.pageX - this.offsetLeft; + g.y = e.pageY - this.offsetTop +}, !1); +function i(_) { + let b = document.getElementById(_), + c = b.getContext('2d'); + c.fillStyle = 'rgba(30,30,30,1)'; + c.fillRect(0, 0, (b.width = window.innerWidth), (b.height = window.innerHeight)); + return c +} +window.requestAnimFrame = (() => (window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimationFrame || function(B) { + window.setTimeout(B) +})); +function j() { + window.requestAnimFrame(j); + c.clearRect(0, 0, w, h); + a() +} +window.addEventListener('resize', function() { + ((w = canvas.width = window.innerWidth), + (h = canvas.height = window.innerHeight)); + j() +}); +j(); +setInterval(j, 1000 / 60);